徐勤民 il y a 7 mois
Parent
commit
1e1e6bf7e9

+ 2 - 2
Index.ets

@@ -11,8 +11,8 @@ export { AlgorithmHelper } from './src/main/ets/utils/AlgorithmHelper'
 export { AppStorageHelper } from './src/main/ets/utils/AppStorageHelper'
 
 export { PreferencesHelper } from './src/main/ets/utils/PreferencesHelper'
-export { LocalStorageKeys } from './src/main/ets/utils/LocalStorageKeys'
-export { LocalStorageHelper } from './src/main/ets/utils/LocalStorageHelper'
+export { SZYXLocalStorageKeys } from './src/main/ets/utils/SZYXLocalStorageKeys'
+export { SZYXLocalStorageHelper } from './src/main/ets/utils/SZYXLocalStorageHelper'
 
 /**
  * 正则相关

+ 28 - 28
src/main/ets/http/HttpHelper.ts

@@ -1,7 +1,7 @@
 import { ArrayList, HashMap } from '@kit.ArkTS';
 import http from '@ohos.net.http';
-import { LocalStorageHelper } from '../utils/LocalStorageHelper';
-import { LocalStorageKeys } from '../utils/LocalStorageKeys';
+import { SZYXLocalStorageHelper } from '../utils/SZYXLocalStorageHelper';
+import { SZYXLocalStorageKeys } from '../utils/SZYXLocalStorageKeys';
 
 
 type HttpParamsGet = {
@@ -41,8 +41,8 @@ export class HttpHelper {
 
   constructor() {
     this.httpHandlerList = new HashMap<string, http.HttpRequest>();
-    LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-    LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+    SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+    SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
     this.concurrentList.clear()
   }
 
@@ -77,15 +77,15 @@ export class HttpHelper {
       this.httpHandlerList.hasKey(apiNo ?? params.url)) {
         this.httpHandlerList.get(apiNo ?? params.url).destroy()
         this.httpHandlerList.remove(apiNo ?? params.url)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
       }
       let httpRequest = http.createHttp();
 
       if (this.concurrentList.getIndexOf(apiNo ?? params.url) === -1) {
         this.httpHandlerList.set(apiNo ?? params.url, httpRequest)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
       }
 
       const header = {
@@ -115,8 +115,8 @@ export class HttpHelper {
 
           if (this.httpHandlerList.hasKey(apiNo ?? params.url)) {
             this.httpHandlerList.remove(apiNo ?? params.url)
-            LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-            LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+            SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+            SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
           }
           if (data.responseCode === 200) {
             resolve((typeof data.result === 'string' ? JSON.parse(data.result) : data.result) as T)
@@ -130,8 +130,8 @@ export class HttpHelper {
         console.info('=====>' + 'Error:' + JSON.stringify({ err: err, url: params.url, }));
         if (this.httpHandlerList.hasKey(apiNo ?? params.url)) {
           this.httpHandlerList.remove(apiNo ?? params.url)
-          LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-          LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+          SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+          SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
         }
         if (err.message === 'Failed writing received data to disk/application') {
           reject('cancel')
@@ -158,15 +158,15 @@ export class HttpHelper {
       this.httpHandlerList.hasKey(apiNo ?? params.url)) {
         this.httpHandlerList.get(apiNo ?? params.url).destroy()
         this.httpHandlerList.remove(apiNo ?? params.url)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
       }
       let httpRequest = http.createHttp();
 
       if (this.concurrentList.getIndexOf(apiNo ?? params.url) === -1) {
         this.httpHandlerList.set(apiNo ?? params.url, httpRequest)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
       }
 
       const header = {
@@ -198,8 +198,8 @@ export class HttpHelper {
 
           if (this.httpHandlerList.hasKey(apiNo ?? params.url)) {
             this.httpHandlerList.remove(apiNo ?? params.url)
-            LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-            LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+            SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+            SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
           }
           if (data.responseCode === 200) {
             resolve((typeof data.result === 'string' ? JSON.parse(data.result) : data.result) as T)
@@ -213,8 +213,8 @@ export class HttpHelper {
         console.info('=====>' + 'Error:' + JSON.stringify({ err: err, url: params.url, }));
         if (this.httpHandlerList.hasKey(apiNo ?? params.url)) {
           this.httpHandlerList.remove(apiNo ?? params.url)
-          LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-          LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+          SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+          SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
         }
         if (err.message === 'Failed writing received data to disk/application') {
           reject('cancel')
@@ -243,15 +243,15 @@ export class HttpHelper {
       this.httpHandlerList.hasKey(apiNo ?? params.url)) {
         this.httpHandlerList.get(apiNo ?? params.url).destroy()
         this.httpHandlerList.remove(apiNo ?? params.url)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
       }
       let httpRequest = http.createHttp();
 
       if (this.concurrentList.getIndexOf(apiNo ?? params.url) === -1) {
         this.httpHandlerList.set(apiNo ?? params.url, httpRequest)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-        LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+        SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
       }
 
       const header = {
@@ -278,8 +278,8 @@ export class HttpHelper {
 
           if (this.httpHandlerList.hasKey(apiNo ?? params.url)) {
             this.httpHandlerList.remove(apiNo ?? params.url)
-            LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-            LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+            SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+            SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
           }
           if (data.responseCode === 200) {
             resolve((typeof data.result === 'string' ? JSON.parse(data.result) : data.result) as T)
@@ -293,8 +293,8 @@ export class HttpHelper {
         console.info('=====>' + 'Error:' + JSON.stringify({ err: err, url: params.url, }));
         if (this.httpHandlerList.hasKey(apiNo ?? params.url)) {
           this.httpHandlerList.remove(apiNo ?? params.url)
-          LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerList, this.httpHandlerList)
-          LocalStorageHelper.storage.setOrCreate(LocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
+          SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerList, this.httpHandlerList)
+          SZYXLocalStorageHelper.storage.setOrCreate(SZYXLocalStorageKeys.HttpHandlerListLength, this.httpHandlerList.length)
         }
         if (err.message === 'Failed writing received data to disk/application') {
           reject('cancel')

+ 170 - 0
src/main/ets/util/base64Util.js

@@ -0,0 +1,170 @@
+/* eslint-disable no-useless-escape */
+/*************************************************************************************************
+ * <pre>
+ * @包路径:
+ * @版权所有: 北京数字医信科技有限公司 (C) 2019
+ *
+ * @类描述:
+ * @版本:       V3.2.0
+ * @作者        daizhenhong
+ * @创建时间    2019/6/4 3:30 PM
+ *
+ * @修改记录:
+ -----------------------------------------------------------------------------------------------
+ ----------- 时间      |   修改人    |     修改的方法       |         修改描述   ---------------
+ -----------------------------------------------------------------------------------------------
+ </pre>
+ ************************************************************************************************/
+
+/*
+  *  base64编码(编码,配合encodeURIComponent使用)
+  *  @parm : str 传入的字符串
+  *  使用:
+        1、引入util.js(路径更改) :const util  = require('../../utils/util.js');
+        2、util.base64_encode(util.utf16to8('base64 编码'));
+ */
+function base64Encode (str) {
+  // 下面是64个基本的编码
+  let base64EncodeChars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
+  let out, i, len
+  let c1, c2, c3
+  len = str.length
+  i = 0
+  out = ''
+  while (i < len) {
+    c1 = str.charCodeAt(i++) & 0xff
+    if (i === len) {
+      out += base64EncodeChars.charAt(c1 >> 2)
+      out += base64EncodeChars.charAt((c1 & 0x3) << 4)
+      out += '=='
+      break
+    }
+    c2 = str.charCodeAt(i++)
+    if (i === len) {
+      out += base64EncodeChars.charAt(c1 >> 2)
+      out += base64EncodeChars.charAt(((c1 & 0x3) << 4) | ((c2 & 0xF0) >> 4))
+      out += base64EncodeChars.charAt((c2 & 0xF) << 2)
+      out += '='
+      break
+    }
+    c3 = str.charCodeAt(i++)
+    out += base64EncodeChars.charAt(c1 >> 2)
+    out += base64EncodeChars.charAt(((c1 & 0x3) << 4) | ((c2 & 0xF0) >> 4))
+    out += base64EncodeChars.charAt(((c2 & 0xF) << 2) | ((c3 & 0xC0) >> 6))
+    out += base64EncodeChars.charAt(c3 & 0x3F)
+  }
+  return out
+}
+
+/*
+  *  base64编码(编码,配合encodeURIComponent使用)
+  *  @parm : str 传入的字符串
+ */
+function utf16to8 (str) {
+  let out, i, len, c
+  out = ''
+  len = str.length
+  for (i = 0; i < len; i++) {
+    c = str.charCodeAt(i)
+    if ((c >= 0x0001) && (c <= 0x007F)) {
+      out += str.charAt(i)
+    } else if (c > 0x07FF) {
+      out += String.fromCharCode(0xE0 | ((c >> 12) & 0x0F))
+      out += String.fromCharCode(0x80 | ((c >> 6) & 0x3F))
+      out += String.fromCharCode(0x80 | ((c >> 0) & 0x3F))
+    } else {
+      out += String.fromCharCode(0xC0 | ((c >> 6) & 0x1F))
+      out += String.fromCharCode(0x80 | ((c >> 0) & 0x3F))
+    }
+  }
+  return out
+}
+
+/*
+  *  base64解码(配合decodeURIComponent使用)
+  *  @parm : input 传入的字符串
+  *  使用:
+        1、引入util.js(路径更改) :const util  = require('../../utils/util.js');
+        2、util.base64_decode('YmFzZTY0IOe8lueggQ==');
+ */
+function base64Decode (input) {
+  let base64EncodeChars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='
+  let output = ''
+  let chr1, chr2, chr3
+  let enc1, enc2, enc3, enc4
+  let i = 0
+  input = input.replace(/[^A-Za-z0-9\+\/\=]/g, '')
+  while (i < input.length) {
+    enc1 = base64EncodeChars.indexOf(input.charAt(i++))
+    enc2 = base64EncodeChars.indexOf(input.charAt(i++))
+    enc3 = base64EncodeChars.indexOf(input.charAt(i++))
+    enc4 = base64EncodeChars.indexOf(input.charAt(i++))
+    chr1 = (enc1 << 2) | (enc2 >> 4)
+    chr2 = ((enc2 & 15) << 4) | (enc3 >> 2)
+    chr3 = ((enc3 & 3) << 6) | enc4
+    output = output + String.fromCharCode(chr1)
+    if (enc3 !== 64) {
+      output = output + String.fromCharCode(chr2)
+    }
+    if (enc4 !== 64) {
+      output = output + String.fromCharCode(chr3)
+    }
+  }
+  return utf8Decode(output)
+}
+
+/*
+  *  utf-8解码
+  *  @parm : utftext 传入的字符串
+ */
+function utf8Decode (utftext) {
+  let string = ''
+  let i = 0
+  let c = 0
+  let c1 = 0
+  let c2 = 0
+  while (i < utftext.length) {
+    c = utftext.charCodeAt(i)
+    if (c < 128) {
+      string += String.fromCharCode(c)
+      i++
+    } else if ((c > 191) && (c < 224)) {
+      c1 = utftext.charCodeAt(i + 1)
+      string += String.fromCharCode(((c & 31) << 6) | (c1 & 63))
+      i += 2
+    } else {
+      c1 = utftext.charCodeAt(i + 1)
+      c2 = utftext.charCodeAt(i + 2)
+      string += String.fromCharCode(((c & 15) << 12) | ((c1 & 63) << 6) | (c2 & 63))
+      i += 3
+    }
+  }
+  return string
+}
+
+/*
+    * base64编码函数封装
+    * @parm: str(传入要编成base64的内容)
+    * 使用:
+        1、引入util.js(路径更改) :const util  = require('../../utils/util.js');
+        2、util.baseEncode('base64 编码');
+*/
+function baseEncode (str) {
+  return base64Encode(utf16to8(str))
+}
+
+/*
+    * base64解码函数封装
+    * @parm: str(传入要解为正常字体)
+    * 使用:
+        1、引入util.js(路径更改) :const util  = require('../../utils/util.js');
+        2、util.baseDecode(util.baseEncode('base64 编码'))
+*/
+function baseDecode (str) {
+  return base64Decode(str)
+}// 抛出函数使用
+
+export {
+  baseEncode,
+  baseDecode
+}

+ 9 - 0
src/main/ets/util/encodeUtil.js

@@ -0,0 +1,9 @@
+import {JSEncrypt} from './jsencryp.js'
+// 医网信公钥,用于数据加密
+const rsa_public_key = 'MIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDsLnkJaVr5hdNlqPNhU+YW4LctrwuDCeUb+GHS\nPNd/g83nNGibYWqNmYgyVw2jZPTDNrZDw/piWhPsV9iWY0Ie6zuUbrKRQEWBEuQxXhEoRv92nw1B\nWzd7vvOk63Xss7iWqLn8PvE6a4OJC90mWPDQFfiLl49SYbK5QvfD5lY5TQIDAQAB'
+
+export function encodeByRsa(origin) {
+    let jsEncrypt = new JSEncrypt();
+    jsEncrypt.setPublicKey(rsa_public_key)
+    return jsEncrypt.encrypt(origin)
+}

+ 5385 - 0
src/main/ets/util/jsencryp.js

@@ -0,0 +1,5385 @@
+// 由于小程序不支持window对象,所以,需要修改源码。
+// https://blog.csdn.net/qq_34672907/article/details/89605498
+(function (global, factory) {
+	typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :
+	typeof define === 'function' && define.amd ? define(['exports'], factory) :
+	(factory((global.JSEncrypt = {})));
+}(this, (function (exports) { 'use strict';
+
+    // 用来替换 navigator2
+    var navigator2 = {
+        appName: 'Netscape',
+        userAgent: 'Mozilla/5.0 (iPhone; CPU iPhone OS 9_1 like Mac OS X) AppleWebKit/601.1.46 (KHTML, like Gecko) Version/9.0 Mobile/13B143 Safari/601.1'
+    };
+    //  用来替换window2
+    var window2 = {
+        ASN1: null,
+        Base64: null,
+        Hex: null,
+        crypto: null,
+        href: null
+    };
+    //--------- 这里结束添加--------
+
+var BI_RM = "0123456789abcdefghijklmnopqrstuvwxyz";
+function int2char(n) {
+    return BI_RM.charAt(n);
+}
+//#region BIT_OPERATIONS
+// (public) this & a
+function op_and(x, y) {
+    return x & y;
+}
+// (public) this | a
+function op_or(x, y) {
+    return x | y;
+}
+// (public) this ^ a
+function op_xor(x, y) {
+    return x ^ y;
+}
+// (public) this & ~a
+function op_andnot(x, y) {
+    return x & ~y;
+}
+// return index of lowest 1-bit in x, x < 2^31
+function lbit(x) {
+    if (x == 0) {
+        return -1;
+    }
+    var r = 0;
+    if ((x & 0xffff) == 0) {
+        x >>= 16;
+        r += 16;
+    }
+    if ((x & 0xff) == 0) {
+        x >>= 8;
+        r += 8;
+    }
+    if ((x & 0xf) == 0) {
+        x >>= 4;
+        r += 4;
+    }
+    if ((x & 3) == 0) {
+        x >>= 2;
+        r += 2;
+    }
+    if ((x & 1) == 0) {
+        ++r;
+    }
+    return r;
+}
+// return number of 1 bits in x
+function cbit(x) {
+    var r = 0;
+    while (x != 0) {
+        x &= x - 1;
+        ++r;
+    }
+    return r;
+}
+//#endregion BIT_OPERATIONS
+
+var b64map = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+var b64pad = "=";
+function hex2b64(h) {
+    var i;
+    var c;
+    var ret = "";
+    for (i = 0; i + 3 <= h.length; i += 3) {
+        c = parseInt(h.substring(i, i + 3), 16);
+        ret += b64map.charAt(c >> 6) + b64map.charAt(c & 63);
+    }
+    if (i + 1 == h.length) {
+        c = parseInt(h.substring(i, i + 1), 16);
+        ret += b64map.charAt(c << 2);
+    }
+    else if (i + 2 == h.length) {
+        c = parseInt(h.substring(i, i + 2), 16);
+        ret += b64map.charAt(c >> 2) + b64map.charAt((c & 3) << 4);
+    }
+    while ((ret.length & 3) > 0) {
+        ret += b64pad;
+    }
+    return ret;
+}
+// convert a base64 string to hex
+function b64tohex(s) {
+    var ret = "";
+    var i;
+    var k = 0; // b64 state, 0-3
+    var slop = 0;
+    for (i = 0; i < s.length; ++i) {
+        if (s.charAt(i) == b64pad) {
+            break;
+        }
+        var v = b64map.indexOf(s.charAt(i));
+        if (v < 0) {
+            continue;
+        }
+        if (k == 0) {
+            ret += int2char(v >> 2);
+            slop = v & 3;
+            k = 1;
+        }
+        else if (k == 1) {
+            ret += int2char((slop << 2) | (v >> 4));
+            slop = v & 0xf;
+            k = 2;
+        }
+        else if (k == 2) {
+            ret += int2char(slop);
+            ret += int2char(v >> 2);
+            slop = v & 3;
+            k = 3;
+        }
+        else {
+            ret += int2char((slop << 2) | (v >> 4));
+            ret += int2char(v & 0xf);
+            k = 0;
+        }
+    }
+    if (k == 1) {
+        ret += int2char(slop << 2);
+    }
+    return ret;
+}
+
+/*! *****************************************************************************
+Copyright (c) Microsoft Corporation. All rights reserved.
+Licensed under the Apache License, Version 2.0 (the "License"); you may not use
+this file except in compliance with the License. You may obtain a copy of the
+License at http://www.apache.org/licenses/LICENSE-2.0
+THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED
+WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE,
+MERCHANTABLITY OR NON-INFRINGEMENT.
+See the Apache Version 2.0 License for specific language governing permissions
+and limitations under the License.
+***************************************************************************** */
+/* global Reflect, Promise */
+
+var extendStatics = function(d, b) {
+    extendStatics = Object.setPrototypeOf ||
+        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
+        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
+    return extendStatics(d, b);
+};
+
+function __extends(d, b) {
+    extendStatics(d, b);
+    function __() { this.constructor = d; }
+    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
+}
+
+// Hex JavaScript decoder
+// Copyright (c) 2008-2013 Lapo Luchini <lapo@lapo.it>
+// Permission to use, copy, modify, and/or distribute this software for any
+// purpose with or without fee is hereby granted, provided that the above
+// copyright notice and this permission notice appear in all copies.
+//
+// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+/*jshint browser: true, strict: true, immed: true, latedef: true, undef: true, regexdash: false */
+var decoder;
+var Hex = {
+    decode: function (a) {
+        var i;
+        if (decoder === undefined) {
+            var hex = "0123456789ABCDEF";
+            var ignore = " \f\n\r\t\u00A0\u2028\u2029";
+            decoder = {};
+            for (i = 0; i < 16; ++i) {
+                decoder[hex.charAt(i)] = i;
+            }
+            hex = hex.toLowerCase();
+            for (i = 10; i < 16; ++i) {
+                decoder[hex.charAt(i)] = i;
+            }
+            for (i = 0; i < ignore.length; ++i) {
+                decoder[ignore.charAt(i)] = -1;
+            }
+        }
+        var out = [];
+        var bits = 0;
+        var char_count = 0;
+        for (i = 0; i < a.length; ++i) {
+            var c = a.charAt(i);
+            if (c == "=") {
+                break;
+            }
+            c = decoder[c];
+            if (c == -1) {
+                continue;
+            }
+            if (c === undefined) {
+                throw new Error("Illegal character at offset " + i);
+            }
+            bits |= c;
+            if (++char_count >= 2) {
+                out[out.length] = bits;
+                bits = 0;
+                char_count = 0;
+            }
+            else {
+                bits <<= 4;
+            }
+        }
+        if (char_count) {
+            throw new Error("Hex encoding incomplete: 4 bits missing");
+        }
+        return out;
+    }
+};
+
+// Base64 JavaScript decoder
+// Copyright (c) 2008-2013 Lapo Luchini <lapo@lapo.it>
+// Permission to use, copy, modify, and/or distribute this software for any
+// purpose with or without fee is hereby granted, provided that the above
+// copyright notice and this permission notice appear in all copies.
+//
+// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+/*jshint browser: true, strict: true, immed: true, latedef: true, undef: true, regexdash: false */
+var decoder$1;
+var Base64 = {
+    decode: function (a) {
+        var i;
+        if (decoder$1 === undefined) {
+            var b64 = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+            var ignore = "= \f\n\r\t\u00A0\u2028\u2029";
+            decoder$1 = Object.create(null);
+            for (i = 0; i < 64; ++i) {
+                decoder$1[b64.charAt(i)] = i;
+            }
+            for (i = 0; i < ignore.length; ++i) {
+                decoder$1[ignore.charAt(i)] = -1;
+            }
+        }
+        var out = [];
+        var bits = 0;
+        var char_count = 0;
+        for (i = 0; i < a.length; ++i) {
+            var c = a.charAt(i);
+            if (c == "=") {
+                break;
+            }
+            c = decoder$1[c];
+            if (c == -1) {
+                continue;
+            }
+            if (c === undefined) {
+                throw new Error("Illegal character at offset " + i);
+            }
+            bits |= c;
+            if (++char_count >= 4) {
+                out[out.length] = (bits >> 16);
+                out[out.length] = (bits >> 8) & 0xFF;
+                out[out.length] = bits & 0xFF;
+                bits = 0;
+                char_count = 0;
+            }
+            else {
+                bits <<= 6;
+            }
+        }
+        switch (char_count) {
+            case 1:
+                throw new Error("Base64 encoding incomplete: at least 2 bits missing");
+            case 2:
+                out[out.length] = (bits >> 10);
+                break;
+            case 3:
+                out[out.length] = (bits >> 16);
+                out[out.length] = (bits >> 8) & 0xFF;
+                break;
+        }
+        return out;
+    },
+    re: /-----BEGIN [^-]+-----([A-Za-z0-9+\/=\s]+)-----END [^-]+-----|begin-base64[^\n]+\n([A-Za-z0-9+\/=\s]+)====/,
+    unarmor: function (a) {
+        var m = Base64.re.exec(a);
+        if (m) {
+            if (m[1]) {
+                a = m[1];
+            }
+            else if (m[2]) {
+                a = m[2];
+            }
+            else {
+                throw new Error("RegExp out of sync");
+            }
+        }
+        return Base64.decode(a);
+    }
+};
+
+// Big integer base-10 printing library
+// Copyright (c) 2014 Lapo Luchini <lapo@lapo.it>
+// Permission to use, copy, modify, and/or distribute this software for any
+// purpose with or without fee is hereby granted, provided that the above
+// copyright notice and this permission notice appear in all copies.
+//
+// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+/*jshint browser: true, strict: true, immed: true, latedef: true, undef: true, regexdash: false */
+var max = 10000000000000; // biggest integer that can still fit 2^53 when multiplied by 256
+var Int10 = /** @class */ (function () {
+    function Int10(value) {
+        this.buf = [+value || 0];
+    }
+    Int10.prototype.mulAdd = function (m, c) {
+        // assert(m <= 256)
+        var b = this.buf;
+        var l = b.length;
+        var i;
+        var t;
+        for (i = 0; i < l; ++i) {
+            t = b[i] * m + c;
+            if (t < max) {
+                c = 0;
+            }
+            else {
+                c = 0 | (t / max);
+                t -= c * max;
+            }
+            b[i] = t;
+        }
+        if (c > 0) {
+            b[i] = c;
+        }
+    };
+    Int10.prototype.sub = function (c) {
+        // assert(m <= 256)
+        var b = this.buf;
+        var l = b.length;
+        var i;
+        var t;
+        for (i = 0; i < l; ++i) {
+            t = b[i] - c;
+            if (t < 0) {
+                t += max;
+                c = 1;
+            }
+            else {
+                c = 0;
+            }
+            b[i] = t;
+        }
+        while (b[b.length - 1] === 0) {
+            b.pop();
+        }
+    };
+    Int10.prototype.toString = function (base) {
+        if ((base || 10) != 10) {
+            throw new Error("only base 10 is supported");
+        }
+        var b = this.buf;
+        var s = b[b.length - 1].toString();
+        for (var i = b.length - 2; i >= 0; --i) {
+            s += (max + b[i]).toString().substring(1);
+        }
+        return s;
+    };
+    Int10.prototype.valueOf = function () {
+        var b = this.buf;
+        var v = 0;
+        for (var i = b.length - 1; i >= 0; --i) {
+            v = v * max + b[i];
+        }
+        return v;
+    };
+    Int10.prototype.simplify = function () {
+        var b = this.buf;
+        return (b.length == 1) ? b[0] : this;
+    };
+    return Int10;
+}());
+
+// ASN.1 JavaScript decoder
+var ellipsis = "\u2026";
+var reTimeS = /^(\d\d)(0[1-9]|1[0-2])(0[1-9]|[12]\d|3[01])([01]\d|2[0-3])(?:([0-5]\d)(?:([0-5]\d)(?:[.,](\d{1,3}))?)?)?(Z|[-+](?:[0]\d|1[0-2])([0-5]\d)?)?$/;
+var reTimeL = /^(\d\d\d\d)(0[1-9]|1[0-2])(0[1-9]|[12]\d|3[01])([01]\d|2[0-3])(?:([0-5]\d)(?:([0-5]\d)(?:[.,](\d{1,3}))?)?)?(Z|[-+](?:[0]\d|1[0-2])([0-5]\d)?)?$/;
+function stringCut(str, len) {
+    if (str.length > len) {
+        str = str.substring(0, len) + ellipsis;
+    }
+    return str;
+}
+var Stream = /** @class */ (function () {
+    function Stream(enc, pos) {
+        this.hexDigits = "0123456789ABCDEF";
+        if (enc instanceof Stream) {
+            this.enc = enc.enc;
+            this.pos = enc.pos;
+        }
+        else {
+            // enc should be an array or a binary string
+            this.enc = enc;
+            this.pos = pos;
+        }
+    }
+    Stream.prototype.get = function (pos) {
+        if (pos === undefined) {
+            pos = this.pos++;
+        }
+        if (pos >= this.enc.length) {
+            throw new Error("Requesting byte offset " + pos + " on a stream of length " + this.enc.length);
+        }
+        return ("string" === typeof this.enc) ? this.enc.charCodeAt(pos) : this.enc[pos];
+    };
+    Stream.prototype.hexByte = function (b) {
+        return this.hexDigits.charAt((b >> 4) & 0xF) + this.hexDigits.charAt(b & 0xF);
+    };
+    Stream.prototype.hexDump = function (start, end, raw) {
+        var s = "";
+        for (var i = start; i < end; ++i) {
+            s += this.hexByte(this.get(i));
+            if (raw !== true) {
+                switch (i & 0xF) {
+                    case 0x7:
+                        s += "  ";
+                        break;
+                    case 0xF:
+                        s += "\n";
+                        break;
+                    default:
+                        s += " ";
+                }
+            }
+        }
+        return s;
+    };
+    Stream.prototype.isASCII = function (start, end) {
+        for (var i = start; i < end; ++i) {
+            var c = this.get(i);
+            if (c < 32 || c > 176) {
+                return false;
+            }
+        }
+        return true;
+    };
+    Stream.prototype.parseStringISO = function (start, end) {
+        var s = "";
+        for (var i = start; i < end; ++i) {
+            s += String.fromCharCode(this.get(i));
+        }
+        return s;
+    };
+    Stream.prototype.parseStringUTF = function (start, end) {
+        var s = "";
+        for (var i = start; i < end;) {
+            var c = this.get(i++);
+            if (c < 128) {
+                s += String.fromCharCode(c);
+            }
+            else if ((c > 191) && (c < 224)) {
+                s += String.fromCharCode(((c & 0x1F) << 6) | (this.get(i++) & 0x3F));
+            }
+            else {
+                s += String.fromCharCode(((c & 0x0F) << 12) | ((this.get(i++) & 0x3F) << 6) | (this.get(i++) & 0x3F));
+            }
+        }
+        return s;
+    };
+    Stream.prototype.parseStringBMP = function (start, end) {
+        var str = "";
+        var hi;
+        var lo;
+        for (var i = start; i < end;) {
+            hi = this.get(i++);
+            lo = this.get(i++);
+            str += String.fromCharCode((hi << 8) | lo);
+        }
+        return str;
+    };
+    Stream.prototype.parseTime = function (start, end, shortYear) {
+        var s = this.parseStringISO(start, end);
+        var m = (shortYear ? reTimeS : reTimeL).exec(s);
+        if (!m) {
+            return "Unrecognized time: " + s;
+        }
+        if (shortYear) {
+            // to avoid querying the timer, use the fixed range [1970, 2069]
+            // it will conform with ITU X.400 [-10, +40] sliding window2 until 2030
+            m[1] = +m[1];
+            m[1] += (+m[1] < 70) ? 2000 : 1900;
+        }
+        s = m[1] + "-" + m[2] + "-" + m[3] + " " + m[4];
+        if (m[5]) {
+            s += ":" + m[5];
+            if (m[6]) {
+                s += ":" + m[6];
+                if (m[7]) {
+                    s += "." + m[7];
+                }
+            }
+        }
+        if (m[8]) {
+            s += " UTC";
+            if (m[8] != "Z") {
+                s += m[8];
+                if (m[9]) {
+                    s += ":" + m[9];
+                }
+            }
+        }
+        return s;
+    };
+    Stream.prototype.parseInteger = function (start, end) {
+        var v = this.get(start);
+        var neg = (v > 127);
+        var pad = neg ? 255 : 0;
+        var len;
+        var s = "";
+        // skip unuseful bits (not allowed in DER)
+        while (v == pad && ++start < end) {
+            v = this.get(start);
+        }
+        len = end - start;
+        if (len === 0) {
+            return neg ? -1 : 0;
+        }
+        // show bit length of huge integers
+        if (len > 4) {
+            s = v;
+            len <<= 3;
+            while (((+s ^ pad) & 0x80) == 0) {
+                s = +s << 1;
+                --len;
+            }
+            s = "(" + len + " bit)\n";
+        }
+        // decode the integer
+        if (neg) {
+            v = v - 256;
+        }
+        var n = new Int10(v);
+        for (var i = start + 1; i < end; ++i) {
+            n.mulAdd(256, this.get(i));
+        }
+        return s + n.toString();
+    };
+    Stream.prototype.parseBitString = function (start, end, maxLength) {
+        var unusedBit = this.get(start);
+        var lenBit = ((end - start - 1) << 3) - unusedBit;
+        var intro = "(" + lenBit + " bit)\n";
+        var s = "";
+        for (var i = start + 1; i < end; ++i) {
+            var b = this.get(i);
+            var skip = (i == end - 1) ? unusedBit : 0;
+            for (var j = 7; j >= skip; --j) {
+                s += (b >> j) & 1 ? "1" : "0";
+            }
+            if (s.length > maxLength) {
+                return intro + stringCut(s, maxLength);
+            }
+        }
+        return intro + s;
+    };
+    Stream.prototype.parseOctetString = function (start, end, maxLength) {
+        if (this.isASCII(start, end)) {
+            return stringCut(this.parseStringISO(start, end), maxLength);
+        }
+        var len = end - start;
+        var s = "(" + len + " byte)\n";
+        maxLength /= 2; // we work in bytes
+        if (len > maxLength) {
+            end = start + maxLength;
+        }
+        for (var i = start; i < end; ++i) {
+            s += this.hexByte(this.get(i));
+        }
+        if (len > maxLength) {
+            s += ellipsis;
+        }
+        return s;
+    };
+    Stream.prototype.parseOID = function (start, end, maxLength) {
+        var s = "";
+        var n = new Int10();
+        var bits = 0;
+        for (var i = start; i < end; ++i) {
+            var v = this.get(i);
+            n.mulAdd(128, v & 0x7F);
+            bits += 7;
+            if (!(v & 0x80)) { // finished
+                if (s === "") {
+                    n = n.simplify();
+                    if (n instanceof Int10) {
+                        n.sub(80);
+                        s = "2." + n.toString();
+                    }
+                    else {
+                        var m = n < 80 ? n < 40 ? 0 : 1 : 2;
+                        s = m + "." + (n - m * 40);
+                    }
+                }
+                else {
+                    s += "." + n.toString();
+                }
+                if (s.length > maxLength) {
+                    return stringCut(s, maxLength);
+                }
+                n = new Int10();
+                bits = 0;
+            }
+        }
+        if (bits > 0) {
+            s += ".incomplete";
+        }
+        return s;
+    };
+    return Stream;
+}());
+var ASN1 = /** @class */ (function () {
+    function ASN1(stream, header, length, tag, sub) {
+        if (!(tag instanceof ASN1Tag)) {
+            throw new Error("Invalid tag value.");
+        }
+        this.stream = stream;
+        this.header = header;
+        this.length = length;
+        this.tag = tag;
+        this.sub = sub;
+    }
+    ASN1.prototype.typeName = function () {
+        switch (this.tag.tagClass) {
+            case 0: // universal
+                switch (this.tag.tagNumber) {
+                    case 0x00:
+                        return "EOC";
+                    case 0x01:
+                        return "BOOLEAN";
+                    case 0x02:
+                        return "INTEGER";
+                    case 0x03:
+                        return "BIT_STRING";
+                    case 0x04:
+                        return "OCTET_STRING";
+                    case 0x05:
+                        return "NULL";
+                    case 0x06:
+                        return "OBJECT_IDENTIFIER";
+                    case 0x07:
+                        return "ObjectDescriptor";
+                    case 0x08:
+                        return "EXTERNAL";
+                    case 0x09:
+                        return "REAL";
+                    case 0x0A:
+                        return "ENUMERATED";
+                    case 0x0B:
+                        return "EMBEDDED_PDV";
+                    case 0x0C:
+                        return "UTF8String";
+                    case 0x10:
+                        return "SEQUENCE";
+                    case 0x11:
+                        return "SET";
+                    case 0x12:
+                        return "NumericString";
+                    case 0x13:
+                        return "PrintableString"; // ASCII subset
+                    case 0x14:
+                        return "TeletexString"; // aka T61String
+                    case 0x15:
+                        return "VideotexString";
+                    case 0x16:
+                        return "IA5String"; // ASCII
+                    case 0x17:
+                        return "UTCTime";
+                    case 0x18:
+                        return "GeneralizedTime";
+                    case 0x19:
+                        return "GraphicString";
+                    case 0x1A:
+                        return "VisibleString"; // ASCII subset
+                    case 0x1B:
+                        return "GeneralString";
+                    case 0x1C:
+                        return "UniversalString";
+                    case 0x1E:
+                        return "BMPString";
+                }
+                return "Universal_" + this.tag.tagNumber.toString();
+            case 1:
+                return "Application_" + this.tag.tagNumber.toString();
+            case 2:
+                return "[" + this.tag.tagNumber.toString() + "]"; // Context
+            case 3:
+                return "Private_" + this.tag.tagNumber.toString();
+        }
+    };
+    ASN1.prototype.content = function (maxLength) {
+        if (this.tag === undefined) {
+            return null;
+        }
+        if (maxLength === undefined) {
+            maxLength = Infinity;
+        }
+        var content = this.posContent();
+        var len = Math.abs(this.length);
+        if (!this.tag.isUniversal()) {
+            if (this.sub !== null) {
+                return "(" + this.sub.length + " elem)";
+            }
+            return this.stream.parseOctetString(content, content + len, maxLength);
+        }
+        switch (this.tag.tagNumber) {
+            case 0x01: // BOOLEAN
+                return (this.stream.get(content) === 0) ? "false" : "true";
+            case 0x02: // INTEGER
+                return this.stream.parseInteger(content, content + len);
+            case 0x03: // BIT_STRING
+                return this.sub ? "(" + this.sub.length + " elem)" :
+                    this.stream.parseBitString(content, content + len, maxLength);
+            case 0x04: // OCTET_STRING
+                return this.sub ? "(" + this.sub.length + " elem)" :
+                    this.stream.parseOctetString(content, content + len, maxLength);
+            // case 0x05: // NULL
+            case 0x06: // OBJECT_IDENTIFIER
+                return this.stream.parseOID(content, content + len, maxLength);
+            // case 0x07: // ObjectDescriptor
+            // case 0x08: // EXTERNAL
+            // case 0x09: // REAL
+            // case 0x0A: // ENUMERATED
+            // case 0x0B: // EMBEDDED_PDV
+            case 0x10: // SEQUENCE
+            case 0x11: // SET
+                if (this.sub !== null) {
+                    return "(" + this.sub.length + " elem)";
+                }
+                else {
+                    return "(no elem)";
+                }
+            case 0x0C: // UTF8String
+                return stringCut(this.stream.parseStringUTF(content, content + len), maxLength);
+            case 0x12: // NumericString
+            case 0x13: // PrintableString
+            case 0x14: // TeletexString
+            case 0x15: // VideotexString
+            case 0x16: // IA5String
+            // case 0x19: // GraphicString
+            case 0x1A: // VisibleString
+                // case 0x1B: // GeneralString
+                // case 0x1C: // UniversalString
+                return stringCut(this.stream.parseStringISO(content, content + len), maxLength);
+            case 0x1E: // BMPString
+                return stringCut(this.stream.parseStringBMP(content, content + len), maxLength);
+            case 0x17: // UTCTime
+            case 0x18: // GeneralizedTime
+                return this.stream.parseTime(content, content + len, (this.tag.tagNumber == 0x17));
+        }
+        return null;
+    };
+    ASN1.prototype.toString = function () {
+        return this.typeName() + "@" + this.stream.pos + "[header:" + this.header + ",length:" + this.length + ",sub:" + ((this.sub === null) ? "null" : this.sub.length) + "]";
+    };
+    ASN1.prototype.toPrettyString = function (indent) {
+        if (indent === undefined) {
+            indent = "";
+        }
+        var s = indent + this.typeName() + " @" + this.stream.pos;
+        if (this.length >= 0) {
+            s += "+";
+        }
+        s += this.length;
+        if (this.tag.tagConstructed) {
+            s += " (constructed)";
+        }
+        else if ((this.tag.isUniversal() && ((this.tag.tagNumber == 0x03) || (this.tag.tagNumber == 0x04))) && (this.sub !== null)) {
+            s += " (encapsulates)";
+        }
+        s += "\n";
+        if (this.sub !== null) {
+            indent += "  ";
+            for (var i = 0, max = this.sub.length; i < max; ++i) {
+                s += this.sub[i].toPrettyString(indent);
+            }
+        }
+        return s;
+    };
+    ASN1.prototype.posStart = function () {
+        return this.stream.pos;
+    };
+    ASN1.prototype.posContent = function () {
+        return this.stream.pos + this.header;
+    };
+    ASN1.prototype.posEnd = function () {
+        return this.stream.pos + this.header + Math.abs(this.length);
+    };
+    ASN1.prototype.toHexString = function () {
+        return this.stream.hexDump(this.posStart(), this.posEnd(), true);
+    };
+    ASN1.decodeLength = function (stream) {
+        var buf = stream.get();
+        var len = buf & 0x7F;
+        if (len == buf) {
+            return len;
+        }
+        // no reason to use Int10, as it would be a huge buffer anyways
+        if (len > 6) {
+            throw new Error("Length over 48 bits not supported at position " + (stream.pos - 1));
+        }
+        if (len === 0) {
+            return null;
+        } // undefined
+        buf = 0;
+        for (var i = 0; i < len; ++i) {
+            buf = (buf * 256) + stream.get();
+        }
+        return buf;
+    };
+    /**
+     * Retrieve the hexadecimal value (as a string) of the current ASN.1 element
+     * @returns {string}
+     * @public
+     */
+    ASN1.prototype.getHexStringValue = function () {
+        var hexString = this.toHexString();
+        var offset = this.header * 2;
+        var length = this.length * 2;
+        return hexString.substr(offset, length);
+    };
+    ASN1.decode = function (str) {
+        var stream;
+        if (!(str instanceof Stream)) {
+            stream = new Stream(str, 0);
+        }
+        else {
+            stream = str;
+        }
+        var streamStart = new Stream(stream);
+        var tag = new ASN1Tag(stream);
+        var len = ASN1.decodeLength(stream);
+        var start = stream.pos;
+        var header = start - streamStart.pos;
+        var sub = null;
+        var getSub = function () {
+            var ret = [];
+            if (len !== null) {
+                // definite length
+                var end = start + len;
+                while (stream.pos < end) {
+                    ret[ret.length] = ASN1.decode(stream);
+                }
+                if (stream.pos != end) {
+                    throw new Error("Content size is not correct for container starting at offset " + start);
+                }
+            }
+            else {
+                // undefined length
+                try {
+                    for (;;) {
+                        var s = ASN1.decode(stream);
+                        if (s.tag.isEOC()) {
+                            break;
+                        }
+                        ret[ret.length] = s;
+                    }
+                    len = start - stream.pos; // undefined lengths are represented as negative values
+                }
+                catch (e) {
+                    throw new Error("Exception while decoding undefined length content: " + e);
+                }
+            }
+            return ret;
+        };
+        if (tag.tagConstructed) {
+            // must have valid content
+            sub = getSub();
+        }
+        else if (tag.isUniversal() && ((tag.tagNumber == 0x03) || (tag.tagNumber == 0x04))) {
+            // sometimes BitString and OctetString are used to encapsulate ASN.1
+            try {
+                if (tag.tagNumber == 0x03) {
+                    if (stream.get() != 0) {
+                        throw new Error("BIT STRINGs with unused bits cannot encapsulate.");
+                    }
+                }
+                sub = getSub();
+                for (var i = 0; i < sub.length; ++i) {
+                    if (sub[i].tag.isEOC()) {
+                        throw new Error("EOC is not supposed to be actual content.");
+                    }
+                }
+            }
+            catch (e) {
+                // but silently ignore when they don't
+                sub = null;
+            }
+        }
+        if (sub === null) {
+            if (len === null) {
+                throw new Error("We can't skip over an invalid tag with undefined length at offset " + start);
+            }
+            stream.pos = start + Math.abs(len);
+        }
+        return new ASN1(streamStart, header, len, tag, sub);
+    };
+    return ASN1;
+}());
+var ASN1Tag = /** @class */ (function () {
+    function ASN1Tag(stream) {
+        var buf = stream.get();
+        this.tagClass = buf >> 6;
+        this.tagConstructed = ((buf & 0x20) !== 0);
+        this.tagNumber = buf & 0x1F;
+        if (this.tagNumber == 0x1F) { // long tag
+            var n = new Int10();
+            do {
+                buf = stream.get();
+                n.mulAdd(128, buf & 0x7F);
+            } while (buf & 0x80);
+            this.tagNumber = n.simplify();
+        }
+    }
+    ASN1Tag.prototype.isUniversal = function () {
+        return this.tagClass === 0x00;
+    };
+    ASN1Tag.prototype.isEOC = function () {
+        return this.tagClass === 0x00 && this.tagNumber === 0x00;
+    };
+    return ASN1Tag;
+}());
+
+// Copyright (c) 2005  Tom Wu
+// Bits per digit
+var dbits;
+// JavaScript engine analysis
+var canary = 0xdeadbeefcafe;
+var j_lm = ((canary & 0xffffff) == 0xefcafe);
+//#region
+var lowprimes = [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97, 101, 103, 107, 109, 113, 127, 131, 137, 139, 149, 151, 157, 163, 167, 173, 179, 181, 191, 193, 197, 199, 211, 223, 227, 229, 233, 239, 241, 251, 257, 263, 269, 271, 277, 281, 283, 293, 307, 311, 313, 317, 331, 337, 347, 349, 353, 359, 367, 373, 379, 383, 389, 397, 401, 409, 419, 421, 431, 433, 439, 443, 449, 457, 461, 463, 467, 479, 487, 491, 499, 503, 509, 521, 523, 541, 547, 557, 563, 569, 571, 577, 587, 593, 599, 601, 607, 613, 617, 619, 631, 641, 643, 647, 653, 659, 661, 673, 677, 683, 691, 701, 709, 719, 727, 733, 739, 743, 751, 757, 761, 769, 773, 787, 797, 809, 811, 821, 823, 827, 829, 839, 853, 857, 859, 863, 877, 881, 883, 887, 907, 911, 919, 929, 937, 941, 947, 953, 967, 971, 977, 983, 991, 997];
+var lplim = (1 << 26) / lowprimes[lowprimes.length - 1];
+//#endregion
+// (public) Constructor
+var BigInteger = /** @class */ (function () {
+    function BigInteger(a, b, c) {
+        if (a != null) {
+            if ("number" == typeof a) {
+                this.fromNumber(a, b, c);
+            }
+            else if (b == null && "string" != typeof a) {
+                this.fromString(a, 256);
+            }
+            else {
+                this.fromString(a, b);
+            }
+        }
+    }
+    //#region PUBLIC
+    // BigInteger.prototype.toString = bnToString;
+    // (public) return string representation in given radix
+    BigInteger.prototype.toString = function (b) {
+        if (this.s < 0) {
+            return "-" + this.negate().toString(b);
+        }
+        var k;
+        if (b == 16) {
+            k = 4;
+        }
+        else if (b == 8) {
+            k = 3;
+        }
+        else if (b == 2) {
+            k = 1;
+        }
+        else if (b == 32) {
+            k = 5;
+        }
+        else if (b == 4) {
+            k = 2;
+        }
+        else {
+            return this.toRadix(b);
+        }
+        var km = (1 << k) - 1;
+        var d;
+        var m = false;
+        var r = "";
+        var i = this.t;
+        var p = this.DB - (i * this.DB) % k;
+        if (i-- > 0) {
+            if (p < this.DB && (d = this[i] >> p) > 0) {
+                m = true;
+                r = int2char(d);
+            }
+            while (i >= 0) {
+                if (p < k) {
+                    d = (this[i] & ((1 << p) - 1)) << (k - p);
+                    d |= this[--i] >> (p += this.DB - k);
+                }
+                else {
+                    d = (this[i] >> (p -= k)) & km;
+                    if (p <= 0) {
+                        p += this.DB;
+                        --i;
+                    }
+                }
+                if (d > 0) {
+                    m = true;
+                }
+                if (m) {
+                    r += int2char(d);
+                }
+            }
+        }
+        return m ? r : "0";
+    };
+    // BigInteger.prototype.negate = bnNegate;
+    // (public) -this
+    BigInteger.prototype.negate = function () {
+        var r = nbi();
+        BigInteger.ZERO.subTo(this, r);
+        return r;
+    };
+    // BigInteger.prototype.abs = bnAbs;
+    // (public) |this|
+    BigInteger.prototype.abs = function () {
+        return (this.s < 0) ? this.negate() : this;
+    };
+    // BigInteger.prototype.compareTo = bnCompareTo;
+    // (public) return + if this > a, - if this < a, 0 if equal
+    BigInteger.prototype.compareTo = function (a) {
+        var r = this.s - a.s;
+        if (r != 0) {
+            return r;
+        }
+        var i = this.t;
+        r = i - a.t;
+        if (r != 0) {
+            return (this.s < 0) ? -r : r;
+        }
+        while (--i >= 0) {
+            if ((r = this[i] - a[i]) != 0) {
+                return r;
+            }
+        }
+        return 0;
+    };
+    // BigInteger.prototype.bitLength = bnBitLength;
+    // (public) return the number of bits in "this"
+    BigInteger.prototype.bitLength = function () {
+        if (this.t <= 0) {
+            return 0;
+        }
+        return this.DB * (this.t - 1) + nbits(this[this.t - 1] ^ (this.s & this.DM));
+    };
+    // BigInteger.prototype.mod = bnMod;
+    // (public) this mod a
+    BigInteger.prototype.mod = function (a) {
+        var r = nbi();
+        this.abs().divRemTo(a, null, r);
+        if (this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) {
+            a.subTo(r, r);
+        }
+        return r;
+    };
+    // BigInteger.prototype.modPowInt = bnModPowInt;
+    // (public) this^e % m, 0 <= e < 2^32
+    BigInteger.prototype.modPowInt = function (e, m) {
+        var z;
+        if (e < 256 || m.isEven()) {
+            z = new Classic(m);
+        }
+        else {
+            z = new Montgomery(m);
+        }
+        return this.exp(e, z);
+    };
+    // BigInteger.prototype.clone = bnClone;
+    // (public)
+    BigInteger.prototype.clone = function () {
+        var r = nbi();
+        this.copyTo(r);
+        return r;
+    };
+    // BigInteger.prototype.intValue = bnIntValue;
+    // (public) return value as integer
+    BigInteger.prototype.intValue = function () {
+        if (this.s < 0) {
+            if (this.t == 1) {
+                return this[0] - this.DV;
+            }
+            else if (this.t == 0) {
+                return -1;
+            }
+        }
+        else if (this.t == 1) {
+            return this[0];
+        }
+        else if (this.t == 0) {
+            return 0;
+        }
+        // assumes 16 < DB < 32
+        return ((this[1] & ((1 << (32 - this.DB)) - 1)) << this.DB) | this[0];
+    };
+    // BigInteger.prototype.byteValue = bnByteValue;
+    // (public) return value as byte
+    BigInteger.prototype.byteValue = function () {
+        return (this.t == 0) ? this.s : (this[0] << 24) >> 24;
+    };
+    // BigInteger.prototype.shortValue = bnShortValue;
+    // (public) return value as short (assumes DB>=16)
+    BigInteger.prototype.shortValue = function () {
+        return (this.t == 0) ? this.s : (this[0] << 16) >> 16;
+    };
+    // BigInteger.prototype.signum = bnSigNum;
+    // (public) 0 if this == 0, 1 if this > 0
+    BigInteger.prototype.signum = function () {
+        if (this.s < 0) {
+            return -1;
+        }
+        else if (this.t <= 0 || (this.t == 1 && this[0] <= 0)) {
+            return 0;
+        }
+        else {
+            return 1;
+        }
+    };
+    // BigInteger.prototype.toByteArray = bnToByteArray;
+    // (public) convert to bigendian byte array
+    BigInteger.prototype.toByteArray = function () {
+        var i = this.t;
+        var r = [];
+        r[0] = this.s;
+        var p = this.DB - (i * this.DB) % 8;
+        var d;
+        var k = 0;
+        if (i-- > 0) {
+            if (p < this.DB && (d = this[i] >> p) != (this.s & this.DM) >> p) {
+                r[k++] = d | (this.s << (this.DB - p));
+            }
+            while (i >= 0) {
+                if (p < 8) {
+                    d = (this[i] & ((1 << p) - 1)) << (8 - p);
+                    d |= this[--i] >> (p += this.DB - 8);
+                }
+                else {
+                    d = (this[i] >> (p -= 8)) & 0xff;
+                    if (p <= 0) {
+                        p += this.DB;
+                        --i;
+                    }
+                }
+                if ((d & 0x80) != 0) {
+                    d |= -256;
+                }
+                if (k == 0 && (this.s & 0x80) != (d & 0x80)) {
+                    ++k;
+                }
+                if (k > 0 || d != this.s) {
+                    r[k++] = d;
+                }
+            }
+        }
+        return r;
+    };
+    // BigInteger.prototype.equals = bnEquals;
+    BigInteger.prototype.equals = function (a) {
+        return (this.compareTo(a) == 0);
+    };
+    // BigInteger.prototype.min = bnMin;
+    BigInteger.prototype.min = function (a) {
+        return (this.compareTo(a) < 0) ? this : a;
+    };
+    // BigInteger.prototype.max = bnMax;
+    BigInteger.prototype.max = function (a) {
+        return (this.compareTo(a) > 0) ? this : a;
+    };
+    // BigInteger.prototype.and = bnAnd;
+    BigInteger.prototype.and = function (a) {
+        var r = nbi();
+        this.bitwiseTo(a, op_and, r);
+        return r;
+    };
+    // BigInteger.prototype.or = bnOr;
+    BigInteger.prototype.or = function (a) {
+        var r = nbi();
+        this.bitwiseTo(a, op_or, r);
+        return r;
+    };
+    // BigInteger.prototype.xor = bnXor;
+    BigInteger.prototype.xor = function (a) {
+        var r = nbi();
+        this.bitwiseTo(a, op_xor, r);
+        return r;
+    };
+    // BigInteger.prototype.andNot = bnAndNot;
+    BigInteger.prototype.andNot = function (a) {
+        var r = nbi();
+        this.bitwiseTo(a, op_andnot, r);
+        return r;
+    };
+    // BigInteger.prototype.not = bnNot;
+    // (public) ~this
+    BigInteger.prototype.not = function () {
+        var r = nbi();
+        for (var i = 0; i < this.t; ++i) {
+            r[i] = this.DM & ~this[i];
+        }
+        r.t = this.t;
+        r.s = ~this.s;
+        return r;
+    };
+    // BigInteger.prototype.shiftLeft = bnShiftLeft;
+    // (public) this << n
+    BigInteger.prototype.shiftLeft = function (n) {
+        var r = nbi();
+        if (n < 0) {
+            this.rShiftTo(-n, r);
+        }
+        else {
+            this.lShiftTo(n, r);
+        }
+        return r;
+    };
+    // BigInteger.prototype.shiftRight = bnShiftRight;
+    // (public) this >> n
+    BigInteger.prototype.shiftRight = function (n) {
+        var r = nbi();
+        if (n < 0) {
+            this.lShiftTo(-n, r);
+        }
+        else {
+            this.rShiftTo(n, r);
+        }
+        return r;
+    };
+    // BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit;
+    // (public) returns index of lowest 1-bit (or -1 if none)
+    BigInteger.prototype.getLowestSetBit = function () {
+        for (var i = 0; i < this.t; ++i) {
+            if (this[i] != 0) {
+                return i * this.DB + lbit(this[i]);
+            }
+        }
+        if (this.s < 0) {
+            return this.t * this.DB;
+        }
+        return -1;
+    };
+    // BigInteger.prototype.bitCount = bnBitCount;
+    // (public) return number of set bits
+    BigInteger.prototype.bitCount = function () {
+        var r = 0;
+        var x = this.s & this.DM;
+        for (var i = 0; i < this.t; ++i) {
+            r += cbit(this[i] ^ x);
+        }
+        return r;
+    };
+    // BigInteger.prototype.testBit = bnTestBit;
+    // (public) true iff nth bit is set
+    BigInteger.prototype.testBit = function (n) {
+        var j = Math.floor(n / this.DB);
+        if (j >= this.t) {
+            return (this.s != 0);
+        }
+        return ((this[j] & (1 << (n % this.DB))) != 0);
+    };
+    // BigInteger.prototype.setBit = bnSetBit;
+    // (public) this | (1<<n)
+    BigInteger.prototype.setBit = function (n) {
+        return this.changeBit(n, op_or);
+    };
+    // BigInteger.prototype.clearBit = bnClearBit;
+    // (public) this & ~(1<<n)
+    BigInteger.prototype.clearBit = function (n) {
+        return this.changeBit(n, op_andnot);
+    };
+    // BigInteger.prototype.flipBit = bnFlipBit;
+    // (public) this ^ (1<<n)
+    BigInteger.prototype.flipBit = function (n) {
+        return this.changeBit(n, op_xor);
+    };
+    // BigInteger.prototype.add = bnAdd;
+    // (public) this + a
+    BigInteger.prototype.add = function (a) {
+        var r = nbi();
+        this.addTo(a, r);
+        return r;
+    };
+    // BigInteger.prototype.subtract = bnSubtract;
+    // (public) this - a
+    BigInteger.prototype.subtract = function (a) {
+        var r = nbi();
+        this.subTo(a, r);
+        return r;
+    };
+    // BigInteger.prototype.multiply = bnMultiply;
+    // (public) this * a
+    BigInteger.prototype.multiply = function (a) {
+        var r = nbi();
+        this.multiplyTo(a, r);
+        return r;
+    };
+    // BigInteger.prototype.divide = bnDivide;
+    // (public) this / a
+    BigInteger.prototype.divide = function (a) {
+        var r = nbi();
+        this.divRemTo(a, r, null);
+        return r;
+    };
+    // BigInteger.prototype.remainder = bnRemainder;
+    // (public) this % a
+    BigInteger.prototype.remainder = function (a) {
+        var r = nbi();
+        this.divRemTo(a, null, r);
+        return r;
+    };
+    // BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder;
+    // (public) [this/a,this%a]
+    BigInteger.prototype.divideAndRemainder = function (a) {
+        var q = nbi();
+        var r = nbi();
+        this.divRemTo(a, q, r);
+        return [q, r];
+    };
+    // BigInteger.prototype.modPow = bnModPow;
+    // (public) this^e % m (HAC 14.85)
+    BigInteger.prototype.modPow = function (e, m) {
+        var i = e.bitLength();
+        var k;
+        var r = nbv(1);
+        var z;
+        if (i <= 0) {
+            return r;
+        }
+        else if (i < 18) {
+            k = 1;
+        }
+        else if (i < 48) {
+            k = 3;
+        }
+        else if (i < 144) {
+            k = 4;
+        }
+        else if (i < 768) {
+            k = 5;
+        }
+        else {
+            k = 6;
+        }
+        if (i < 8) {
+            z = new Classic(m);
+        }
+        else if (m.isEven()) {
+            z = new Barrett(m);
+        }
+        else {
+            z = new Montgomery(m);
+        }
+        // precomputation
+        var g = [];
+        var n = 3;
+        var k1 = k - 1;
+        var km = (1 << k) - 1;
+        g[1] = z.convert(this);
+        if (k > 1) {
+            var g2 = nbi();
+            z.sqrTo(g[1], g2);
+            while (n <= km) {
+                g[n] = nbi();
+                z.mulTo(g2, g[n - 2], g[n]);
+                n += 2;
+            }
+        }
+        var j = e.t - 1;
+        var w;
+        var is1 = true;
+        var r2 = nbi();
+        var t;
+        i = nbits(e[j]) - 1;
+        while (j >= 0) {
+            if (i >= k1) {
+                w = (e[j] >> (i - k1)) & km;
+            }
+            else {
+                w = (e[j] & ((1 << (i + 1)) - 1)) << (k1 - i);
+                if (j > 0) {
+                    w |= e[j - 1] >> (this.DB + i - k1);
+                }
+            }
+            n = k;
+            while ((w & 1) == 0) {
+                w >>= 1;
+                --n;
+            }
+            if ((i -= n) < 0) {
+                i += this.DB;
+                --j;
+            }
+            if (is1) { // ret == 1, don't bother squaring or multiplying it
+                g[w].copyTo(r);
+                is1 = false;
+            }
+            else {
+                while (n > 1) {
+                    z.sqrTo(r, r2);
+                    z.sqrTo(r2, r);
+                    n -= 2;
+                }
+                if (n > 0) {
+                    z.sqrTo(r, r2);
+                }
+                else {
+                    t = r;
+                    r = r2;
+                    r2 = t;
+                }
+                z.mulTo(r2, g[w], r);
+            }
+            while (j >= 0 && (e[j] & (1 << i)) == 0) {
+                z.sqrTo(r, r2);
+                t = r;
+                r = r2;
+                r2 = t;
+                if (--i < 0) {
+                    i = this.DB - 1;
+                    --j;
+                }
+            }
+        }
+        return z.revert(r);
+    };
+    // BigInteger.prototype.modInverse = bnModInverse;
+    // (public) 1/this % m (HAC 14.61)
+    BigInteger.prototype.modInverse = function (m) {
+        var ac = m.isEven();
+        if ((this.isEven() && ac) || m.signum() == 0) {
+            return BigInteger.ZERO;
+        }
+        var u = m.clone();
+        var v = this.clone();
+        var a = nbv(1);
+        var b = nbv(0);
+        var c = nbv(0);
+        var d = nbv(1);
+        while (u.signum() != 0) {
+            while (u.isEven()) {
+                u.rShiftTo(1, u);
+                if (ac) {
+                    if (!a.isEven() || !b.isEven()) {
+                        a.addTo(this, a);
+                        b.subTo(m, b);
+                    }
+                    a.rShiftTo(1, a);
+                }
+                else if (!b.isEven()) {
+                    b.subTo(m, b);
+                }
+                b.rShiftTo(1, b);
+            }
+            while (v.isEven()) {
+                v.rShiftTo(1, v);
+                if (ac) {
+                    if (!c.isEven() || !d.isEven()) {
+                        c.addTo(this, c);
+                        d.subTo(m, d);
+                    }
+                    c.rShiftTo(1, c);
+                }
+                else if (!d.isEven()) {
+                    d.subTo(m, d);
+                }
+                d.rShiftTo(1, d);
+            }
+            if (u.compareTo(v) >= 0) {
+                u.subTo(v, u);
+                if (ac) {
+                    a.subTo(c, a);
+                }
+                b.subTo(d, b);
+            }
+            else {
+                v.subTo(u, v);
+                if (ac) {
+                    c.subTo(a, c);
+                }
+                d.subTo(b, d);
+            }
+        }
+        if (v.compareTo(BigInteger.ONE) != 0) {
+            return BigInteger.ZERO;
+        }
+        if (d.compareTo(m) >= 0) {
+            return d.subtract(m);
+        }
+        if (d.signum() < 0) {
+            d.addTo(m, d);
+        }
+        else {
+            return d;
+        }
+        if (d.signum() < 0) {
+            return d.add(m);
+        }
+        else {
+            return d;
+        }
+    };
+    // BigInteger.prototype.pow = bnPow;
+    // (public) this^e
+    BigInteger.prototype.pow = function (e) {
+        return this.exp(e, new NullExp());
+    };
+    // BigInteger.prototype.gcd = bnGCD;
+    // (public) gcd(this,a) (HAC 14.54)
+    BigInteger.prototype.gcd = function (a) {
+        var x = (this.s < 0) ? this.negate() : this.clone();
+        var y = (a.s < 0) ? a.negate() : a.clone();
+        if (x.compareTo(y) < 0) {
+            var t = x;
+            x = y;
+            y = t;
+        }
+        var i = x.getLowestSetBit();
+        var g = y.getLowestSetBit();
+        if (g < 0) {
+            return x;
+        }
+        if (i < g) {
+            g = i;
+        }
+        if (g > 0) {
+            x.rShiftTo(g, x);
+            y.rShiftTo(g, y);
+        }
+        while (x.signum() > 0) {
+            if ((i = x.getLowestSetBit()) > 0) {
+                x.rShiftTo(i, x);
+            }
+            if ((i = y.getLowestSetBit()) > 0) {
+                y.rShiftTo(i, y);
+            }
+            if (x.compareTo(y) >= 0) {
+                x.subTo(y, x);
+                x.rShiftTo(1, x);
+            }
+            else {
+                y.subTo(x, y);
+                y.rShiftTo(1, y);
+            }
+        }
+        if (g > 0) {
+            y.lShiftTo(g, y);
+        }
+        return y;
+    };
+    // BigInteger.prototype.isProbablePrime = bnIsProbablePrime;
+    // (public) test primality with certainty >= 1-.5^t
+    BigInteger.prototype.isProbablePrime = function (t) {
+        var i;
+        var x = this.abs();
+        if (x.t == 1 && x[0] <= lowprimes[lowprimes.length - 1]) {
+            for (i = 0; i < lowprimes.length; ++i) {
+                if (x[0] == lowprimes[i]) {
+                    return true;
+                }
+            }
+            return false;
+        }
+        if (x.isEven()) {
+            return false;
+        }
+        i = 1;
+        while (i < lowprimes.length) {
+            var m = lowprimes[i];
+            var j = i + 1;
+            while (j < lowprimes.length && m < lplim) {
+                m *= lowprimes[j++];
+            }
+            m = x.modInt(m);
+            while (i < j) {
+                if (m % lowprimes[i++] == 0) {
+                    return false;
+                }
+            }
+        }
+        return x.millerRabin(t);
+    };
+    //#endregion PUBLIC
+    //#region PROTECTED
+    // BigInteger.prototype.copyTo = bnpCopyTo;
+    // (protected) copy this to r
+    BigInteger.prototype.copyTo = function (r) {
+        for (var i = this.t - 1; i >= 0; --i) {
+            r[i] = this[i];
+        }
+        r.t = this.t;
+        r.s = this.s;
+    };
+    // BigInteger.prototype.fromInt = bnpFromInt;
+    // (protected) set from integer value x, -DV <= x < DV
+    BigInteger.prototype.fromInt = function (x) {
+        this.t = 1;
+        this.s = (x < 0) ? -1 : 0;
+        if (x > 0) {
+            this[0] = x;
+        }
+        else if (x < -1) {
+            this[0] = x + this.DV;
+        }
+        else {
+            this.t = 0;
+        }
+    };
+    // BigInteger.prototype.fromString = bnpFromString;
+    // (protected) set from string and radix
+    BigInteger.prototype.fromString = function (s, b) {
+        var k;
+        if (b == 16) {
+            k = 4;
+        }
+        else if (b == 8) {
+            k = 3;
+        }
+        else if (b == 256) {
+            k = 8;
+            /* byte array */
+        }
+        else if (b == 2) {
+            k = 1;
+        }
+        else if (b == 32) {
+            k = 5;
+        }
+        else if (b == 4) {
+            k = 2;
+        }
+        else {
+            this.fromRadix(s, b);
+            return;
+        }
+        this.t = 0;
+        this.s = 0;
+        var i = s.length;
+        var mi = false;
+        var sh = 0;
+        while (--i >= 0) {
+            var x = (k == 8) ? (+s[i]) & 0xff : intAt(s, i);
+            if (x < 0) {
+                if (s.charAt(i) == "-") {
+                    mi = true;
+                }
+                continue;
+            }
+            mi = false;
+            if (sh == 0) {
+                this[this.t++] = x;
+            }
+            else if (sh + k > this.DB) {
+                this[this.t - 1] |= (x & ((1 << (this.DB - sh)) - 1)) << sh;
+                this[this.t++] = (x >> (this.DB - sh));
+            }
+            else {
+                this[this.t - 1] |= x << sh;
+            }
+            sh += k;
+            if (sh >= this.DB) {
+                sh -= this.DB;
+            }
+        }
+        if (k == 8 && ((+s[0]) & 0x80) != 0) {
+            this.s = -1;
+            if (sh > 0) {
+                this[this.t - 1] |= ((1 << (this.DB - sh)) - 1) << sh;
+            }
+        }
+        this.clamp();
+        if (mi) {
+            BigInteger.ZERO.subTo(this, this);
+        }
+    };
+    // BigInteger.prototype.clamp = bnpClamp;
+    // (protected) clamp off excess high words
+    BigInteger.prototype.clamp = function () {
+        var c = this.s & this.DM;
+        while (this.t > 0 && this[this.t - 1] == c) {
+            --this.t;
+        }
+    };
+    // BigInteger.prototype.dlShiftTo = bnpDLShiftTo;
+    // (protected) r = this << n*DB
+    BigInteger.prototype.dlShiftTo = function (n, r) {
+        var i;
+        for (i = this.t - 1; i >= 0; --i) {
+            r[i + n] = this[i];
+        }
+        for (i = n - 1; i >= 0; --i) {
+            r[i] = 0;
+        }
+        r.t = this.t + n;
+        r.s = this.s;
+    };
+    // BigInteger.prototype.drShiftTo = bnpDRShiftTo;
+    // (protected) r = this >> n*DB
+    BigInteger.prototype.drShiftTo = function (n, r) {
+        for (var i = n; i < this.t; ++i) {
+            r[i - n] = this[i];
+        }
+        r.t = Math.max(this.t - n, 0);
+        r.s = this.s;
+    };
+    // BigInteger.prototype.lShiftTo = bnpLShiftTo;
+    // (protected) r = this << n
+    BigInteger.prototype.lShiftTo = function (n, r) {
+        var bs = n % this.DB;
+        var cbs = this.DB - bs;
+        var bm = (1 << cbs) - 1;
+        var ds = Math.floor(n / this.DB);
+        var c = (this.s << bs) & this.DM;
+        for (var i = this.t - 1; i >= 0; --i) {
+            r[i + ds + 1] = (this[i] >> cbs) | c;
+            c = (this[i] & bm) << bs;
+        }
+        for (var i = ds - 1; i >= 0; --i) {
+            r[i] = 0;
+        }
+        r[ds] = c;
+        r.t = this.t + ds + 1;
+        r.s = this.s;
+        r.clamp();
+    };
+    // BigInteger.prototype.rShiftTo = bnpRShiftTo;
+    // (protected) r = this >> n
+    BigInteger.prototype.rShiftTo = function (n, r) {
+        r.s = this.s;
+        var ds = Math.floor(n / this.DB);
+        if (ds >= this.t) {
+            r.t = 0;
+            return;
+        }
+        var bs = n % this.DB;
+        var cbs = this.DB - bs;
+        var bm = (1 << bs) - 1;
+        r[0] = this[ds] >> bs;
+        for (var i = ds + 1; i < this.t; ++i) {
+            r[i - ds - 1] |= (this[i] & bm) << cbs;
+            r[i - ds] = this[i] >> bs;
+        }
+        if (bs > 0) {
+            r[this.t - ds - 1] |= (this.s & bm) << cbs;
+        }
+        r.t = this.t - ds;
+        r.clamp();
+    };
+    // BigInteger.prototype.subTo = bnpSubTo;
+    // (protected) r = this - a
+    BigInteger.prototype.subTo = function (a, r) {
+        var i = 0;
+        var c = 0;
+        var m = Math.min(a.t, this.t);
+        while (i < m) {
+            c += this[i] - a[i];
+            r[i++] = c & this.DM;
+            c >>= this.DB;
+        }
+        if (a.t < this.t) {
+            c -= a.s;
+            while (i < this.t) {
+                c += this[i];
+                r[i++] = c & this.DM;
+                c >>= this.DB;
+            }
+            c += this.s;
+        }
+        else {
+            c += this.s;
+            while (i < a.t) {
+                c -= a[i];
+                r[i++] = c & this.DM;
+                c >>= this.DB;
+            }
+            c -= a.s;
+        }
+        r.s = (c < 0) ? -1 : 0;
+        if (c < -1) {
+            r[i++] = this.DV + c;
+        }
+        else if (c > 0) {
+            r[i++] = c;
+        }
+        r.t = i;
+        r.clamp();
+    };
+    // BigInteger.prototype.multiplyTo = bnpMultiplyTo;
+    // (protected) r = this * a, r != this,a (HAC 14.12)
+    // "this" should be the larger one if appropriate.
+    BigInteger.prototype.multiplyTo = function (a, r) {
+        var x = this.abs();
+        var y = a.abs();
+        var i = x.t;
+        r.t = i + y.t;
+        while (--i >= 0) {
+            r[i] = 0;
+        }
+        for (i = 0; i < y.t; ++i) {
+            r[i + x.t] = x.am(0, y[i], r, i, 0, x.t);
+        }
+        r.s = 0;
+        r.clamp();
+        if (this.s != a.s) {
+            BigInteger.ZERO.subTo(r, r);
+        }
+    };
+    // BigInteger.prototype.squareTo = bnpSquareTo;
+    // (protected) r = this^2, r != this (HAC 14.16)
+    BigInteger.prototype.squareTo = function (r) {
+        var x = this.abs();
+        var i = r.t = 2 * x.t;
+        while (--i >= 0) {
+            r[i] = 0;
+        }
+        for (i = 0; i < x.t - 1; ++i) {
+            var c = x.am(i, x[i], r, 2 * i, 0, 1);
+            if ((r[i + x.t] += x.am(i + 1, 2 * x[i], r, 2 * i + 1, c, x.t - i - 1)) >= x.DV) {
+                r[i + x.t] -= x.DV;
+                r[i + x.t + 1] = 1;
+            }
+        }
+        if (r.t > 0) {
+            r[r.t - 1] += x.am(i, x[i], r, 2 * i, 0, 1);
+        }
+        r.s = 0;
+        r.clamp();
+    };
+    // BigInteger.prototype.divRemTo = bnpDivRemTo;
+    // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20)
+    // r != q, this != m.  q or r may be null.
+    BigInteger.prototype.divRemTo = function (m, q, r) {
+        var pm = m.abs();
+        if (pm.t <= 0) {
+            return;
+        }
+        var pt = this.abs();
+        if (pt.t < pm.t) {
+            if (q != null) {
+                q.fromInt(0);
+            }
+            if (r != null) {
+                this.copyTo(r);
+            }
+            return;
+        }
+        if (r == null) {
+            r = nbi();
+        }
+        var y = nbi();
+        var ts = this.s;
+        var ms = m.s;
+        var nsh = this.DB - nbits(pm[pm.t - 1]); // normalize modulus
+        if (nsh > 0) {
+            pm.lShiftTo(nsh, y);
+            pt.lShiftTo(nsh, r);
+        }
+        else {
+            pm.copyTo(y);
+            pt.copyTo(r);
+        }
+        var ys = y.t;
+        var y0 = y[ys - 1];
+        if (y0 == 0) {
+            return;
+        }
+        var yt = y0 * (1 << this.F1) + ((ys > 1) ? y[ys - 2] >> this.F2 : 0);
+        var d1 = this.FV / yt;
+        var d2 = (1 << this.F1) / yt;
+        var e = 1 << this.F2;
+        var i = r.t;
+        var j = i - ys;
+        var t = (q == null) ? nbi() : q;
+        y.dlShiftTo(j, t);
+        if (r.compareTo(t) >= 0) {
+            r[r.t++] = 1;
+            r.subTo(t, r);
+        }
+        BigInteger.ONE.dlShiftTo(ys, t);
+        t.subTo(y, y); // "negative" y so we can replace sub with am later
+        while (y.t < ys) {
+            y[y.t++] = 0;
+        }
+        while (--j >= 0) {
+            // Estimate quotient digit
+            var qd = (r[--i] == y0) ? this.DM : Math.floor(r[i] * d1 + (r[i - 1] + e) * d2);
+            if ((r[i] += y.am(0, qd, r, j, 0, ys)) < qd) { // Try it out
+                y.dlShiftTo(j, t);
+                r.subTo(t, r);
+                while (r[i] < --qd) {
+                    r.subTo(t, r);
+                }
+            }
+        }
+        if (q != null) {
+            r.drShiftTo(ys, q);
+            if (ts != ms) {
+                BigInteger.ZERO.subTo(q, q);
+            }
+        }
+        r.t = ys;
+        r.clamp();
+        if (nsh > 0) {
+            r.rShiftTo(nsh, r);
+        } // Denormalize remainder
+        if (ts < 0) {
+            BigInteger.ZERO.subTo(r, r);
+        }
+    };
+    // BigInteger.prototype.invDigit = bnpInvDigit;
+    // (protected) return "-1/this % 2^DB"; useful for Mont. reduction
+    // justification:
+    //         xy == 1 (mod m)
+    //         xy =  1+km
+    //   xy(2-xy) = (1+km)(1-km)
+    // x[y(2-xy)] = 1-k^2m^2
+    // x[y(2-xy)] == 1 (mod m^2)
+    // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2
+    // should reduce x and y(2-xy) by m^2 at each step to keep size bounded.
+    // JS multiply "overflows" differently from C/C++, so care is needed here.
+    BigInteger.prototype.invDigit = function () {
+        if (this.t < 1) {
+            return 0;
+        }
+        var x = this[0];
+        if ((x & 1) == 0) {
+            return 0;
+        }
+        var y = x & 3; // y == 1/x mod 2^2
+        y = (y * (2 - (x & 0xf) * y)) & 0xf; // y == 1/x mod 2^4
+        y = (y * (2 - (x & 0xff) * y)) & 0xff; // y == 1/x mod 2^8
+        y = (y * (2 - (((x & 0xffff) * y) & 0xffff))) & 0xffff; // y == 1/x mod 2^16
+        // last step - calculate inverse mod DV directly;
+        // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints
+        y = (y * (2 - x * y % this.DV)) % this.DV; // y == 1/x mod 2^dbits
+        // we really want the negative inverse, and -DV < y < DV
+        return (y > 0) ? this.DV - y : -y;
+    };
+    // BigInteger.prototype.isEven = bnpIsEven;
+    // (protected) true iff this is even
+    BigInteger.prototype.isEven = function () {
+        return ((this.t > 0) ? (this[0] & 1) : this.s) == 0;
+    };
+    // BigInteger.prototype.exp = bnpExp;
+    // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79)
+    BigInteger.prototype.exp = function (e, z) {
+        if (e > 0xffffffff || e < 1) {
+            return BigInteger.ONE;
+        }
+        var r = nbi();
+        var r2 = nbi();
+        var g = z.convert(this);
+        var i = nbits(e) - 1;
+        g.copyTo(r);
+        while (--i >= 0) {
+            z.sqrTo(r, r2);
+            if ((e & (1 << i)) > 0) {
+                z.mulTo(r2, g, r);
+            }
+            else {
+                var t = r;
+                r = r2;
+                r2 = t;
+            }
+        }
+        return z.revert(r);
+    };
+    // BigInteger.prototype.chunkSize = bnpChunkSize;
+    // (protected) return x s.t. r^x < DV
+    BigInteger.prototype.chunkSize = function (r) {
+        return Math.floor(Math.LN2 * this.DB / Math.log(r));
+    };
+    // BigInteger.prototype.toRadix = bnpToRadix;
+    // (protected) convert to radix string
+    BigInteger.prototype.toRadix = function (b) {
+        if (b == null) {
+            b = 10;
+        }
+        if (this.signum() == 0 || b < 2 || b > 36) {
+            return "0";
+        }
+        var cs = this.chunkSize(b);
+        var a = Math.pow(b, cs);
+        var d = nbv(a);
+        var y = nbi();
+        var z = nbi();
+        var r = "";
+        this.divRemTo(d, y, z);
+        while (y.signum() > 0) {
+            r = (a + z.intValue()).toString(b).substr(1) + r;
+            y.divRemTo(d, y, z);
+        }
+        return z.intValue().toString(b) + r;
+    };
+    // BigInteger.prototype.fromRadix = bnpFromRadix;
+    // (protected) convert from radix string
+    BigInteger.prototype.fromRadix = function (s, b) {
+        this.fromInt(0);
+        if (b == null) {
+            b = 10;
+        }
+        var cs = this.chunkSize(b);
+        var d = Math.pow(b, cs);
+        var mi = false;
+        var j = 0;
+        var w = 0;
+        for (var i = 0; i < s.length; ++i) {
+            var x = intAt(s, i);
+            if (x < 0) {
+                if (s.charAt(i) == "-" && this.signum() == 0) {
+                    mi = true;
+                }
+                continue;
+            }
+            w = b * w + x;
+            if (++j >= cs) {
+                this.dMultiply(d);
+                this.dAddOffset(w, 0);
+                j = 0;
+                w = 0;
+            }
+        }
+        if (j > 0) {
+            this.dMultiply(Math.pow(b, j));
+            this.dAddOffset(w, 0);
+        }
+        if (mi) {
+            BigInteger.ZERO.subTo(this, this);
+        }
+    };
+    // BigInteger.prototype.fromNumber = bnpFromNumber;
+    // (protected) alternate constructor
+    BigInteger.prototype.fromNumber = function (a, b, c) {
+        if ("number" == typeof b) {
+            // new BigInteger(int,int,RNG)
+            if (a < 2) {
+                this.fromInt(1);
+            }
+            else {
+                this.fromNumber(a, c);
+                if (!this.testBit(a - 1)) {
+                    // force MSB set
+                    this.bitwiseTo(BigInteger.ONE.shiftLeft(a - 1), op_or, this);
+                }
+                if (this.isEven()) {
+                    this.dAddOffset(1, 0);
+                } // force odd
+                while (!this.isProbablePrime(b)) {
+                    this.dAddOffset(2, 0);
+                    if (this.bitLength() > a) {
+                        this.subTo(BigInteger.ONE.shiftLeft(a - 1), this);
+                    }
+                }
+            }
+        }
+        else {
+            // new BigInteger(int,RNG)
+            var x = [];
+            var t = a & 7;
+            x.length = (a >> 3) + 1;
+            b.nextBytes(x);
+            if (t > 0) {
+                x[0] &= ((1 << t) - 1);
+            }
+            else {
+                x[0] = 0;
+            }
+            this.fromString(x, 256);
+        }
+    };
+    // BigInteger.prototype.bitwiseTo = bnpBitwiseTo;
+    // (protected) r = this op a (bitwise)
+    BigInteger.prototype.bitwiseTo = function (a, op, r) {
+        var i;
+        var f;
+        var m = Math.min(a.t, this.t);
+        for (i = 0; i < m; ++i) {
+            r[i] = op(this[i], a[i]);
+        }
+        if (a.t < this.t) {
+            f = a.s & this.DM;
+            for (i = m; i < this.t; ++i) {
+                r[i] = op(this[i], f);
+            }
+            r.t = this.t;
+        }
+        else {
+            f = this.s & this.DM;
+            for (i = m; i < a.t; ++i) {
+                r[i] = op(f, a[i]);
+            }
+            r.t = a.t;
+        }
+        r.s = op(this.s, a.s);
+        r.clamp();
+    };
+    // BigInteger.prototype.changeBit = bnpChangeBit;
+    // (protected) this op (1<<n)
+    BigInteger.prototype.changeBit = function (n, op) {
+        var r = BigInteger.ONE.shiftLeft(n);
+        this.bitwiseTo(r, op, r);
+        return r;
+    };
+    // BigInteger.prototype.addTo = bnpAddTo;
+    // (protected) r = this + a
+    BigInteger.prototype.addTo = function (a, r) {
+        var i = 0;
+        var c = 0;
+        var m = Math.min(a.t, this.t);
+        while (i < m) {
+            c += this[i] + a[i];
+            r[i++] = c & this.DM;
+            c >>= this.DB;
+        }
+        if (a.t < this.t) {
+            c += a.s;
+            while (i < this.t) {
+                c += this[i];
+                r[i++] = c & this.DM;
+                c >>= this.DB;
+            }
+            c += this.s;
+        }
+        else {
+            c += this.s;
+            while (i < a.t) {
+                c += a[i];
+                r[i++] = c & this.DM;
+                c >>= this.DB;
+            }
+            c += a.s;
+        }
+        r.s = (c < 0) ? -1 : 0;
+        if (c > 0) {
+            r[i++] = c;
+        }
+        else if (c < -1) {
+            r[i++] = this.DV + c;
+        }
+        r.t = i;
+        r.clamp();
+    };
+    // BigInteger.prototype.dMultiply = bnpDMultiply;
+    // (protected) this *= n, this >= 0, 1 < n < DV
+    BigInteger.prototype.dMultiply = function (n) {
+        this[this.t] = this.am(0, n - 1, this, 0, 0, this.t);
+        ++this.t;
+        this.clamp();
+    };
+    // BigInteger.prototype.dAddOffset = bnpDAddOffset;
+    // (protected) this += n << w words, this >= 0
+    BigInteger.prototype.dAddOffset = function (n, w) {
+        if (n == 0) {
+            return;
+        }
+        while (this.t <= w) {
+            this[this.t++] = 0;
+        }
+        this[w] += n;
+        while (this[w] >= this.DV) {
+            this[w] -= this.DV;
+            if (++w >= this.t) {
+                this[this.t++] = 0;
+            }
+            ++this[w];
+        }
+    };
+    // BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo;
+    // (protected) r = lower n words of "this * a", a.t <= n
+    // "this" should be the larger one if appropriate.
+    BigInteger.prototype.multiplyLowerTo = function (a, n, r) {
+        var i = Math.min(this.t + a.t, n);
+        r.s = 0; // assumes a,this >= 0
+        r.t = i;
+        while (i > 0) {
+            r[--i] = 0;
+        }
+        for (var j = r.t - this.t; i < j; ++i) {
+            r[i + this.t] = this.am(0, a[i], r, i, 0, this.t);
+        }
+        for (var j = Math.min(a.t, n); i < j; ++i) {
+            this.am(0, a[i], r, i, 0, n - i);
+        }
+        r.clamp();
+    };
+    // BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo;
+    // (protected) r = "this * a" without lower n words, n > 0
+    // "this" should be the larger one if appropriate.
+    BigInteger.prototype.multiplyUpperTo = function (a, n, r) {
+        --n;
+        var i = r.t = this.t + a.t - n;
+        r.s = 0; // assumes a,this >= 0
+        while (--i >= 0) {
+            r[i] = 0;
+        }
+        for (i = Math.max(n - this.t, 0); i < a.t; ++i) {
+            r[this.t + i - n] = this.am(n - i, a[i], r, 0, 0, this.t + i - n);
+        }
+        r.clamp();
+        r.drShiftTo(1, r);
+    };
+    // BigInteger.prototype.modInt = bnpModInt;
+    // (protected) this % n, n < 2^26
+    BigInteger.prototype.modInt = function (n) {
+        if (n <= 0) {
+            return 0;
+        }
+        var d = this.DV % n;
+        var r = (this.s < 0) ? n - 1 : 0;
+        if (this.t > 0) {
+            if (d == 0) {
+                r = this[0] % n;
+            }
+            else {
+                for (var i = this.t - 1; i >= 0; --i) {
+                    r = (d * r + this[i]) % n;
+                }
+            }
+        }
+        return r;
+    };
+    // BigInteger.prototype.millerRabin = bnpMillerRabin;
+    // (protected) true if probably prime (HAC 4.24, Miller-Rabin)
+    BigInteger.prototype.millerRabin = function (t) {
+        var n1 = this.subtract(BigInteger.ONE);
+        var k = n1.getLowestSetBit();
+        if (k <= 0) {
+            return false;
+        }
+        var r = n1.shiftRight(k);
+        t = (t + 1) >> 1;
+        if (t > lowprimes.length) {
+            t = lowprimes.length;
+        }
+        var a = nbi();
+        for (var i = 0; i < t; ++i) {
+            // Pick bases at random, instead of starting at 2
+            a.fromInt(lowprimes[Math.floor(Math.random() * lowprimes.length)]);
+            var y = a.modPow(r, this);
+            if (y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) {
+                var j = 1;
+                while (j++ < k && y.compareTo(n1) != 0) {
+                    y = y.modPowInt(2, this);
+                    if (y.compareTo(BigInteger.ONE) == 0) {
+                        return false;
+                    }
+                }
+                if (y.compareTo(n1) != 0) {
+                    return false;
+                }
+            }
+        }
+        return true;
+    };
+    // BigInteger.prototype.square = bnSquare;
+    // (public) this^2
+    BigInteger.prototype.square = function () {
+        var r = nbi();
+        this.squareTo(r);
+        return r;
+    };
+    //#region ASYNC
+    // Public API method
+    BigInteger.prototype.gcda = function (a, callback) {
+        var x = (this.s < 0) ? this.negate() : this.clone();
+        var y = (a.s < 0) ? a.negate() : a.clone();
+        if (x.compareTo(y) < 0) {
+            var t = x;
+            x = y;
+            y = t;
+        }
+        var i = x.getLowestSetBit();
+        var g = y.getLowestSetBit();
+        if (g < 0) {
+            callback(x);
+            return;
+        }
+        if (i < g) {
+            g = i;
+        }
+        if (g > 0) {
+            x.rShiftTo(g, x);
+            y.rShiftTo(g, y);
+        }
+        // Workhorse of the algorithm, gets called 200 - 800 times per 512 bit keygen.
+        var gcda1 = function () {
+            if ((i = x.getLowestSetBit()) > 0) {
+                x.rShiftTo(i, x);
+            }
+            if ((i = y.getLowestSetBit()) > 0) {
+                y.rShiftTo(i, y);
+            }
+            if (x.compareTo(y) >= 0) {
+                x.subTo(y, x);
+                x.rShiftTo(1, x);
+            }
+            else {
+                y.subTo(x, y);
+                y.rShiftTo(1, y);
+            }
+            if (!(x.signum() > 0)) {
+                if (g > 0) {
+                    y.lShiftTo(g, y);
+                }
+                setTimeout(function () { callback(y); }, 0); // escape
+            }
+            else {
+                setTimeout(gcda1, 0);
+            }
+        };
+        setTimeout(gcda1, 10);
+    };
+    // (protected) alternate constructor
+    BigInteger.prototype.fromNumberAsync = function (a, b, c, callback) {
+        if ("number" == typeof b) {
+            if (a < 2) {
+                this.fromInt(1);
+            }
+            else {
+                this.fromNumber(a, c);
+                if (!this.testBit(a - 1)) {
+                    this.bitwiseTo(BigInteger.ONE.shiftLeft(a - 1), op_or, this);
+                }
+                if (this.isEven()) {
+                    this.dAddOffset(1, 0);
+                }
+                var bnp_1 = this;
+                var bnpfn1_1 = function () {
+                    bnp_1.dAddOffset(2, 0);
+                    if (bnp_1.bitLength() > a) {
+                        bnp_1.subTo(BigInteger.ONE.shiftLeft(a - 1), bnp_1);
+                    }
+                    if (bnp_1.isProbablePrime(b)) {
+                        setTimeout(function () { callback(); }, 0); // escape
+                    }
+                    else {
+                        setTimeout(bnpfn1_1, 0);
+                    }
+                };
+                setTimeout(bnpfn1_1, 0);
+            }
+        }
+        else {
+            var x = [];
+            var t = a & 7;
+            x.length = (a >> 3) + 1;
+            b.nextBytes(x);
+            if (t > 0) {
+                x[0] &= ((1 << t) - 1);
+            }
+            else {
+                x[0] = 0;
+            }
+            this.fromString(x, 256);
+        }
+    };
+    return BigInteger;
+}());
+//#region REDUCERS
+//#region NullExp
+var NullExp = /** @class */ (function () {
+    function NullExp() {
+    }
+    // NullExp.prototype.convert = nNop;
+    NullExp.prototype.convert = function (x) {
+        return x;
+    };
+    // NullExp.prototype.revert = nNop;
+    NullExp.prototype.revert = function (x) {
+        return x;
+    };
+    // NullExp.prototype.mulTo = nMulTo;
+    NullExp.prototype.mulTo = function (x, y, r) {
+        x.multiplyTo(y, r);
+    };
+    // NullExp.prototype.sqrTo = nSqrTo;
+    NullExp.prototype.sqrTo = function (x, r) {
+        x.squareTo(r);
+    };
+    return NullExp;
+}());
+// Modular reduction using "classic" algorithm
+var Classic = /** @class */ (function () {
+    function Classic(m) {
+        this.m = m;
+    }
+    // Classic.prototype.convert = cConvert;
+    Classic.prototype.convert = function (x) {
+        if (x.s < 0 || x.compareTo(this.m) >= 0) {
+            return x.mod(this.m);
+        }
+        else {
+            return x;
+        }
+    };
+    // Classic.prototype.revert = cRevert;
+    Classic.prototype.revert = function (x) {
+        return x;
+    };
+    // Classic.prototype.reduce = cReduce;
+    Classic.prototype.reduce = function (x) {
+        x.divRemTo(this.m, null, x);
+    };
+    // Classic.prototype.mulTo = cMulTo;
+    Classic.prototype.mulTo = function (x, y, r) {
+        x.multiplyTo(y, r);
+        this.reduce(r);
+    };
+    // Classic.prototype.sqrTo = cSqrTo;
+    Classic.prototype.sqrTo = function (x, r) {
+        x.squareTo(r);
+        this.reduce(r);
+    };
+    return Classic;
+}());
+//#endregion
+//#region Montgomery
+// Montgomery reduction
+var Montgomery = /** @class */ (function () {
+    function Montgomery(m) {
+        this.m = m;
+        this.mp = m.invDigit();
+        this.mpl = this.mp & 0x7fff;
+        this.mph = this.mp >> 15;
+        this.um = (1 << (m.DB - 15)) - 1;
+        this.mt2 = 2 * m.t;
+    }
+    // Montgomery.prototype.convert = montConvert;
+    // xR mod m
+    Montgomery.prototype.convert = function (x) {
+        var r = nbi();
+        x.abs().dlShiftTo(this.m.t, r);
+        r.divRemTo(this.m, null, r);
+        if (x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) {
+            this.m.subTo(r, r);
+        }
+        return r;
+    };
+    // Montgomery.prototype.revert = montRevert;
+    // x/R mod m
+    Montgomery.prototype.revert = function (x) {
+        var r = nbi();
+        x.copyTo(r);
+        this.reduce(r);
+        return r;
+    };
+    // Montgomery.prototype.reduce = montReduce;
+    // x = x/R mod m (HAC 14.32)
+    Montgomery.prototype.reduce = function (x) {
+        while (x.t <= this.mt2) {
+            // pad x so am has enough room later
+            x[x.t++] = 0;
+        }
+        for (var i = 0; i < this.m.t; ++i) {
+            // faster way of calculating u0 = x[i]*mp mod DV
+            var j = x[i] & 0x7fff;
+            var u0 = (j * this.mpl + (((j * this.mph + (x[i] >> 15) * this.mpl) & this.um) << 15)) & x.DM;
+            // use am to combine the multiply-shift-add into one call
+            j = i + this.m.t;
+            x[j] += this.m.am(0, u0, x, i, 0, this.m.t);
+            // propagate carry
+            while (x[j] >= x.DV) {
+                x[j] -= x.DV;
+                x[++j]++;
+            }
+        }
+        x.clamp();
+        x.drShiftTo(this.m.t, x);
+        if (x.compareTo(this.m) >= 0) {
+            x.subTo(this.m, x);
+        }
+    };
+    // Montgomery.prototype.mulTo = montMulTo;
+    // r = "xy/R mod m"; x,y != r
+    Montgomery.prototype.mulTo = function (x, y, r) {
+        x.multiplyTo(y, r);
+        this.reduce(r);
+    };
+    // Montgomery.prototype.sqrTo = montSqrTo;
+    // r = "x^2/R mod m"; x != r
+    Montgomery.prototype.sqrTo = function (x, r) {
+        x.squareTo(r);
+        this.reduce(r);
+    };
+    return Montgomery;
+}());
+//#endregion Montgomery
+//#region Barrett
+// Barrett modular reduction
+var Barrett = /** @class */ (function () {
+    function Barrett(m) {
+        this.m = m;
+        // setup Barrett
+        this.r2 = nbi();
+        this.q3 = nbi();
+        BigInteger.ONE.dlShiftTo(2 * m.t, this.r2);
+        this.mu = this.r2.divide(m);
+    }
+    // Barrett.prototype.convert = barrettConvert;
+    Barrett.prototype.convert = function (x) {
+        if (x.s < 0 || x.t > 2 * this.m.t) {
+            return x.mod(this.m);
+        }
+        else if (x.compareTo(this.m) < 0) {
+            return x;
+        }
+        else {
+            var r = nbi();
+            x.copyTo(r);
+            this.reduce(r);
+            return r;
+        }
+    };
+    // Barrett.prototype.revert = barrettRevert;
+    Barrett.prototype.revert = function (x) {
+        return x;
+    };
+    // Barrett.prototype.reduce = barrettReduce;
+    // x = x mod m (HAC 14.42)
+    Barrett.prototype.reduce = function (x) {
+        x.drShiftTo(this.m.t - 1, this.r2);
+        if (x.t > this.m.t + 1) {
+            x.t = this.m.t + 1;
+            x.clamp();
+        }
+        this.mu.multiplyUpperTo(this.r2, this.m.t + 1, this.q3);
+        this.m.multiplyLowerTo(this.q3, this.m.t + 1, this.r2);
+        while (x.compareTo(this.r2) < 0) {
+            x.dAddOffset(1, this.m.t + 1);
+        }
+        x.subTo(this.r2, x);
+        while (x.compareTo(this.m) >= 0) {
+            x.subTo(this.m, x);
+        }
+    };
+    // Barrett.prototype.mulTo = barrettMulTo;
+    // r = x*y mod m; x,y != r
+    Barrett.prototype.mulTo = function (x, y, r) {
+        x.multiplyTo(y, r);
+        this.reduce(r);
+    };
+    // Barrett.prototype.sqrTo = barrettSqrTo;
+    // r = x^2 mod m; x != r
+    Barrett.prototype.sqrTo = function (x, r) {
+        x.squareTo(r);
+        this.reduce(r);
+    };
+    return Barrett;
+}());
+//#endregion
+//#endregion REDUCERS
+// return new, unset BigInteger
+function nbi() { return new BigInteger(null); }
+function parseBigInt(str, r) {
+    return new BigInteger(str, r);
+}
+// am: Compute w_j += (x*this_i), propagate carries,
+// c is initial carry, returns final carry.
+// c < 3*dvalue, x < 2*dvalue, this_i < dvalue
+// We need to select the fastest one that works in this environment.
+// am1: use a single mult and divide to get the high bits,
+// max digit bits should be 26 because
+// max internal value = 2*dvalue^2-2*dvalue (< 2^53)
+function am1(i, x, w, j, c, n) {
+    while (--n >= 0) {
+        var v = x * this[i++] + w[j] + c;
+        c = Math.floor(v / 0x4000000);
+        w[j++] = v & 0x3ffffff;
+    }
+    return c;
+}
+// am2 avoids a big mult-and-extract completely.
+// Max digit bits should be <= 30 because we do bitwise ops
+// on values up to 2*hdvalue^2-hdvalue-1 (< 2^31)
+function am2(i, x, w, j, c, n) {
+    var xl = x & 0x7fff;
+    var xh = x >> 15;
+    while (--n >= 0) {
+        var l = this[i] & 0x7fff;
+        var h = this[i++] >> 15;
+        var m = xh * l + h * xl;
+        l = xl * l + ((m & 0x7fff) << 15) + w[j] + (c & 0x3fffffff);
+        c = (l >>> 30) + (m >>> 15) + xh * h + (c >>> 30);
+        w[j++] = l & 0x3fffffff;
+    }
+    return c;
+}
+// Alternately, set max digit bits to 28 since some
+// browsers slow down when dealing with 32-bit numbers.
+function am3(i, x, w, j, c, n) {
+    var xl = x & 0x3fff;
+    var xh = x >> 14;
+    while (--n >= 0) {
+        var l = this[i] & 0x3fff;
+        var h = this[i++] >> 14;
+        var m = xh * l + h * xl;
+        l = xl * l + ((m & 0x3fff) << 14) + w[j] + c;
+        c = (l >> 28) + (m >> 14) + xh * h;
+        w[j++] = l & 0xfffffff;
+    }
+    return c;
+}
+if (j_lm && (navigator2.appName == "Microsoft Internet Explorer")) {
+    BigInteger.prototype.am = am2;
+    dbits = 30;
+}
+else if (j_lm && (navigator2.appName != "Netscape")) {
+    BigInteger.prototype.am = am1;
+    dbits = 26;
+}
+else { // Mozilla/Netscape seems to prefer am3
+    BigInteger.prototype.am = am3;
+    dbits = 28;
+}
+BigInteger.prototype.DB = dbits;
+BigInteger.prototype.DM = ((1 << dbits) - 1);
+BigInteger.prototype.DV = (1 << dbits);
+var BI_FP = 52;
+BigInteger.prototype.FV = Math.pow(2, BI_FP);
+BigInteger.prototype.F1 = BI_FP - dbits;
+BigInteger.prototype.F2 = 2 * dbits - BI_FP;
+// Digit conversions
+var BI_RC = [];
+var rr;
+var vv;
+rr = "0".charCodeAt(0);
+for (vv = 0; vv <= 9; ++vv) {
+    BI_RC[rr++] = vv;
+}
+rr = "a".charCodeAt(0);
+for (vv = 10; vv < 36; ++vv) {
+    BI_RC[rr++] = vv;
+}
+rr = "A".charCodeAt(0);
+for (vv = 10; vv < 36; ++vv) {
+    BI_RC[rr++] = vv;
+}
+function intAt(s, i) {
+    var c = BI_RC[s.charCodeAt(i)];
+    return (c == null) ? -1 : c;
+}
+// return bigint initialized to value
+function nbv(i) {
+    var r = nbi();
+    r.fromInt(i);
+    return r;
+}
+// returns bit length of the integer x
+function nbits(x) {
+    var r = 1;
+    var t;
+    if ((t = x >>> 16) != 0) {
+        x = t;
+        r += 16;
+    }
+    if ((t = x >> 8) != 0) {
+        x = t;
+        r += 8;
+    }
+    if ((t = x >> 4) != 0) {
+        x = t;
+        r += 4;
+    }
+    if ((t = x >> 2) != 0) {
+        x = t;
+        r += 2;
+    }
+    if ((t = x >> 1) != 0) {
+        x = t;
+        r += 1;
+    }
+    return r;
+}
+// "constants"
+BigInteger.ZERO = nbv(0);
+BigInteger.ONE = nbv(1);
+
+// prng4.js - uses Arcfour as a PRNG
+var Arcfour = /** @class */ (function () {
+    function Arcfour() {
+        this.i = 0;
+        this.j = 0;
+        this.S = [];
+    }
+    // Arcfour.prototype.init = ARC4init;
+    // Initialize arcfour context from key, an array of ints, each from [0..255]
+    Arcfour.prototype.init = function (key) {
+        var i;
+        var j;
+        var t;
+        for (i = 0; i < 256; ++i) {
+            this.S[i] = i;
+        }
+        j = 0;
+        for (i = 0; i < 256; ++i) {
+            j = (j + this.S[i] + key[i % key.length]) & 255;
+            t = this.S[i];
+            this.S[i] = this.S[j];
+            this.S[j] = t;
+        }
+        this.i = 0;
+        this.j = 0;
+    };
+    // Arcfour.prototype.next = ARC4next;
+    Arcfour.prototype.next = function () {
+        var t;
+        this.i = (this.i + 1) & 255;
+        this.j = (this.j + this.S[this.i]) & 255;
+        t = this.S[this.i];
+        this.S[this.i] = this.S[this.j];
+        this.S[this.j] = t;
+        return this.S[(t + this.S[this.i]) & 255];
+    };
+    return Arcfour;
+}());
+// Plug in your RNG constructor here
+function prng_newstate() {
+    return new Arcfour();
+}
+// Pool size must be a multiple of 4 and greater than 32.
+// An array of bytes the size of the pool will be passed to init()
+var rng_psize = 256;
+
+// Random number generator - requires a PRNG backend, e.g. prng4.js
+var rng_state;
+var rng_pool = null;
+var rng_pptr;
+// Initialize the pool with junk if needed.
+if (rng_pool == null) {
+    rng_pool = [];
+    rng_pptr = 0;
+    var t = void 0;
+    if (window2.crypto && window2.crypto.getRandomValues) {
+        // Extract entropy (2048 bits) from RNG if available
+        var z = new Uint32Array(256);
+        window2.crypto.getRandomValues(z);
+        for (t = 0; t < z.length; ++t) {
+            rng_pool[rng_pptr++] = z[t] & 255;
+        }
+    }
+    // Use mouse events for entropy, if we do not have enough entropy by the time
+    // we need it, entropy will be generated by Math.random.
+    var onMouseMoveListener_1 = function (ev) {
+        this.count = this.count || 0;
+        if (this.count >= 256 || rng_pptr >= rng_psize) {
+            if (window2.removeEventListener) {
+                window2.removeEventListener("mousemove", onMouseMoveListener_1, false);
+            }
+            else if (window2.detachEvent) {
+                window2.detachEvent("onmousemove", onMouseMoveListener_1);
+            }
+            return;
+        }
+        try {
+            var mouseCoordinates = ev.x + ev.y;
+            rng_pool[rng_pptr++] = mouseCoordinates & 255;
+            this.count += 1;
+        }
+        catch (e) {
+            // Sometimes Firefox will deny permission to access event properties for some reason. Ignore.
+        }
+    };
+    if (window2.addEventListener) {
+        window2.addEventListener("mousemove", onMouseMoveListener_1, false);
+    }
+    else if (window2.attachEvent) {
+        window2.attachEvent("onmousemove", onMouseMoveListener_1);
+    }
+}
+function rng_get_byte() {
+    if (rng_state == null) {
+        rng_state = prng_newstate();
+        // At this point, we may not have collected enough entropy.  If not, fall back to Math.random
+        while (rng_pptr < rng_psize) {
+            var random = Math.floor(65536 * Math.random());
+            rng_pool[rng_pptr++] = random & 255;
+        }
+        rng_state.init(rng_pool);
+        for (rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) {
+            rng_pool[rng_pptr] = 0;
+        }
+        rng_pptr = 0;
+    }
+    // TODO: allow reseeding after first request
+    return rng_state.next();
+}
+var SecureRandom = /** @class */ (function () {
+    function SecureRandom() {
+    }
+    SecureRandom.prototype.nextBytes = function (ba) {
+        for (var i = 0; i < ba.length; ++i) {
+            ba[i] = rng_get_byte();
+        }
+    };
+    return SecureRandom;
+}());
+
+// Depends on jsbn.js and rng.js
+// function linebrk(s,n) {
+//   var ret = "";
+//   var i = 0;
+//   while(i + n < s.length) {
+//     ret += s.substring(i,i+n) + "\n";
+//     i += n;
+//   }
+//   return ret + s.substring(i,s.length);
+// }
+// function byte2Hex(b) {
+//   if(b < 0x10)
+//     return "0" + b.toString(16);
+//   else
+//     return b.toString(16);
+// }
+function pkcs1pad1(s, n) {
+    if (n < s.length + 22) {
+        console.error("Message too long for RSA");
+        return null;
+    }
+    var len = n - s.length - 6;
+    var filler = "";
+    for (var f = 0; f < len; f += 2) {
+        filler += "ff";
+    }
+    var m = "0001" + filler + "00" + s;
+    return parseBigInt(m, 16);
+}
+// PKCS#1 (type 2, random) pad input string s to n bytes, and return a bigint
+function pkcs1pad2(s, n) {
+    if (n < s.length + 11) { // TODO: fix for utf-8
+        console.error("Message too long for RSA");
+        return null;
+    }
+    var ba = [];
+    var i = s.length - 1;
+    while (i >= 0 && n > 0) {
+        var c = s.charCodeAt(i--);
+        if (c < 128) { // encode using utf-8
+            ba[--n] = c;
+        }
+        else if ((c > 127) && (c < 2048)) {
+            ba[--n] = (c & 63) | 128;
+            ba[--n] = (c >> 6) | 192;
+        }
+        else {
+            ba[--n] = (c & 63) | 128;
+            ba[--n] = ((c >> 6) & 63) | 128;
+            ba[--n] = (c >> 12) | 224;
+        }
+    }
+    ba[--n] = 0;
+    var rng = new SecureRandom();
+    var x = [];
+    while (n > 2) { // random non-zero pad
+        x[0] = 0;
+        while (x[0] == 0) {
+            rng.nextBytes(x);
+        }
+        ba[--n] = x[0];
+    }
+    ba[--n] = 2;
+    ba[--n] = 0;
+    return new BigInteger(ba);
+}
+// "empty" RSA key constructor
+var RSAKey = /** @class */ (function () {
+    function RSAKey() {
+        this.n = null;
+        this.e = 0;
+        this.d = null;
+        this.p = null;
+        this.q = null;
+        this.dmp1 = null;
+        this.dmq1 = null;
+        this.coeff = null;
+    }
+    //#region PROTECTED
+    // protected
+    // RSAKey.prototype.doPublic = RSADoPublic;
+    // Perform raw public operation on "x": return x^e (mod n)
+    RSAKey.prototype.doPublic = function (x) {
+        return x.modPowInt(this.e, this.n);
+    };
+    // RSAKey.prototype.doPrivate = RSADoPrivate;
+    // Perform raw private operation on "x": return x^d (mod n)
+    RSAKey.prototype.doPrivate = function (x) {
+        if (this.p == null || this.q == null) {
+            return x.modPow(this.d, this.n);
+        }
+        // TODO: re-calculate any missing CRT params
+        var xp = x.mod(this.p).modPow(this.dmp1, this.p);
+        var xq = x.mod(this.q).modPow(this.dmq1, this.q);
+        while (xp.compareTo(xq) < 0) {
+            xp = xp.add(this.p);
+        }
+        return xp.subtract(xq).multiply(this.coeff).mod(this.p).multiply(this.q).add(xq);
+    };
+    //#endregion PROTECTED
+    //#region PUBLIC
+    // RSAKey.prototype.setPublic = RSASetPublic;
+    // Set the public key fields N and e from hex strings
+    RSAKey.prototype.setPublic = function (N, E) {
+        if (N != null && E != null && N.length > 0 && E.length > 0) {
+            this.n = parseBigInt(N, 16);
+            this.e = parseInt(E, 16);
+        }
+        else {
+            console.error("Invalid RSA public key");
+        }
+    };
+    // RSAKey.prototype.encrypt = RSAEncrypt;
+    // Return the PKCS#1 RSA encryption of "text" as an even-length hex string
+    RSAKey.prototype.encrypt = function (text) {
+        var m = pkcs1pad2(text, (this.n.bitLength() + 7) >> 3);
+        if (m == null) {
+            return null;
+        }
+        var c = this.doPublic(m);
+        if (c == null) {
+            return null;
+        }
+        var h = c.toString(16);
+        if ((h.length & 1) == 0) {
+            return h;
+        }
+        else {
+            return "0" + h;
+        }
+    };
+    // RSAKey.prototype.setPrivate = RSASetPrivate;
+    // Set the private key fields N, e, and d from hex strings
+    RSAKey.prototype.setPrivate = function (N, E, D) {
+        if (N != null && E != null && N.length > 0 && E.length > 0) {
+            this.n = parseBigInt(N, 16);
+            this.e = parseInt(E, 16);
+            this.d = parseBigInt(D, 16);
+        }
+        else {
+            console.error("Invalid RSA private key");
+        }
+    };
+    // RSAKey.prototype.setPrivateEx = RSASetPrivateEx;
+    // Set the private key fields N, e, d and CRT params from hex strings
+    RSAKey.prototype.setPrivateEx = function (N, E, D, P, Q, DP, DQ, C) {
+        if (N != null && E != null && N.length > 0 && E.length > 0) {
+            this.n = parseBigInt(N, 16);
+            this.e = parseInt(E, 16);
+            this.d = parseBigInt(D, 16);
+            this.p = parseBigInt(P, 16);
+            this.q = parseBigInt(Q, 16);
+            this.dmp1 = parseBigInt(DP, 16);
+            this.dmq1 = parseBigInt(DQ, 16);
+            this.coeff = parseBigInt(C, 16);
+        }
+        else {
+            console.error("Invalid RSA private key");
+        }
+    };
+    // RSAKey.prototype.generate = RSAGenerate;
+    // Generate a new random private key B bits long, using public expt E
+    RSAKey.prototype.generate = function (B, E) {
+        var rng = new SecureRandom();
+        var qs = B >> 1;
+        this.e = parseInt(E, 16);
+        var ee = new BigInteger(E, 16);
+        for (;;) {
+            for (;;) {
+                this.p = new BigInteger(B - qs, 1, rng);
+                if (this.p.subtract(BigInteger.ONE).gcd(ee).compareTo(BigInteger.ONE) == 0 && this.p.isProbablePrime(10)) {
+                    break;
+                }
+            }
+            for (;;) {
+                this.q = new BigInteger(qs, 1, rng);
+                if (this.q.subtract(BigInteger.ONE).gcd(ee).compareTo(BigInteger.ONE) == 0 && this.q.isProbablePrime(10)) {
+                    break;
+                }
+            }
+            if (this.p.compareTo(this.q) <= 0) {
+                var t = this.p;
+                this.p = this.q;
+                this.q = t;
+            }
+            var p1 = this.p.subtract(BigInteger.ONE);
+            var q1 = this.q.subtract(BigInteger.ONE);
+            var phi = p1.multiply(q1);
+            if (phi.gcd(ee).compareTo(BigInteger.ONE) == 0) {
+                this.n = this.p.multiply(this.q);
+                this.d = ee.modInverse(phi);
+                this.dmp1 = this.d.mod(p1);
+                this.dmq1 = this.d.mod(q1);
+                this.coeff = this.q.modInverse(this.p);
+                break;
+            }
+        }
+    };
+    // RSAKey.prototype.decrypt = RSADecrypt;
+    // Return the PKCS#1 RSA decryption of "ctext".
+    // "ctext" is an even-length hex string and the output is a plain string.
+    RSAKey.prototype.decrypt = function (ctext) {
+        var c = parseBigInt(ctext, 16);
+        var m = this.doPrivate(c);
+        if (m == null) {
+            return null;
+        }
+        return pkcs1unpad2(m, (this.n.bitLength() + 7) >> 3);
+    };
+    // Generate a new random private key B bits long, using public expt E
+    RSAKey.prototype.generateAsync = function (B, E, callback) {
+        var rng = new SecureRandom();
+        var qs = B >> 1;
+        this.e = parseInt(E, 16);
+        var ee = new BigInteger(E, 16);
+        var rsa = this;
+        // These functions have non-descript names because they were originally for(;;) loops.
+        // I don't know about cryptography to give them better names than loop1-4.
+        var loop1 = function () {
+            var loop4 = function () {
+                if (rsa.p.compareTo(rsa.q) <= 0) {
+                    var t = rsa.p;
+                    rsa.p = rsa.q;
+                    rsa.q = t;
+                }
+                var p1 = rsa.p.subtract(BigInteger.ONE);
+                var q1 = rsa.q.subtract(BigInteger.ONE);
+                var phi = p1.multiply(q1);
+                if (phi.gcd(ee).compareTo(BigInteger.ONE) == 0) {
+                    rsa.n = rsa.p.multiply(rsa.q);
+                    rsa.d = ee.modInverse(phi);
+                    rsa.dmp1 = rsa.d.mod(p1);
+                    rsa.dmq1 = rsa.d.mod(q1);
+                    rsa.coeff = rsa.q.modInverse(rsa.p);
+                    setTimeout(function () { callback(); }, 0); // escape
+                }
+                else {
+                    setTimeout(loop1, 0);
+                }
+            };
+            var loop3 = function () {
+                rsa.q = nbi();
+                rsa.q.fromNumberAsync(qs, 1, rng, function () {
+                    rsa.q.subtract(BigInteger.ONE).gcda(ee, function (r) {
+                        if (r.compareTo(BigInteger.ONE) == 0 && rsa.q.isProbablePrime(10)) {
+                            setTimeout(loop4, 0);
+                        }
+                        else {
+                            setTimeout(loop3, 0);
+                        }
+                    });
+                });
+            };
+            var loop2 = function () {
+                rsa.p = nbi();
+                rsa.p.fromNumberAsync(B - qs, 1, rng, function () {
+                    rsa.p.subtract(BigInteger.ONE).gcda(ee, function (r) {
+                        if (r.compareTo(BigInteger.ONE) == 0 && rsa.p.isProbablePrime(10)) {
+                            setTimeout(loop3, 0);
+                        }
+                        else {
+                            setTimeout(loop2, 0);
+                        }
+                    });
+                });
+            };
+            setTimeout(loop2, 0);
+        };
+        setTimeout(loop1, 0);
+    };
+    RSAKey.prototype.sign = function (text, digestMethod, digestName) {
+        var header = getDigestHeader(digestName);
+        var digest = header + digestMethod(text).toString();
+        var m = pkcs1pad1(digest, this.n.bitLength() / 4);
+        if (m == null) {
+            return null;
+        }
+        var c = this.doPrivate(m);
+        if (c == null) {
+            return null;
+        }
+        var h = c.toString(16);
+        if ((h.length & 1) == 0) {
+            return h;
+        }
+        else {
+            return "0" + h;
+        }
+    };
+    RSAKey.prototype.verify = function (text, signature, digestMethod) {
+        var c = parseBigInt(signature, 16);
+        var m = this.doPublic(c);
+        if (m == null) {
+            return null;
+        }
+        var unpadded = m.toString(16).replace(/^1f+00/, "");
+        var digest = removeDigestHeader(unpadded);
+        return digest == digestMethod(text).toString();
+    };
+    return RSAKey;
+}());
+// Undo PKCS#1 (type 2, random) padding and, if valid, return the plaintext
+function pkcs1unpad2(d, n) {
+    var b = d.toByteArray();
+    var i = 0;
+    while (i < b.length && b[i] == 0) {
+        ++i;
+    }
+    if (b.length - i != n - 1 || b[i] != 2) {
+        return null;
+    }
+    ++i;
+    while (b[i] != 0) {
+        if (++i >= b.length) {
+            return null;
+        }
+    }
+    var ret = "";
+    while (++i < b.length) {
+        var c = b[i] & 255;
+        if (c < 128) { // utf-8 decode
+            ret += String.fromCharCode(c);
+        }
+        else if ((c > 191) && (c < 224)) {
+            ret += String.fromCharCode(((c & 31) << 6) | (b[i + 1] & 63));
+            ++i;
+        }
+        else {
+            ret += String.fromCharCode(((c & 15) << 12) | ((b[i + 1] & 63) << 6) | (b[i + 2] & 63));
+            i += 2;
+        }
+    }
+    return ret;
+}
+// https://tools.ietf.org/html/rfc3447#page-43
+var DIGEST_HEADERS = {
+    md2: "3020300c06082a864886f70d020205000410",
+    md5: "3020300c06082a864886f70d020505000410",
+    sha1: "3021300906052b0e03021a05000414",
+    sha224: "302d300d06096086480165030402040500041c",
+    sha256: "3031300d060960864801650304020105000420",
+    sha384: "3041300d060960864801650304020205000430",
+    sha512: "3051300d060960864801650304020305000440",
+    ripemd160: "3021300906052b2403020105000414",
+};
+function getDigestHeader(name) {
+    return DIGEST_HEADERS[name] || "";
+}
+function removeDigestHeader(str) {
+    for (var name_1 in DIGEST_HEADERS) {
+        if (DIGEST_HEADERS.hasOwnProperty(name_1)) {
+            var header = DIGEST_HEADERS[name_1];
+            var len = header.length;
+            if (str.substr(0, len) == header) {
+                return str.substr(len);
+            }
+        }
+    }
+    return str;
+}
+// Return the PKCS#1 RSA encryption of "text" as a Base64-encoded string
+// function RSAEncryptB64(text) {
+//  var h = this.encrypt(text);
+//  if(h) return hex2b64(h); else return null;
+// }
+// public
+// RSAKey.prototype.encrypt_b64 = RSAEncryptB64;
+
+/*!
+Copyright (c) 2011, Yahoo! Inc. All rights reserved.
+Code licensed under the BSD License:
+http://developer.yahoo.com/yui/license.html
+version: 2.9.0
+*/
+var YAHOO = {};
+YAHOO.lang = {
+    /**
+     * Utility to set up the prototype, constructor and superclass properties to
+     * support an inheritance strategy that can chain constructors and methods.
+     * Static members will not be inherited.
+     *
+     * @method extend
+     * @static
+     * @param {Function} subc   the object to modify
+     * @param {Function} superc the object to inherit
+     * @param {Object} overrides  additional properties/methods to add to the
+     *                              subclass prototype.  These will override the
+     *                              matching items obtained from the superclass
+     *                              if present.
+     */
+    extend: function(subc, superc, overrides) {
+        if (! superc || ! subc) {
+            throw new Error("YAHOO.lang.extend failed, please check that " +
+                "all dependencies are included.");
+        }
+
+        var F = function() {};
+        F.prototype = superc.prototype;
+        subc.prototype = new F();
+        subc.prototype.constructor = subc;
+        subc.superclass = superc.prototype;
+
+        if (superc.prototype.constructor == Object.prototype.constructor) {
+            superc.prototype.constructor = superc;
+        }
+
+        if (overrides) {
+            var i;
+            for (i in overrides) {
+                subc.prototype[i] = overrides[i];
+            }
+
+            /*
+             * IE will not enumerate native functions in a derived object even if the
+             * function was overridden.  This is a workaround for specific functions
+             * we care about on the Object prototype.
+             * @property _IEEnumFix
+             * @param {Function} r  the object to receive the augmentation
+             * @param {Function} s  the object that supplies the properties to augment
+             * @static
+             * @private
+             */
+            var _IEEnumFix = function() {},
+                ADD = ["toString", "valueOf"];
+            try {
+                if (/MSIE/.test(navigator2.userAgent)) {
+                    _IEEnumFix = function(r, s) {
+                        for (i = 0; i < ADD.length; i = i + 1) {
+                            var fname = ADD[i], f = s[fname];
+                            if (typeof f === 'function' && f != Object.prototype[fname]) {
+                                r[fname] = f;
+                            }
+                        }
+                    };
+                }
+            } catch (ex) {}            _IEEnumFix(subc.prototype, overrides);
+        }
+    }
+};
+
+/* asn1-1.0.13.js (c) 2013-2017 Kenji Urushima | kjur.github.com/jsrsasign/license
+ */
+
+/**
+ * @fileOverview
+ * @name asn1-1.0.js
+ * @author Kenji Urushima kenji.urushima@gmail.com
+ * @version asn1 1.0.13 (2017-Jun-02)
+ * @since jsrsasign 2.1
+ * @license <a href="https://kjur.github.io/jsrsasign/license/">MIT License</a>
+ */
+
+/**
+ * kjur's class library name space
+ * <p>
+ * This name space provides following name spaces:
+ * <ul>
+ * <li>{@link KJUR.asn1} - ASN.1 primitive hexadecimal encoder</li>
+ * <li>{@link KJUR.asn1.x509} - ASN.1 structure for X.509 certificate and CRL</li>
+ * <li>{@link KJUR.crypto} - Java Cryptographic Extension(JCE) style MessageDigest/Signature
+ * class and utilities</li>
+ * </ul>
+ * </p>
+ * NOTE: Please ignore method summary and document of this namespace. This caused by a bug of jsdoc2.
+ * @name KJUR
+ * @namespace kjur's class library name space
+ */
+var KJUR = {};
+
+/**
+ * kjur's ASN.1 class library name space
+ * <p>
+ * This is ITU-T X.690 ASN.1 DER encoder class library and
+ * class structure and methods is very similar to
+ * org.bouncycastle.asn1 package of
+ * well known BouncyCaslte Cryptography Library.
+ * <h4>PROVIDING ASN.1 PRIMITIVES</h4>
+ * Here are ASN.1 DER primitive classes.
+ * <ul>
+ * <li>0x01 {@link KJUR.asn1.DERBoolean}</li>
+ * <li>0x02 {@link KJUR.asn1.DERInteger}</li>
+ * <li>0x03 {@link KJUR.asn1.DERBitString}</li>
+ * <li>0x04 {@link KJUR.asn1.DEROctetString}</li>
+ * <li>0x05 {@link KJUR.asn1.DERNull}</li>
+ * <li>0x06 {@link KJUR.asn1.DERObjectIdentifier}</li>
+ * <li>0x0a {@link KJUR.asn1.DEREnumerated}</li>
+ * <li>0x0c {@link KJUR.asn1.DERUTF8String}</li>
+ * <li>0x12 {@link KJUR.asn1.DERNumericString}</li>
+ * <li>0x13 {@link KJUR.asn1.DERPrintableString}</li>
+ * <li>0x14 {@link KJUR.asn1.DERTeletexString}</li>
+ * <li>0x16 {@link KJUR.asn1.DERIA5String}</li>
+ * <li>0x17 {@link KJUR.asn1.DERUTCTime}</li>
+ * <li>0x18 {@link KJUR.asn1.DERGeneralizedTime}</li>
+ * <li>0x30 {@link KJUR.asn1.DERSequence}</li>
+ * <li>0x31 {@link KJUR.asn1.DERSet}</li>
+ * </ul>
+ * <h4>OTHER ASN.1 CLASSES</h4>
+ * <ul>
+ * <li>{@link KJUR.asn1.ASN1Object}</li>
+ * <li>{@link KJUR.asn1.DERAbstractString}</li>
+ * <li>{@link KJUR.asn1.DERAbstractTime}</li>
+ * <li>{@link KJUR.asn1.DERAbstractStructured}</li>
+ * <li>{@link KJUR.asn1.DERTaggedObject}</li>
+ * </ul>
+ * <h4>SUB NAME SPACES</h4>
+ * <ul>
+ * <li>{@link KJUR.asn1.cades} - CAdES long term signature format</li>
+ * <li>{@link KJUR.asn1.cms} - Cryptographic Message Syntax</li>
+ * <li>{@link KJUR.asn1.csr} - Certificate Signing Request (CSR/PKCS#10)</li>
+ * <li>{@link KJUR.asn1.tsp} - RFC 3161 Timestamping Protocol Format</li>
+ * <li>{@link KJUR.asn1.x509} - RFC 5280 X.509 certificate and CRL</li>
+ * </ul>
+ * </p>
+ * NOTE: Please ignore method summary and document of this namespace.
+ * This caused by a bug of jsdoc2.
+ * @name KJUR.asn1
+ * @namespace
+ */
+if (typeof KJUR.asn1 == "undefined" || !KJUR.asn1) KJUR.asn1 = {};
+
+/**
+ * ASN1 utilities class
+ * @name KJUR.asn1.ASN1Util
+ * @class ASN1 utilities class
+ * @since asn1 1.0.2
+ */
+KJUR.asn1.ASN1Util = new function() {
+    this.integerToByteHex = function(i) {
+        var h = i.toString(16);
+        if ((h.length % 2) == 1) h = '0' + h;
+        return h;
+    };
+    this.bigIntToMinTwosComplementsHex = function(bigIntegerValue) {
+        var h = bigIntegerValue.toString(16);
+        if (h.substr(0, 1) != '-') {
+            if (h.length % 2 == 1) {
+                h = '0' + h;
+            } else {
+                if (! h.match(/^[0-7]/)) {
+                    h = '00' + h;
+                }
+            }
+        } else {
+            var hPos = h.substr(1);
+            var xorLen = hPos.length;
+            if (xorLen % 2 == 1) {
+                xorLen += 1;
+            } else {
+                if (! h.match(/^[0-7]/)) {
+                    xorLen += 2;
+                }
+            }
+            var hMask = '';
+            for (var i = 0; i < xorLen; i++) {
+                hMask += 'f';
+            }
+            var biMask = new BigInteger(hMask, 16);
+            var biNeg = biMask.xor(bigIntegerValue).add(BigInteger.ONE);
+            h = biNeg.toString(16).replace(/^-/, '');
+        }
+        return h;
+    };
+    /**
+     * get PEM string from hexadecimal data and header string
+     * @name getPEMStringFromHex
+     * @memberOf KJUR.asn1.ASN1Util
+     * @function
+     * @param {String} dataHex hexadecimal string of PEM body
+     * @param {String} pemHeader PEM header string (ex. 'RSA PRIVATE KEY')
+     * @return {String} PEM formatted string of input data
+     * @description
+     * This method converts a hexadecimal string to a PEM string with
+     * a specified header. Its line break will be CRLF("\r\n").
+     * @example
+     * var pem  = KJUR.asn1.ASN1Util.getPEMStringFromHex('616161', 'RSA PRIVATE KEY');
+     * // value of pem will be:
+     * -----BEGIN PRIVATE KEY-----
+     * YWFh
+     * -----END PRIVATE KEY-----
+     */
+    this.getPEMStringFromHex = function(dataHex, pemHeader) {
+        return hextopem(dataHex, pemHeader);
+    };
+
+    /**
+     * generate ASN1Object specifed by JSON parameters
+     * @name newObject
+     * @memberOf KJUR.asn1.ASN1Util
+     * @function
+     * @param {Array} param JSON parameter to generate ASN1Object
+     * @return {KJUR.asn1.ASN1Object} generated object
+     * @since asn1 1.0.3
+     * @description
+     * generate any ASN1Object specified by JSON param
+     * including ASN.1 primitive or structured.
+     * Generally 'param' can be described as follows:
+     * <blockquote>
+     * {TYPE-OF-ASNOBJ: ASN1OBJ-PARAMETER}
+     * </blockquote>
+     * 'TYPE-OF-ASN1OBJ' can be one of following symbols:
+     * <ul>
+     * <li>'bool' - DERBoolean</li>
+     * <li>'int' - DERInteger</li>
+     * <li>'bitstr' - DERBitString</li>
+     * <li>'octstr' - DEROctetString</li>
+     * <li>'null' - DERNull</li>
+     * <li>'oid' - DERObjectIdentifier</li>
+     * <li>'enum' - DEREnumerated</li>
+     * <li>'utf8str' - DERUTF8String</li>
+     * <li>'numstr' - DERNumericString</li>
+     * <li>'prnstr' - DERPrintableString</li>
+     * <li>'telstr' - DERTeletexString</li>
+     * <li>'ia5str' - DERIA5String</li>
+     * <li>'utctime' - DERUTCTime</li>
+     * <li>'gentime' - DERGeneralizedTime</li>
+     * <li>'seq' - DERSequence</li>
+     * <li>'set' - DERSet</li>
+     * <li>'tag' - DERTaggedObject</li>
+     * </ul>
+     * @example
+     * newObject({'prnstr': 'aaa'});
+     * newObject({'seq': [{'int': 3}, {'prnstr': 'aaa'}]})
+     * // ASN.1 Tagged Object
+     * newObject({'tag': {'tag': 'a1',
+     *                    'explicit': true,
+     *                    'obj': {'seq': [{'int': 3}, {'prnstr': 'aaa'}]}}});
+     * // more simple representation of ASN.1 Tagged Object
+     * newObject({'tag': ['a1',
+     *                    true,
+     *                    {'seq': [
+     *                      {'int': 3},
+     *                      {'prnstr': 'aaa'}]}
+     *                   ]});
+     */
+    this.newObject = function(param) {
+        var _KJUR = KJUR,
+            _KJUR_asn1 = _KJUR.asn1,
+            _DERBoolean = _KJUR_asn1.DERBoolean,
+            _DERInteger = _KJUR_asn1.DERInteger,
+            _DERBitString = _KJUR_asn1.DERBitString,
+            _DEROctetString = _KJUR_asn1.DEROctetString,
+            _DERNull = _KJUR_asn1.DERNull,
+            _DERObjectIdentifier = _KJUR_asn1.DERObjectIdentifier,
+            _DEREnumerated = _KJUR_asn1.DEREnumerated,
+            _DERUTF8String = _KJUR_asn1.DERUTF8String,
+            _DERNumericString = _KJUR_asn1.DERNumericString,
+            _DERPrintableString = _KJUR_asn1.DERPrintableString,
+            _DERTeletexString = _KJUR_asn1.DERTeletexString,
+            _DERIA5String = _KJUR_asn1.DERIA5String,
+            _DERUTCTime = _KJUR_asn1.DERUTCTime,
+            _DERGeneralizedTime = _KJUR_asn1.DERGeneralizedTime,
+            _DERSequence = _KJUR_asn1.DERSequence,
+            _DERSet = _KJUR_asn1.DERSet,
+            _DERTaggedObject = _KJUR_asn1.DERTaggedObject,
+            _newObject = _KJUR_asn1.ASN1Util.newObject;
+
+        var keys = Object.keys(param);
+        if (keys.length != 1)
+            throw "key of param shall be only one.";
+        var key = keys[0];
+
+        if (":bool:int:bitstr:octstr:null:oid:enum:utf8str:numstr:prnstr:telstr:ia5str:utctime:gentime:seq:set:tag:".indexOf(":" + key + ":") == -1)
+            throw "undefined key: " + key;
+
+        if (key == "bool")    return new _DERBoolean(param[key]);
+        if (key == "int")     return new _DERInteger(param[key]);
+        if (key == "bitstr")  return new _DERBitString(param[key]);
+        if (key == "octstr")  return new _DEROctetString(param[key]);
+        if (key == "null")    return new _DERNull(param[key]);
+        if (key == "oid")     return new _DERObjectIdentifier(param[key]);
+        if (key == "enum")    return new _DEREnumerated(param[key]);
+        if (key == "utf8str") return new _DERUTF8String(param[key]);
+        if (key == "numstr")  return new _DERNumericString(param[key]);
+        if (key == "prnstr")  return new _DERPrintableString(param[key]);
+        if (key == "telstr")  return new _DERTeletexString(param[key]);
+        if (key == "ia5str")  return new _DERIA5String(param[key]);
+        if (key == "utctime") return new _DERUTCTime(param[key]);
+        if (key == "gentime") return new _DERGeneralizedTime(param[key]);
+
+        if (key == "seq") {
+            var paramList = param[key];
+            var a = [];
+            for (var i = 0; i < paramList.length; i++) {
+                var asn1Obj = _newObject(paramList[i]);
+                a.push(asn1Obj);
+            }
+            return new _DERSequence({'array': a});
+        }
+
+        if (key == "set") {
+            var paramList = param[key];
+            var a = [];
+            for (var i = 0; i < paramList.length; i++) {
+                var asn1Obj = _newObject(paramList[i]);
+                a.push(asn1Obj);
+            }
+            return new _DERSet({'array': a});
+        }
+
+        if (key == "tag") {
+            var tagParam = param[key];
+            if (Object.prototype.toString.call(tagParam) === '[object Array]' &&
+                tagParam.length == 3) {
+                var obj = _newObject(tagParam[2]);
+                return new _DERTaggedObject({tag: tagParam[0],
+                    explicit: tagParam[1],
+                    obj: obj});
+            } else {
+                var newParam = {};
+                if (tagParam.explicit !== undefined)
+                    newParam.explicit = tagParam.explicit;
+                if (tagParam.tag !== undefined)
+                    newParam.tag = tagParam.tag;
+                if (tagParam.obj === undefined)
+                    throw "obj shall be specified for 'tag'.";
+                newParam.obj = _newObject(tagParam.obj);
+                return new _DERTaggedObject(newParam);
+            }
+        }
+    };
+
+    /**
+     * get encoded hexadecimal string of ASN1Object specifed by JSON parameters
+     * @name jsonToASN1HEX
+     * @memberOf KJUR.asn1.ASN1Util
+     * @function
+     * @param {Array} param JSON parameter to generate ASN1Object
+     * @return hexadecimal string of ASN1Object
+     * @since asn1 1.0.4
+     * @description
+     * As for ASN.1 object representation of JSON object,
+     * please see {@link newObject}.
+     * @example
+     * jsonToASN1HEX({'prnstr': 'aaa'});
+     */
+    this.jsonToASN1HEX = function(param) {
+        var asn1Obj = this.newObject(param);
+        return asn1Obj.getEncodedHex();
+    };
+};
+
+/**
+ * get dot noted oid number string from hexadecimal value of OID
+ * @name oidHexToInt
+ * @memberOf KJUR.asn1.ASN1Util
+ * @function
+ * @param {String} hex hexadecimal value of object identifier
+ * @return {String} dot noted string of object identifier
+ * @since jsrsasign 4.8.3 asn1 1.0.7
+ * @description
+ * This static method converts from hexadecimal string representation of
+ * ASN.1 value of object identifier to oid number string.
+ * @example
+ * KJUR.asn1.ASN1Util.oidHexToInt('550406') &rarr; "2.5.4.6"
+ */
+KJUR.asn1.ASN1Util.oidHexToInt = function(hex) {
+    var s = "";
+    var i01 = parseInt(hex.substr(0, 2), 16);
+    var i0 = Math.floor(i01 / 40);
+    var i1 = i01 % 40;
+    var s = i0 + "." + i1;
+
+    var binbuf = "";
+    for (var i = 2; i < hex.length; i += 2) {
+        var value = parseInt(hex.substr(i, 2), 16);
+        var bin = ("00000000" + value.toString(2)).slice(- 8);
+        binbuf = binbuf + bin.substr(1, 7);
+        if (bin.substr(0, 1) == "0") {
+            var bi = new BigInteger(binbuf, 2);
+            s = s + "." + bi.toString(10);
+            binbuf = "";
+        }
+    }
+    return s;
+};
+
+/**
+ * get hexadecimal value of object identifier from dot noted oid value
+ * @name oidIntToHex
+ * @memberOf KJUR.asn1.ASN1Util
+ * @function
+ * @param {String} oidString dot noted string of object identifier
+ * @return {String} hexadecimal value of object identifier
+ * @since jsrsasign 4.8.3 asn1 1.0.7
+ * @description
+ * This static method converts from object identifier value string.
+ * to hexadecimal string representation of it.
+ * @example
+ * KJUR.asn1.ASN1Util.oidIntToHex("2.5.4.6") &rarr; "550406"
+ */
+KJUR.asn1.ASN1Util.oidIntToHex = function(oidString) {
+    var itox = function(i) {
+        var h = i.toString(16);
+        if (h.length == 1) h = '0' + h;
+        return h;
+    };
+
+    var roidtox = function(roid) {
+        var h = '';
+        var bi = new BigInteger(roid, 10);
+        var b = bi.toString(2);
+        var padLen = 7 - b.length % 7;
+        if (padLen == 7) padLen = 0;
+        var bPad = '';
+        for (var i = 0; i < padLen; i++) bPad += '0';
+        b = bPad + b;
+        for (var i = 0; i < b.length - 1; i += 7) {
+            var b8 = b.substr(i, 7);
+            if (i != b.length - 7) b8 = '1' + b8;
+            h += itox(parseInt(b8, 2));
+        }
+        return h;
+    };
+
+    if (! oidString.match(/^[0-9.]+$/)) {
+        throw "malformed oid string: " + oidString;
+    }
+    var h = '';
+    var a = oidString.split('.');
+    var i0 = parseInt(a[0]) * 40 + parseInt(a[1]);
+    h += itox(i0);
+    a.splice(0, 2);
+    for (var i = 0; i < a.length; i++) {
+        h += roidtox(a[i]);
+    }
+    return h;
+};
+
+
+// ********************************************************************
+//  Abstract ASN.1 Classes
+// ********************************************************************
+
+// ********************************************************************
+
+/**
+ * base class for ASN.1 DER encoder object
+ * @name KJUR.asn1.ASN1Object
+ * @class base class for ASN.1 DER encoder object
+ * @property {Boolean} isModified flag whether internal data was changed
+ * @property {String} hTLV hexadecimal string of ASN.1 TLV
+ * @property {String} hT hexadecimal string of ASN.1 TLV tag(T)
+ * @property {String} hL hexadecimal string of ASN.1 TLV length(L)
+ * @property {String} hV hexadecimal string of ASN.1 TLV value(V)
+ * @description
+ */
+KJUR.asn1.ASN1Object = function() {
+    var hV = '';
+
+    /**
+     * get hexadecimal ASN.1 TLV length(L) bytes from TLV value(V)
+     * @name getLengthHexFromValue
+     * @memberOf KJUR.asn1.ASN1Object#
+     * @function
+     * @return {String} hexadecimal string of ASN.1 TLV length(L)
+     */
+    this.getLengthHexFromValue = function() {
+        if (typeof this.hV == "undefined" || this.hV == null) {
+            throw "this.hV is null or undefined.";
+        }
+        if (this.hV.length % 2 == 1) {
+            throw "value hex must be even length: n=" + hV.length + ",v=" + this.hV;
+        }
+        var n = this.hV.length / 2;
+        var hN = n.toString(16);
+        if (hN.length % 2 == 1) {
+            hN = "0" + hN;
+        }
+        if (n < 128) {
+            return hN;
+        } else {
+            var hNlen = hN.length / 2;
+            if (hNlen > 15) {
+                throw "ASN.1 length too long to represent by 8x: n = " + n.toString(16);
+            }
+            var head = 128 + hNlen;
+            return head.toString(16) + hN;
+        }
+    };
+
+    /**
+     * get hexadecimal string of ASN.1 TLV bytes
+     * @name getEncodedHex
+     * @memberOf KJUR.asn1.ASN1Object#
+     * @function
+     * @return {String} hexadecimal string of ASN.1 TLV
+     */
+    this.getEncodedHex = function() {
+        if (this.hTLV == null || this.isModified) {
+            this.hV = this.getFreshValueHex();
+            this.hL = this.getLengthHexFromValue();
+            this.hTLV = this.hT + this.hL + this.hV;
+            this.isModified = false;
+            //alert("first time: " + this.hTLV);
+        }
+        return this.hTLV;
+    };
+
+    /**
+     * get hexadecimal string of ASN.1 TLV value(V) bytes
+     * @name getValueHex
+     * @memberOf KJUR.asn1.ASN1Object#
+     * @function
+     * @return {String} hexadecimal string of ASN.1 TLV value(V) bytes
+     */
+    this.getValueHex = function() {
+        this.getEncodedHex();
+        return this.hV;
+    };
+
+    this.getFreshValueHex = function() {
+        return '';
+    };
+};
+
+// == BEGIN DERAbstractString ================================================
+/**
+ * base class for ASN.1 DER string classes
+ * @name KJUR.asn1.DERAbstractString
+ * @class base class for ASN.1 DER string classes
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @property {String} s internal string of value
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>str - specify initial ASN.1 value(V) by a string</li>
+ * <li>hex - specify initial ASN.1 value(V) by a hexadecimal string</li>
+ * </ul>
+ * NOTE: 'params' can be omitted.
+ */
+KJUR.asn1.DERAbstractString = function(params) {
+    KJUR.asn1.DERAbstractString.superclass.constructor.call(this);
+
+    /**
+     * get string value of this string object
+     * @name getString
+     * @memberOf KJUR.asn1.DERAbstractString#
+     * @function
+     * @return {String} string value of this string object
+     */
+    this.getString = function() {
+        return this.s;
+    };
+
+    /**
+     * set value by a string
+     * @name setString
+     * @memberOf KJUR.asn1.DERAbstractString#
+     * @function
+     * @param {String} newS value by a string to set
+     */
+    this.setString = function(newS) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.s = newS;
+        this.hV = stohex(this.s);
+    };
+
+    /**
+     * set value by a hexadecimal string
+     * @name setStringHex
+     * @memberOf KJUR.asn1.DERAbstractString#
+     * @function
+     * @param {String} newHexString value by a hexadecimal string to set
+     */
+    this.setStringHex = function(newHexString) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.s = null;
+        this.hV = newHexString;
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+
+    if (typeof params != "undefined") {
+        if (typeof params == "string") {
+            this.setString(params);
+        } else if (typeof params['str'] != "undefined") {
+            this.setString(params['str']);
+        } else if (typeof params['hex'] != "undefined") {
+            this.setStringHex(params['hex']);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERAbstractString, KJUR.asn1.ASN1Object);
+// == END   DERAbstractString ================================================
+
+// == BEGIN DERAbstractTime ==================================================
+/**
+ * base class for ASN.1 DER Generalized/UTCTime class
+ * @name KJUR.asn1.DERAbstractTime
+ * @class base class for ASN.1 DER Generalized/UTCTime class
+ * @param {Array} params associative array of parameters (ex. {'str': '130430235959Z'})
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * @see KJUR.asn1.ASN1Object - superclass
+ */
+KJUR.asn1.DERAbstractTime = function(params) {
+    KJUR.asn1.DERAbstractTime.superclass.constructor.call(this);
+
+    // --- PRIVATE METHODS --------------------
+    this.localDateToUTC = function(d) {
+        utc = d.getTime() + (d.getTimezoneOffset() * 60000);
+        var utcDate = new Date(utc);
+        return utcDate;
+    };
+
+    /*
+     * format date string by Data object
+     * @name formatDate
+     * @memberOf KJUR.asn1.AbstractTime;
+     * @param {Date} dateObject
+     * @param {string} type 'utc' or 'gen'
+     * @param {boolean} withMillis flag for with millisections or not
+     * @description
+     * 'withMillis' flag is supported from asn1 1.0.6.
+     */
+    this.formatDate = function(dateObject, type, withMillis) {
+        var pad = this.zeroPadding;
+        var d = this.localDateToUTC(dateObject);
+        var year = String(d.getFullYear());
+        if (type == 'utc') year = year.substr(2, 2);
+        var month = pad(String(d.getMonth() + 1), 2);
+        var day = pad(String(d.getDate()), 2);
+        var hour = pad(String(d.getHours()), 2);
+        var min = pad(String(d.getMinutes()), 2);
+        var sec = pad(String(d.getSeconds()), 2);
+        var s = year + month + day + hour + min + sec;
+        if (withMillis === true) {
+            var millis = d.getMilliseconds();
+            if (millis != 0) {
+                var sMillis = pad(String(millis), 3);
+                sMillis = sMillis.replace(/[0]+$/, "");
+                s = s + "." + sMillis;
+            }
+        }
+        return s + "Z";
+    };
+
+    this.zeroPadding = function(s, len) {
+        if (s.length >= len) return s;
+        return new Array(len - s.length + 1).join('0') + s;
+    };
+
+    // --- PUBLIC METHODS --------------------
+    /**
+     * get string value of this string object
+     * @name getString
+     * @memberOf KJUR.asn1.DERAbstractTime#
+     * @function
+     * @return {String} string value of this time object
+     */
+    this.getString = function() {
+        return this.s;
+    };
+
+    /**
+     * set value by a string
+     * @name setString
+     * @memberOf KJUR.asn1.DERAbstractTime#
+     * @function
+     * @param {String} newS value by a string to set such like "130430235959Z"
+     */
+    this.setString = function(newS) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.s = newS;
+        this.hV = stohex(newS);
+    };
+
+    /**
+     * set value by a Date object
+     * @name setByDateValue
+     * @memberOf KJUR.asn1.DERAbstractTime#
+     * @function
+     * @param {Integer} year year of date (ex. 2013)
+     * @param {Integer} month month of date between 1 and 12 (ex. 12)
+     * @param {Integer} day day of month
+     * @param {Integer} hour hours of date
+     * @param {Integer} min minutes of date
+     * @param {Integer} sec seconds of date
+     */
+    this.setByDateValue = function(year, month, day, hour, min, sec) {
+        var dateObject = new Date(Date.UTC(year, month - 1, day, hour, min, sec, 0));
+        this.setByDate(dateObject);
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+};
+YAHOO.lang.extend(KJUR.asn1.DERAbstractTime, KJUR.asn1.ASN1Object);
+// == END   DERAbstractTime ==================================================
+
+// == BEGIN DERAbstractStructured ============================================
+/**
+ * base class for ASN.1 DER structured class
+ * @name KJUR.asn1.DERAbstractStructured
+ * @class base class for ASN.1 DER structured class
+ * @property {Array} asn1Array internal array of ASN1Object
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * @see KJUR.asn1.ASN1Object - superclass
+ */
+KJUR.asn1.DERAbstractStructured = function(params) {
+    KJUR.asn1.DERAbstractString.superclass.constructor.call(this);
+
+    /**
+     * set value by array of ASN1Object
+     * @name setByASN1ObjectArray
+     * @memberOf KJUR.asn1.DERAbstractStructured#
+     * @function
+     * @param {array} asn1ObjectArray array of ASN1Object to set
+     */
+    this.setByASN1ObjectArray = function(asn1ObjectArray) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.asn1Array = asn1ObjectArray;
+    };
+
+    /**
+     * append an ASN1Object to internal array
+     * @name appendASN1Object
+     * @memberOf KJUR.asn1.DERAbstractStructured#
+     * @function
+     * @param {ASN1Object} asn1Object to add
+     */
+    this.appendASN1Object = function(asn1Object) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.asn1Array.push(asn1Object);
+    };
+
+    this.asn1Array = new Array();
+    if (typeof params != "undefined") {
+        if (typeof params['array'] != "undefined") {
+            this.asn1Array = params['array'];
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERAbstractStructured, KJUR.asn1.ASN1Object);
+
+
+// ********************************************************************
+//  ASN.1 Object Classes
+// ********************************************************************
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER Boolean
+ * @name KJUR.asn1.DERBoolean
+ * @class class for ASN.1 DER Boolean
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * @see KJUR.asn1.ASN1Object - superclass
+ */
+KJUR.asn1.DERBoolean = function() {
+    KJUR.asn1.DERBoolean.superclass.constructor.call(this);
+    this.hT = "01";
+    this.hTLV = "0101ff";
+};
+YAHOO.lang.extend(KJUR.asn1.DERBoolean, KJUR.asn1.ASN1Object);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER Integer
+ * @name KJUR.asn1.DERInteger
+ * @class class for ASN.1 DER Integer
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>int - specify initial ASN.1 value(V) by integer value</li>
+ * <li>bigint - specify initial ASN.1 value(V) by BigInteger object</li>
+ * <li>hex - specify initial ASN.1 value(V) by a hexadecimal string</li>
+ * </ul>
+ * NOTE: 'params' can be omitted.
+ */
+KJUR.asn1.DERInteger = function(params) {
+    KJUR.asn1.DERInteger.superclass.constructor.call(this);
+    this.hT = "02";
+
+    /**
+     * set value by Tom Wu's BigInteger object
+     * @name setByBigInteger
+     * @memberOf KJUR.asn1.DERInteger#
+     * @function
+     * @param {BigInteger} bigIntegerValue to set
+     */
+    this.setByBigInteger = function(bigIntegerValue) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.hV = KJUR.asn1.ASN1Util.bigIntToMinTwosComplementsHex(bigIntegerValue);
+    };
+
+    /**
+     * set value by integer value
+     * @name setByInteger
+     * @memberOf KJUR.asn1.DERInteger
+     * @function
+     * @param {Integer} integer value to set
+     */
+    this.setByInteger = function(intValue) {
+        var bi = new BigInteger(String(intValue), 10);
+        this.setByBigInteger(bi);
+    };
+
+    /**
+     * set value by integer value
+     * @name setValueHex
+     * @memberOf KJUR.asn1.DERInteger#
+     * @function
+     * @param {String} hexadecimal string of integer value
+     * @description
+     * <br/>
+     * NOTE: Value shall be represented by minimum octet length of
+     * two's complement representation.
+     * @example
+     * new KJUR.asn1.DERInteger(123);
+     * new KJUR.asn1.DERInteger({'int': 123});
+     * new KJUR.asn1.DERInteger({'hex': '1fad'});
+     */
+    this.setValueHex = function(newHexString) {
+        this.hV = newHexString;
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+
+    if (typeof params != "undefined") {
+        if (typeof params['bigint'] != "undefined") {
+            this.setByBigInteger(params['bigint']);
+        } else if (typeof params['int'] != "undefined") {
+            this.setByInteger(params['int']);
+        } else if (typeof params == "number") {
+            this.setByInteger(params);
+        } else if (typeof params['hex'] != "undefined") {
+            this.setValueHex(params['hex']);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERInteger, KJUR.asn1.ASN1Object);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER encoded BitString primitive
+ * @name KJUR.asn1.DERBitString
+ * @class class for ASN.1 DER encoded BitString primitive
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>bin - specify binary string (ex. '10111')</li>
+ * <li>array - specify array of boolean (ex. [true,false,true,true])</li>
+ * <li>hex - specify hexadecimal string of ASN.1 value(V) including unused bits</li>
+ * <li>obj - specify {@link KJUR.asn1.ASN1Util.newObject}
+ * argument for "BitString encapsulates" structure.</li>
+ * </ul>
+ * NOTE1: 'params' can be omitted.<br/>
+ * NOTE2: 'obj' parameter have been supported since
+ * asn1 1.0.11, jsrsasign 6.1.1 (2016-Sep-25).<br/>
+ * @example
+ * // default constructor
+ * o = new KJUR.asn1.DERBitString();
+ * // initialize with binary string
+ * o = new KJUR.asn1.DERBitString({bin: "1011"});
+ * // initialize with boolean array
+ * o = new KJUR.asn1.DERBitString({array: [true,false,true,true]});
+ * // initialize with hexadecimal string (04 is unused bits)
+ * o = new KJUR.asn1.DEROctetString({hex: "04bac0"});
+ * // initialize with ASN1Util.newObject argument for encapsulated
+ * o = new KJUR.asn1.DERBitString({obj: {seq: [{int: 3}, {prnstr: 'aaa'}]}});
+ * // above generates a ASN.1 data like this:
+ * // BIT STRING, encapsulates {
+ * //   SEQUENCE {
+ * //     INTEGER 3
+ * //     PrintableString 'aaa'
+ * //     }
+ * //   }
+ */
+KJUR.asn1.DERBitString = function(params) {
+    if (params !== undefined && typeof params.obj !== "undefined") {
+        var o = KJUR.asn1.ASN1Util.newObject(params.obj);
+        params.hex = "00" + o.getEncodedHex();
+    }
+    KJUR.asn1.DERBitString.superclass.constructor.call(this);
+    this.hT = "03";
+
+    /**
+     * set ASN.1 value(V) by a hexadecimal string including unused bits
+     * @name setHexValueIncludingUnusedBits
+     * @memberOf KJUR.asn1.DERBitString#
+     * @function
+     * @param {String} newHexStringIncludingUnusedBits
+     */
+    this.setHexValueIncludingUnusedBits = function(newHexStringIncludingUnusedBits) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.hV = newHexStringIncludingUnusedBits;
+    };
+
+    /**
+     * set ASN.1 value(V) by unused bit and hexadecimal string of value
+     * @name setUnusedBitsAndHexValue
+     * @memberOf KJUR.asn1.DERBitString#
+     * @function
+     * @param {Integer} unusedBits
+     * @param {String} hValue
+     */
+    this.setUnusedBitsAndHexValue = function(unusedBits, hValue) {
+        if (unusedBits < 0 || 7 < unusedBits) {
+            throw "unused bits shall be from 0 to 7: u = " + unusedBits;
+        }
+        var hUnusedBits = "0" + unusedBits;
+        this.hTLV = null;
+        this.isModified = true;
+        this.hV = hUnusedBits + hValue;
+    };
+
+    /**
+     * set ASN.1 DER BitString by binary string<br/>
+     * @name setByBinaryString
+     * @memberOf KJUR.asn1.DERBitString#
+     * @function
+     * @param {String} binaryString binary value string (i.e. '10111')
+     * @description
+     * Its unused bits will be calculated automatically by length of
+     * 'binaryValue'. <br/>
+     * NOTE: Trailing zeros '0' will be ignored.
+     * @example
+     * o = new KJUR.asn1.DERBitString();
+     * o.setByBooleanArray("01011");
+     */
+    this.setByBinaryString = function(binaryString) {
+        binaryString = binaryString.replace(/0+$/, '');
+        var unusedBits = 8 - binaryString.length % 8;
+        if (unusedBits == 8) unusedBits = 0;
+        for (var i = 0; i <= unusedBits; i++) {
+            binaryString += '0';
+        }
+        var h = '';
+        for (var i = 0; i < binaryString.length - 1; i += 8) {
+            var b = binaryString.substr(i, 8);
+            var x = parseInt(b, 2).toString(16);
+            if (x.length == 1) x = '0' + x;
+            h += x;
+        }
+        this.hTLV = null;
+        this.isModified = true;
+        this.hV = '0' + unusedBits + h;
+    };
+
+    /**
+     * set ASN.1 TLV value(V) by an array of boolean<br/>
+     * @name setByBooleanArray
+     * @memberOf KJUR.asn1.DERBitString#
+     * @function
+     * @param {array} booleanArray array of boolean (ex. [true, false, true])
+     * @description
+     * NOTE: Trailing falses will be ignored in the ASN.1 DER Object.
+     * @example
+     * o = new KJUR.asn1.DERBitString();
+     * o.setByBooleanArray([false, true, false, true, true]);
+     */
+    this.setByBooleanArray = function(booleanArray) {
+        var s = '';
+        for (var i = 0; i < booleanArray.length; i++) {
+            if (booleanArray[i] == true) {
+                s += '1';
+            } else {
+                s += '0';
+            }
+        }
+        this.setByBinaryString(s);
+    };
+
+    /**
+     * generate an array of falses with specified length<br/>
+     * @name newFalseArray
+     * @memberOf KJUR.asn1.DERBitString
+     * @function
+     * @param {Integer} nLength length of array to generate
+     * @return {array} array of boolean falses
+     * @description
+     * This static method may be useful to initialize boolean array.
+     * @example
+     * o = new KJUR.asn1.DERBitString();
+     * o.newFalseArray(3) &rarr; [false, false, false]
+     */
+    this.newFalseArray = function(nLength) {
+        var a = new Array(nLength);
+        for (var i = 0; i < nLength; i++) {
+            a[i] = false;
+        }
+        return a;
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+
+    if (typeof params != "undefined") {
+        if (typeof params == "string" && params.toLowerCase().match(/^[0-9a-f]+$/)) {
+            this.setHexValueIncludingUnusedBits(params);
+        } else if (typeof params['hex'] != "undefined") {
+            this.setHexValueIncludingUnusedBits(params['hex']);
+        } else if (typeof params['bin'] != "undefined") {
+            this.setByBinaryString(params['bin']);
+        } else if (typeof params['array'] != "undefined") {
+            this.setByBooleanArray(params['array']);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERBitString, KJUR.asn1.ASN1Object);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER OctetString<br/>
+ * @name KJUR.asn1.DEROctetString
+ * @class class for ASN.1 DER OctetString
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @extends KJUR.asn1.DERAbstractString
+ * @description
+ * This class provides ASN.1 OctetString simple type.<br/>
+ * Supported "params" attributes are:
+ * <ul>
+ * <li>str - to set a string as a value</li>
+ * <li>hex - to set a hexadecimal string as a value</li>
+ * <li>obj - to set a encapsulated ASN.1 value by JSON object
+ * which is defined in {@link KJUR.asn1.ASN1Util.newObject}</li>
+ * </ul>
+ * NOTE: A parameter 'obj' have been supported
+ * for "OCTET STRING, encapsulates" structure.
+ * since asn1 1.0.11, jsrsasign 6.1.1 (2016-Sep-25).
+ * @see KJUR.asn1.DERAbstractString - superclass
+ * @example
+ * // default constructor
+ * o = new KJUR.asn1.DEROctetString();
+ * // initialize with string
+ * o = new KJUR.asn1.DEROctetString({str: "aaa"});
+ * // initialize with hexadecimal string
+ * o = new KJUR.asn1.DEROctetString({hex: "616161"});
+ * // initialize with ASN1Util.newObject argument
+ * o = new KJUR.asn1.DEROctetString({obj: {seq: [{int: 3}, {prnstr: 'aaa'}]}});
+ * // above generates a ASN.1 data like this:
+ * // OCTET STRING, encapsulates {
+ * //   SEQUENCE {
+ * //     INTEGER 3
+ * //     PrintableString 'aaa'
+ * //     }
+ * //   }
+ */
+KJUR.asn1.DEROctetString = function(params) {
+    if (params !== undefined && typeof params.obj !== "undefined") {
+        var o = KJUR.asn1.ASN1Util.newObject(params.obj);
+        params.hex = o.getEncodedHex();
+    }
+    KJUR.asn1.DEROctetString.superclass.constructor.call(this, params);
+    this.hT = "04";
+};
+YAHOO.lang.extend(KJUR.asn1.DEROctetString, KJUR.asn1.DERAbstractString);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER Null
+ * @name KJUR.asn1.DERNull
+ * @class class for ASN.1 DER Null
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * @see KJUR.asn1.ASN1Object - superclass
+ */
+KJUR.asn1.DERNull = function() {
+    KJUR.asn1.DERNull.superclass.constructor.call(this);
+    this.hT = "05";
+    this.hTLV = "0500";
+};
+YAHOO.lang.extend(KJUR.asn1.DERNull, KJUR.asn1.ASN1Object);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER ObjectIdentifier
+ * @name KJUR.asn1.DERObjectIdentifier
+ * @class class for ASN.1 DER ObjectIdentifier
+ * @param {Array} params associative array of parameters (ex. {'oid': '2.5.4.5'})
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>oid - specify initial ASN.1 value(V) by a oid string (ex. 2.5.4.13)</li>
+ * <li>hex - specify initial ASN.1 value(V) by a hexadecimal string</li>
+ * </ul>
+ * NOTE: 'params' can be omitted.
+ */
+KJUR.asn1.DERObjectIdentifier = function(params) {
+    var itox = function(i) {
+        var h = i.toString(16);
+        if (h.length == 1) h = '0' + h;
+        return h;
+    };
+    var roidtox = function(roid) {
+        var h = '';
+        var bi = new BigInteger(roid, 10);
+        var b = bi.toString(2);
+        var padLen = 7 - b.length % 7;
+        if (padLen == 7) padLen = 0;
+        var bPad = '';
+        for (var i = 0; i < padLen; i++) bPad += '0';
+        b = bPad + b;
+        for (var i = 0; i < b.length - 1; i += 7) {
+            var b8 = b.substr(i, 7);
+            if (i != b.length - 7) b8 = '1' + b8;
+            h += itox(parseInt(b8, 2));
+        }
+        return h;
+    };
+
+    KJUR.asn1.DERObjectIdentifier.superclass.constructor.call(this);
+    this.hT = "06";
+
+    /**
+     * set value by a hexadecimal string
+     * @name setValueHex
+     * @memberOf KJUR.asn1.DERObjectIdentifier#
+     * @function
+     * @param {String} newHexString hexadecimal value of OID bytes
+     */
+    this.setValueHex = function(newHexString) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.s = null;
+        this.hV = newHexString;
+    };
+
+    /**
+     * set value by a OID string<br/>
+     * @name setValueOidString
+     * @memberOf KJUR.asn1.DERObjectIdentifier#
+     * @function
+     * @param {String} oidString OID string (ex. 2.5.4.13)
+     * @example
+     * o = new KJUR.asn1.DERObjectIdentifier();
+     * o.setValueOidString("2.5.4.13");
+     */
+    this.setValueOidString = function(oidString) {
+        if (! oidString.match(/^[0-9.]+$/)) {
+            throw "malformed oid string: " + oidString;
+        }
+        var h = '';
+        var a = oidString.split('.');
+        var i0 = parseInt(a[0]) * 40 + parseInt(a[1]);
+        h += itox(i0);
+        a.splice(0, 2);
+        for (var i = 0; i < a.length; i++) {
+            h += roidtox(a[i]);
+        }
+        this.hTLV = null;
+        this.isModified = true;
+        this.s = null;
+        this.hV = h;
+    };
+
+    /**
+     * set value by a OID name
+     * @name setValueName
+     * @memberOf KJUR.asn1.DERObjectIdentifier#
+     * @function
+     * @param {String} oidName OID name (ex. 'serverAuth')
+     * @since 1.0.1
+     * @description
+     * OID name shall be defined in 'KJUR.asn1.x509.OID.name2oidList'.
+     * Otherwise raise error.
+     * @example
+     * o = new KJUR.asn1.DERObjectIdentifier();
+     * o.setValueName("serverAuth");
+     */
+    this.setValueName = function(oidName) {
+        var oid = KJUR.asn1.x509.OID.name2oid(oidName);
+        if (oid !== '') {
+            this.setValueOidString(oid);
+        } else {
+            throw "DERObjectIdentifier oidName undefined: " + oidName;
+        }
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+
+    if (params !== undefined) {
+        if (typeof params === "string") {
+            if (params.match(/^[0-2].[0-9.]+$/)) {
+                this.setValueOidString(params);
+            } else {
+                this.setValueName(params);
+            }
+        } else if (params.oid !== undefined) {
+            this.setValueOidString(params.oid);
+        } else if (params.hex !== undefined) {
+            this.setValueHex(params.hex);
+        } else if (params.name !== undefined) {
+            this.setValueName(params.name);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERObjectIdentifier, KJUR.asn1.ASN1Object);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER Enumerated
+ * @name KJUR.asn1.DEREnumerated
+ * @class class for ASN.1 DER Enumerated
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>int - specify initial ASN.1 value(V) by integer value</li>
+ * <li>hex - specify initial ASN.1 value(V) by a hexadecimal string</li>
+ * </ul>
+ * NOTE: 'params' can be omitted.
+ * @example
+ * new KJUR.asn1.DEREnumerated(123);
+ * new KJUR.asn1.DEREnumerated({int: 123});
+ * new KJUR.asn1.DEREnumerated({hex: '1fad'});
+ */
+KJUR.asn1.DEREnumerated = function(params) {
+    KJUR.asn1.DEREnumerated.superclass.constructor.call(this);
+    this.hT = "0a";
+
+    /**
+     * set value by Tom Wu's BigInteger object
+     * @name setByBigInteger
+     * @memberOf KJUR.asn1.DEREnumerated#
+     * @function
+     * @param {BigInteger} bigIntegerValue to set
+     */
+    this.setByBigInteger = function(bigIntegerValue) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.hV = KJUR.asn1.ASN1Util.bigIntToMinTwosComplementsHex(bigIntegerValue);
+    };
+
+    /**
+     * set value by integer value
+     * @name setByInteger
+     * @memberOf KJUR.asn1.DEREnumerated#
+     * @function
+     * @param {Integer} integer value to set
+     */
+    this.setByInteger = function(intValue) {
+        var bi = new BigInteger(String(intValue), 10);
+        this.setByBigInteger(bi);
+    };
+
+    /**
+     * set value by integer value
+     * @name setValueHex
+     * @memberOf KJUR.asn1.DEREnumerated#
+     * @function
+     * @param {String} hexadecimal string of integer value
+     * @description
+     * <br/>
+     * NOTE: Value shall be represented by minimum octet length of
+     * two's complement representation.
+     */
+    this.setValueHex = function(newHexString) {
+        this.hV = newHexString;
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+
+    if (typeof params != "undefined") {
+        if (typeof params['int'] != "undefined") {
+            this.setByInteger(params['int']);
+        } else if (typeof params == "number") {
+            this.setByInteger(params);
+        } else if (typeof params['hex'] != "undefined") {
+            this.setValueHex(params['hex']);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DEREnumerated, KJUR.asn1.ASN1Object);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER UTF8String
+ * @name KJUR.asn1.DERUTF8String
+ * @class class for ASN.1 DER UTF8String
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @extends KJUR.asn1.DERAbstractString
+ * @description
+ * @see KJUR.asn1.DERAbstractString - superclass
+ */
+KJUR.asn1.DERUTF8String = function(params) {
+    KJUR.asn1.DERUTF8String.superclass.constructor.call(this, params);
+    this.hT = "0c";
+};
+YAHOO.lang.extend(KJUR.asn1.DERUTF8String, KJUR.asn1.DERAbstractString);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER NumericString
+ * @name KJUR.asn1.DERNumericString
+ * @class class for ASN.1 DER NumericString
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @extends KJUR.asn1.DERAbstractString
+ * @description
+ * @see KJUR.asn1.DERAbstractString - superclass
+ */
+KJUR.asn1.DERNumericString = function(params) {
+    KJUR.asn1.DERNumericString.superclass.constructor.call(this, params);
+    this.hT = "12";
+};
+YAHOO.lang.extend(KJUR.asn1.DERNumericString, KJUR.asn1.DERAbstractString);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER PrintableString
+ * @name KJUR.asn1.DERPrintableString
+ * @class class for ASN.1 DER PrintableString
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @extends KJUR.asn1.DERAbstractString
+ * @description
+ * @see KJUR.asn1.DERAbstractString - superclass
+ */
+KJUR.asn1.DERPrintableString = function(params) {
+    KJUR.asn1.DERPrintableString.superclass.constructor.call(this, params);
+    this.hT = "13";
+};
+YAHOO.lang.extend(KJUR.asn1.DERPrintableString, KJUR.asn1.DERAbstractString);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER TeletexString
+ * @name KJUR.asn1.DERTeletexString
+ * @class class for ASN.1 DER TeletexString
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @extends KJUR.asn1.DERAbstractString
+ * @description
+ * @see KJUR.asn1.DERAbstractString - superclass
+ */
+KJUR.asn1.DERTeletexString = function(params) {
+    KJUR.asn1.DERTeletexString.superclass.constructor.call(this, params);
+    this.hT = "14";
+};
+YAHOO.lang.extend(KJUR.asn1.DERTeletexString, KJUR.asn1.DERAbstractString);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER IA5String
+ * @name KJUR.asn1.DERIA5String
+ * @class class for ASN.1 DER IA5String
+ * @param {Array} params associative array of parameters (ex. {'str': 'aaa'})
+ * @extends KJUR.asn1.DERAbstractString
+ * @description
+ * @see KJUR.asn1.DERAbstractString - superclass
+ */
+KJUR.asn1.DERIA5String = function(params) {
+    KJUR.asn1.DERIA5String.superclass.constructor.call(this, params);
+    this.hT = "16";
+};
+YAHOO.lang.extend(KJUR.asn1.DERIA5String, KJUR.asn1.DERAbstractString);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER UTCTime
+ * @name KJUR.asn1.DERUTCTime
+ * @class class for ASN.1 DER UTCTime
+ * @param {Array} params associative array of parameters (ex. {'str': '130430235959Z'})
+ * @extends KJUR.asn1.DERAbstractTime
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>str - specify initial ASN.1 value(V) by a string (ex.'130430235959Z')</li>
+ * <li>hex - specify initial ASN.1 value(V) by a hexadecimal string</li>
+ * <li>date - specify Date object.</li>
+ * </ul>
+ * NOTE: 'params' can be omitted.
+ * <h4>EXAMPLES</h4>
+ * @example
+ * d1 = new KJUR.asn1.DERUTCTime();
+ * d1.setString('130430125959Z');
+ *
+ * d2 = new KJUR.asn1.DERUTCTime({'str': '130430125959Z'});
+ * d3 = new KJUR.asn1.DERUTCTime({'date': new Date(Date.UTC(2015, 0, 31, 0, 0, 0, 0))});
+ * d4 = new KJUR.asn1.DERUTCTime('130430125959Z');
+ */
+KJUR.asn1.DERUTCTime = function(params) {
+    KJUR.asn1.DERUTCTime.superclass.constructor.call(this, params);
+    this.hT = "17";
+
+    /**
+     * set value by a Date object<br/>
+     * @name setByDate
+     * @memberOf KJUR.asn1.DERUTCTime#
+     * @function
+     * @param {Date} dateObject Date object to set ASN.1 value(V)
+     * @example
+     * o = new KJUR.asn1.DERUTCTime();
+     * o.setByDate(new Date("2016/12/31"));
+     */
+    this.setByDate = function(dateObject) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.date = dateObject;
+        this.s = this.formatDate(this.date, 'utc');
+        this.hV = stohex(this.s);
+    };
+
+    this.getFreshValueHex = function() {
+        if (typeof this.date == "undefined" && typeof this.s == "undefined") {
+            this.date = new Date();
+            this.s = this.formatDate(this.date, 'utc');
+            this.hV = stohex(this.s);
+        }
+        return this.hV;
+    };
+
+    if (params !== undefined) {
+        if (params.str !== undefined) {
+            this.setString(params.str);
+        } else if (typeof params == "string" && params.match(/^[0-9]{12}Z$/)) {
+            this.setString(params);
+        } else if (params.hex !== undefined) {
+            this.setStringHex(params.hex);
+        } else if (params.date !== undefined) {
+            this.setByDate(params.date);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERUTCTime, KJUR.asn1.DERAbstractTime);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER GeneralizedTime
+ * @name KJUR.asn1.DERGeneralizedTime
+ * @class class for ASN.1 DER GeneralizedTime
+ * @param {Array} params associative array of parameters (ex. {'str': '20130430235959Z'})
+ * @property {Boolean} withMillis flag to show milliseconds or not
+ * @extends KJUR.asn1.DERAbstractTime
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>str - specify initial ASN.1 value(V) by a string (ex.'20130430235959Z')</li>
+ * <li>hex - specify initial ASN.1 value(V) by a hexadecimal string</li>
+ * <li>date - specify Date object.</li>
+ * <li>millis - specify flag to show milliseconds (from 1.0.6)</li>
+ * </ul>
+ * NOTE1: 'params' can be omitted.
+ * NOTE2: 'withMillis' property is supported from asn1 1.0.6.
+ */
+KJUR.asn1.DERGeneralizedTime = function(params) {
+    KJUR.asn1.DERGeneralizedTime.superclass.constructor.call(this, params);
+    this.hT = "18";
+    this.withMillis = false;
+
+    /**
+     * set value by a Date object
+     * @name setByDate
+     * @memberOf KJUR.asn1.DERGeneralizedTime#
+     * @function
+     * @param {Date} dateObject Date object to set ASN.1 value(V)
+     * @example
+     * When you specify UTC time, use 'Date.UTC' method like this:<br/>
+     * o1 = new DERUTCTime();
+     * o1.setByDate(date);
+     *
+     * date = new Date(Date.UTC(2015, 0, 31, 23, 59, 59, 0)); #2015JAN31 23:59:59
+     */
+    this.setByDate = function(dateObject) {
+        this.hTLV = null;
+        this.isModified = true;
+        this.date = dateObject;
+        this.s = this.formatDate(this.date, 'gen', this.withMillis);
+        this.hV = stohex(this.s);
+    };
+
+    this.getFreshValueHex = function() {
+        if (this.date === undefined && this.s === undefined) {
+            this.date = new Date();
+            this.s = this.formatDate(this.date, 'gen', this.withMillis);
+            this.hV = stohex(this.s);
+        }
+        return this.hV;
+    };
+
+    if (params !== undefined) {
+        if (params.str !== undefined) {
+            this.setString(params.str);
+        } else if (typeof params == "string" && params.match(/^[0-9]{14}Z$/)) {
+            this.setString(params);
+        } else if (params.hex !== undefined) {
+            this.setStringHex(params.hex);
+        } else if (params.date !== undefined) {
+            this.setByDate(params.date);
+        }
+        if (params.millis === true) {
+            this.withMillis = true;
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERGeneralizedTime, KJUR.asn1.DERAbstractTime);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER Sequence
+ * @name KJUR.asn1.DERSequence
+ * @class class for ASN.1 DER Sequence
+ * @extends KJUR.asn1.DERAbstractStructured
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>array - specify array of ASN1Object to set elements of content</li>
+ * </ul>
+ * NOTE: 'params' can be omitted.
+ */
+KJUR.asn1.DERSequence = function(params) {
+    KJUR.asn1.DERSequence.superclass.constructor.call(this, params);
+    this.hT = "30";
+    this.getFreshValueHex = function() {
+        var h = '';
+        for (var i = 0; i < this.asn1Array.length; i++) {
+            var asn1Obj = this.asn1Array[i];
+            h += asn1Obj.getEncodedHex();
+        }
+        this.hV = h;
+        return this.hV;
+    };
+};
+YAHOO.lang.extend(KJUR.asn1.DERSequence, KJUR.asn1.DERAbstractStructured);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER Set
+ * @name KJUR.asn1.DERSet
+ * @class class for ASN.1 DER Set
+ * @extends KJUR.asn1.DERAbstractStructured
+ * @description
+ * <br/>
+ * As for argument 'params' for constructor, you can specify one of
+ * following properties:
+ * <ul>
+ * <li>array - specify array of ASN1Object to set elements of content</li>
+ * <li>sortflag - flag for sort (default: true). ASN.1 BER is not sorted in 'SET OF'.</li>
+ * </ul>
+ * NOTE1: 'params' can be omitted.<br/>
+ * NOTE2: sortflag is supported since 1.0.5.
+ */
+KJUR.asn1.DERSet = function(params) {
+    KJUR.asn1.DERSet.superclass.constructor.call(this, params);
+    this.hT = "31";
+    this.sortFlag = true; // item shall be sorted only in ASN.1 DER
+    this.getFreshValueHex = function() {
+        var a = new Array();
+        for (var i = 0; i < this.asn1Array.length; i++) {
+            var asn1Obj = this.asn1Array[i];
+            a.push(asn1Obj.getEncodedHex());
+        }
+        if (this.sortFlag == true) a.sort();
+        this.hV = a.join('');
+        return this.hV;
+    };
+
+    if (typeof params != "undefined") {
+        if (typeof params.sortflag != "undefined" &&
+            params.sortflag == false)
+            this.sortFlag = false;
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERSet, KJUR.asn1.DERAbstractStructured);
+
+// ********************************************************************
+/**
+ * class for ASN.1 DER TaggedObject
+ * @name KJUR.asn1.DERTaggedObject
+ * @class class for ASN.1 DER TaggedObject
+ * @extends KJUR.asn1.ASN1Object
+ * @description
+ * <br/>
+ * Parameter 'tagNoNex' is ASN.1 tag(T) value for this object.
+ * For example, if you find '[1]' tag in a ASN.1 dump,
+ * 'tagNoHex' will be 'a1'.
+ * <br/>
+ * As for optional argument 'params' for constructor, you can specify *ANY* of
+ * following properties:
+ * <ul>
+ * <li>explicit - specify true if this is explicit tag otherwise false
+ *     (default is 'true').</li>
+ * <li>tag - specify tag (default is 'a0' which means [0])</li>
+ * <li>obj - specify ASN1Object which is tagged</li>
+ * </ul>
+ * @example
+ * d1 = new KJUR.asn1.DERUTF8String({'str':'a'});
+ * d2 = new KJUR.asn1.DERTaggedObject({'obj': d1});
+ * hex = d2.getEncodedHex();
+ */
+KJUR.asn1.DERTaggedObject = function(params) {
+    KJUR.asn1.DERTaggedObject.superclass.constructor.call(this);
+    this.hT = "a0";
+    this.hV = '';
+    this.isExplicit = true;
+    this.asn1Object = null;
+
+    /**
+     * set value by an ASN1Object
+     * @name setString
+     * @memberOf KJUR.asn1.DERTaggedObject#
+     * @function
+     * @param {Boolean} isExplicitFlag flag for explicit/implicit tag
+     * @param {Integer} tagNoHex hexadecimal string of ASN.1 tag
+     * @param {ASN1Object} asn1Object ASN.1 to encapsulate
+     */
+    this.setASN1Object = function(isExplicitFlag, tagNoHex, asn1Object) {
+        this.hT = tagNoHex;
+        this.isExplicit = isExplicitFlag;
+        this.asn1Object = asn1Object;
+        if (this.isExplicit) {
+            this.hV = this.asn1Object.getEncodedHex();
+            this.hTLV = null;
+            this.isModified = true;
+        } else {
+            this.hV = null;
+            this.hTLV = asn1Object.getEncodedHex();
+            this.hTLV = this.hTLV.replace(/^../, tagNoHex);
+            this.isModified = false;
+        }
+    };
+
+    this.getFreshValueHex = function() {
+        return this.hV;
+    };
+
+    if (typeof params != "undefined") {
+        if (typeof params['tag'] != "undefined") {
+            this.hT = params['tag'];
+        }
+        if (typeof params['explicit'] != "undefined") {
+            this.isExplicit = params['explicit'];
+        }
+        if (typeof params['obj'] != "undefined") {
+            this.asn1Object = params['obj'];
+            this.setASN1Object(this.isExplicit, this.hT, this.asn1Object);
+        }
+    }
+};
+YAHOO.lang.extend(KJUR.asn1.DERTaggedObject, KJUR.asn1.ASN1Object);
+
+/**
+ * Create a new JSEncryptRSAKey that extends Tom Wu's RSA key object.
+ * This object is just a decorator for parsing the key parameter
+ * @param {string|Object} key - The key in string format, or an object containing
+ * the parameters needed to build a RSAKey object.
+ * @constructor
+ */
+var JSEncryptRSAKey = /** @class */ (function (_super) {
+    __extends(JSEncryptRSAKey, _super);
+    function JSEncryptRSAKey(key) {
+        var _this = _super.call(this) || this;
+        // Call the super constructor.
+        //  RSAKey.call(this);
+        // If a key key was provided.
+        if (key) {
+            // If this is a string...
+            if (typeof key === "string") {
+                _this.parseKey(key);
+            }
+            else if (JSEncryptRSAKey.hasPrivateKeyProperty(key) ||
+                JSEncryptRSAKey.hasPublicKeyProperty(key)) {
+                // Set the values for the key.
+                _this.parsePropertiesFrom(key);
+            }
+        }
+        return _this;
+    }
+    /**
+     * Method to parse a pem encoded string containing both a public or private key.
+     * The method will translate the pem encoded string in a der encoded string and
+     * will parse private key and public key parameters. This method accepts public key
+     * in the rsaencryption pkcs #1 format (oid: 1.2.840.113549.1.1.1).
+     *
+     * @todo Check how many rsa formats use the same format of pkcs #1.
+     *
+     * The format is defined as:
+     * PublicKeyInfo ::= SEQUENCE {
+     *   algorithm       AlgorithmIdentifier,
+     *   PublicKey       BIT STRING
+     * }
+     * Where AlgorithmIdentifier is:
+     * AlgorithmIdentifier ::= SEQUENCE {
+     *   algorithm       OBJECT IDENTIFIER,     the OID of the enc algorithm
+     *   parameters      ANY DEFINED BY algorithm OPTIONAL (NULL for PKCS #1)
+     * }
+     * and PublicKey is a SEQUENCE encapsulated in a BIT STRING
+     * RSAPublicKey ::= SEQUENCE {
+     *   modulus           INTEGER,  -- n
+     *   publicExponent    INTEGER   -- e
+     * }
+     * it's possible to examine the structure of the keys obtained from openssl using
+     * an asn.1 dumper as the one used here to parse the components: http://lapo.it/asn1js/
+     * @argument {string} pem the pem encoded string, can include the BEGIN/END header/footer
+     * @private
+     */
+    JSEncryptRSAKey.prototype.parseKey = function (pem) {
+        try {
+            var modulus = 0;
+            var public_exponent = 0;
+            var reHex = /^\s*(?:[0-9A-Fa-f][0-9A-Fa-f]\s*)+$/;
+            var der = reHex.test(pem) ? Hex.decode(pem) : Base64.unarmor(pem);
+            var asn1 = ASN1.decode(der);
+            // Fixes a bug with OpenSSL 1.0+ private keys
+            if (asn1.sub.length === 3) {
+                asn1 = asn1.sub[2].sub[0];
+            }
+            if (asn1.sub.length === 9) {
+                // Parse the private key.
+                modulus = asn1.sub[1].getHexStringValue(); // bigint
+                this.n = parseBigInt(modulus, 16);
+                public_exponent = asn1.sub[2].getHexStringValue(); // int
+                this.e = parseInt(public_exponent, 16);
+                var private_exponent = asn1.sub[3].getHexStringValue(); // bigint
+                this.d = parseBigInt(private_exponent, 16);
+                var prime1 = asn1.sub[4].getHexStringValue(); // bigint
+                this.p = parseBigInt(prime1, 16);
+                var prime2 = asn1.sub[5].getHexStringValue(); // bigint
+                this.q = parseBigInt(prime2, 16);
+                var exponent1 = asn1.sub[6].getHexStringValue(); // bigint
+                this.dmp1 = parseBigInt(exponent1, 16);
+                var exponent2 = asn1.sub[7].getHexStringValue(); // bigint
+                this.dmq1 = parseBigInt(exponent2, 16);
+                var coefficient = asn1.sub[8].getHexStringValue(); // bigint
+                this.coeff = parseBigInt(coefficient, 16);
+            }
+            else if (asn1.sub.length === 2) {
+                // Parse the public key.
+                var bit_string = asn1.sub[1];
+                var sequence = bit_string.sub[0];
+                modulus = sequence.sub[0].getHexStringValue();
+                this.n = parseBigInt(modulus, 16);
+                public_exponent = sequence.sub[1].getHexStringValue();
+                this.e = parseInt(public_exponent, 16);
+            }
+            else {
+                return false;
+            }
+            return true;
+        }
+        catch (ex) {
+            return false;
+        }
+    };
+    /**
+     * Translate rsa parameters in a hex encoded string representing the rsa key.
+     *
+     * The translation follow the ASN.1 notation :
+     * RSAPrivateKey ::= SEQUENCE {
+     *   version           Version,
+     *   modulus           INTEGER,  -- n
+     *   publicExponent    INTEGER,  -- e
+     *   privateExponent   INTEGER,  -- d
+     *   prime1            INTEGER,  -- p
+     *   prime2            INTEGER,  -- q
+     *   exponent1         INTEGER,  -- d mod (p1)
+     *   exponent2         INTEGER,  -- d mod (q-1)
+     *   coefficient       INTEGER,  -- (inverse of q) mod p
+     * }
+     * @returns {string}  DER Encoded String representing the rsa private key
+     * @private
+     */
+    JSEncryptRSAKey.prototype.getPrivateBaseKey = function () {
+        var options = {
+            array: [
+                new KJUR.asn1.DERInteger({ int: 0 }),
+                new KJUR.asn1.DERInteger({ bigint: this.n }),
+                new KJUR.asn1.DERInteger({ int: this.e }),
+                new KJUR.asn1.DERInteger({ bigint: this.d }),
+                new KJUR.asn1.DERInteger({ bigint: this.p }),
+                new KJUR.asn1.DERInteger({ bigint: this.q }),
+                new KJUR.asn1.DERInteger({ bigint: this.dmp1 }),
+                new KJUR.asn1.DERInteger({ bigint: this.dmq1 }),
+                new KJUR.asn1.DERInteger({ bigint: this.coeff })
+            ]
+        };
+        var seq = new KJUR.asn1.DERSequence(options);
+        return seq.getEncodedHex();
+    };
+    /**
+     * base64 (pem) encoded version of the DER encoded representation
+     * @returns {string} pem encoded representation without header and footer
+     * @public
+     */
+    JSEncryptRSAKey.prototype.getPrivateBaseKeyB64 = function () {
+        return hex2b64(this.getPrivateBaseKey());
+    };
+    /**
+     * Translate rsa parameters in a hex encoded string representing the rsa public key.
+     * The representation follow the ASN.1 notation :
+     * PublicKeyInfo ::= SEQUENCE {
+     *   algorithm       AlgorithmIdentifier,
+     *   PublicKey       BIT STRING
+     * }
+     * Where AlgorithmIdentifier is:
+     * AlgorithmIdentifier ::= SEQUENCE {
+     *   algorithm       OBJECT IDENTIFIER,     the OID of the enc algorithm
+     *   parameters      ANY DEFINED BY algorithm OPTIONAL (NULL for PKCS #1)
+     * }
+     * and PublicKey is a SEQUENCE encapsulated in a BIT STRING
+     * RSAPublicKey ::= SEQUENCE {
+     *   modulus           INTEGER,  -- n
+     *   publicExponent    INTEGER   -- e
+     * }
+     * @returns {string} DER Encoded String representing the rsa public key
+     * @private
+     */
+    JSEncryptRSAKey.prototype.getPublicBaseKey = function () {
+        var first_sequence = new KJUR.asn1.DERSequence({
+            array: [
+                new KJUR.asn1.DERObjectIdentifier({ oid: "1.2.840.113549.1.1.1" }),
+                new KJUR.asn1.DERNull()
+            ]
+        });
+        var second_sequence = new KJUR.asn1.DERSequence({
+            array: [
+                new KJUR.asn1.DERInteger({ bigint: this.n }),
+                new KJUR.asn1.DERInteger({ int: this.e })
+            ]
+        });
+        var bit_string = new KJUR.asn1.DERBitString({
+            hex: "00" + second_sequence.getEncodedHex()
+        });
+        var seq = new KJUR.asn1.DERSequence({
+            array: [
+                first_sequence,
+                bit_string
+            ]
+        });
+        return seq.getEncodedHex();
+    };
+    /**
+     * base64 (pem) encoded version of the DER encoded representation
+     * @returns {string} pem encoded representation without header and footer
+     * @public
+     */
+    JSEncryptRSAKey.prototype.getPublicBaseKeyB64 = function () {
+        return hex2b64(this.getPublicBaseKey());
+    };
+    /**
+     * wrap the string in block of width chars. The default value for rsa keys is 64
+     * characters.
+     * @param {string} str the pem encoded string without header and footer
+     * @param {Number} [width=64] - the length the string has to be wrapped at
+     * @returns {string}
+     * @private
+     */
+    JSEncryptRSAKey.wordwrap = function (str, width) {
+        width = width || 64;
+        if (!str) {
+            return str;
+        }
+        var regex = "(.{1," + width + "})( +|$\n?)|(.{1," + width + "})";
+        return str.match(RegExp(regex, "g")).join("\n");
+    };
+    /**
+     * Retrieve the pem encoded private key
+     * @returns {string} the pem encoded private key with header/footer
+     * @public
+     */
+    JSEncryptRSAKey.prototype.getPrivateKey = function () {
+        var key = "-----BEGIN RSA PRIVATE KEY-----\n";
+        key += JSEncryptRSAKey.wordwrap(this.getPrivateBaseKeyB64()) + "\n";
+        key += "-----END RSA PRIVATE KEY-----";
+        return key;
+    };
+    /**
+     * Retrieve the pem encoded public key
+     * @returns {string} the pem encoded public key with header/footer
+     * @public
+     */
+    JSEncryptRSAKey.prototype.getPublicKey = function () {
+        var key = "-----BEGIN PUBLIC KEY-----\n";
+        key += JSEncryptRSAKey.wordwrap(this.getPublicBaseKeyB64()) + "\n";
+        key += "-----END PUBLIC KEY-----";
+        return key;
+    };
+    /**
+     * Check if the object contains the necessary parameters to populate the rsa modulus
+     * and public exponent parameters.
+     * @param {Object} [obj={}] - An object that may contain the two public key
+     * parameters
+     * @returns {boolean} true if the object contains both the modulus and the public exponent
+     * properties (n and e)
+     * @todo check for types of n and e. N should be a parseable bigInt object, E should
+     * be a parseable integer number
+     * @private
+     */
+    JSEncryptRSAKey.hasPublicKeyProperty = function (obj) {
+        obj = obj || {};
+        return (obj.hasOwnProperty("n") &&
+            obj.hasOwnProperty("e"));
+    };
+    /**
+     * Check if the object contains ALL the parameters of an RSA key.
+     * @param {Object} [obj={}] - An object that may contain nine rsa key
+     * parameters
+     * @returns {boolean} true if the object contains all the parameters needed
+     * @todo check for types of the parameters all the parameters but the public exponent
+     * should be parseable bigint objects, the public exponent should be a parseable integer number
+     * @private
+     */
+    JSEncryptRSAKey.hasPrivateKeyProperty = function (obj) {
+        obj = obj || {};
+        return (obj.hasOwnProperty("n") &&
+            obj.hasOwnProperty("e") &&
+            obj.hasOwnProperty("d") &&
+            obj.hasOwnProperty("p") &&
+            obj.hasOwnProperty("q") &&
+            obj.hasOwnProperty("dmp1") &&
+            obj.hasOwnProperty("dmq1") &&
+            obj.hasOwnProperty("coeff"));
+    };
+    /**
+     * Parse the properties of obj in the current rsa object. Obj should AT LEAST
+     * include the modulus and public exponent (n, e) parameters.
+     * @param {Object} obj - the object containing rsa parameters
+     * @private
+     */
+    JSEncryptRSAKey.prototype.parsePropertiesFrom = function (obj) {
+        this.n = obj.n;
+        this.e = obj.e;
+        if (obj.hasOwnProperty("d")) {
+            this.d = obj.d;
+            this.p = obj.p;
+            this.q = obj.q;
+            this.dmp1 = obj.dmp1;
+            this.dmq1 = obj.dmq1;
+            this.coeff = obj.coeff;
+        }
+    };
+    return JSEncryptRSAKey;
+}(RSAKey));
+
+/**
+ *
+ * @param {Object} [options = {}] - An object to customize JSEncrypt behaviour
+ * possible parameters are:
+ * - default_key_size        {number}  default: 1024 the key size in bit
+ * - default_public_exponent {string}  default: '010001' the hexadecimal representation of the public exponent
+ * - log                     {boolean} default: false whether log warn/error or not
+ * @constructor
+ */
+var JSEncrypt = /** @class */ (function () {
+    function JSEncrypt(options) {
+        options = options || {};
+        this.default_key_size = parseInt(options.default_key_size, 10) || 1024;
+        this.default_public_exponent = options.default_public_exponent || "010001"; // 65537 default openssl public exponent for rsa key type
+        this.log = options.log || false;
+        // The private and public key.
+        this.key = null;
+    }
+    /**
+     * Method to set the rsa key parameter (one method is enough to set both the public
+     * and the private key, since the private key contains the public key paramenters)
+     * Log a warning if logs are enabled
+     * @param {Object|string} key the pem encoded string or an object (with or without header/footer)
+     * @public
+     */
+    JSEncrypt.prototype.setKey = function (key) {
+        if (this.log && this.key) {
+            console.warn("A key was already set, overriding existing.");
+        }
+        this.key = new JSEncryptRSAKey(key);
+    };
+    /**
+     * Proxy method for setKey, for api compatibility
+     * @see setKey
+     * @public
+     */
+    JSEncrypt.prototype.setPrivateKey = function (privkey) {
+        // Create the key.
+        this.setKey(privkey);
+    };
+    /**
+     * Proxy method for setKey, for api compatibility
+     * @see setKey
+     * @public
+     */
+    JSEncrypt.prototype.setPublicKey = function (pubkey) {
+        // Sets the public key.
+        this.setKey(pubkey);
+    };
+    /**
+     * Proxy method for RSAKey object's decrypt, decrypt the string using the private
+     * components of the rsa key object. Note that if the object was not set will be created
+     * on the fly (by the getKey method) using the parameters passed in the JSEncrypt constructor
+     * @param {string} str base64 encoded crypted string to decrypt
+     * @return {string} the decrypted string
+     * @public
+     */
+    JSEncrypt.prototype.decrypt = function (str) {
+        // Return the decrypted string.
+        try {
+            return this.getKey().decrypt(b64tohex(str));
+        }
+        catch (ex) {
+            return false;
+        }
+    };
+    /**
+     * Proxy method for RSAKey object's encrypt, encrypt the string using the public
+     * components of the rsa key object. Note that if the object was not set will be created
+     * on the fly (by the getKey method) using the parameters passed in the JSEncrypt constructor
+     * @param {string} str the string to encrypt
+     * @return {string} the encrypted string encoded in base64
+     * @public
+     */
+    JSEncrypt.prototype.encrypt = function (str) {
+        // Return the encrypted string.
+        try {
+            return hex2b64(this.getKey().encrypt(str));
+        }
+        catch (ex) {
+            return false;
+        }
+    };
+    /**
+     * Proxy method for RSAKey object's sign.
+     * @param {string} str the string to sign
+     * @param {function} digestMethod hash method
+     * @param {string} digestName the name of the hash algorithm
+     * @return {string} the signature encoded in base64
+     * @public
+     */
+    JSEncrypt.prototype.sign = function (str, digestMethod, digestName) {
+        // return the RSA signature of 'str' in 'hex' format.
+        try {
+            return hex2b64(this.getKey().sign(str, digestMethod, digestName));
+        }
+        catch (ex) {
+            return false;
+        }
+    };
+    /**
+     * Proxy method for RSAKey object's verify.
+     * @param {string} str the string to verify
+     * @param {string} signature the signature encoded in base64 to compare the string to
+     * @param {function} digestMethod hash method
+     * @return {boolean} whether the data and signature match
+     * @public
+     */
+    JSEncrypt.prototype.verify = function (str, signature, digestMethod) {
+        // Return the decrypted 'digest' of the signature.
+        try {
+            return this.getKey().verify(str, b64tohex(signature), digestMethod);
+        }
+        catch (ex) {
+            return false;
+        }
+    };
+    /**
+     * Getter for the current JSEncryptRSAKey object. If it doesn't exists a new object
+     * will be created and returned
+     * @param {callback} [cb] the callback to be called if we want the key to be generated
+     * in an async fashion
+     * @returns {JSEncryptRSAKey} the JSEncryptRSAKey object
+     * @public
+     */
+    JSEncrypt.prototype.getKey = function (cb) {
+        // Only create new if it does not exist.
+        if (!this.key) {
+            // Get a new private key.
+            this.key = new JSEncryptRSAKey();
+            if (cb && {}.toString.call(cb) === "[object Function]") {
+                this.key.generateAsync(this.default_key_size, this.default_public_exponent, cb);
+                return;
+            }
+            // Generate the key.
+            this.key.generate(this.default_key_size, this.default_public_exponent);
+        }
+        return this.key;
+    };
+    /**
+     * Returns the pem encoded representation of the private key
+     * If the key doesn't exists a new key will be created
+     * @returns {string} pem encoded representation of the private key WITH header and footer
+     * @public
+     */
+    JSEncrypt.prototype.getPrivateKey = function () {
+        // Return the private representation of this key.
+        return this.getKey().getPrivateKey();
+    };
+    /**
+     * Returns the pem encoded representation of the private key
+     * If the key doesn't exists a new key will be created
+     * @returns {string} pem encoded representation of the private key WITHOUT header and footer
+     * @public
+     */
+    JSEncrypt.prototype.getPrivateKeyB64 = function () {
+        // Return the private representation of this key.
+        return this.getKey().getPrivateBaseKeyB64();
+    };
+    /**
+     * Returns the pem encoded representation of the public key
+     * If the key doesn't exists a new key will be created
+     * @returns {string} pem encoded representation of the public key WITH header and footer
+     * @public
+     */
+    JSEncrypt.prototype.getPublicKey = function () {
+        // Return the private representation of this key.
+        return this.getKey().getPublicKey();
+    };
+    /**
+     * Returns the pem encoded representation of the public key
+     * If the key doesn't exists a new key will be created
+     * @returns {string} pem encoded representation of the public key WITHOUT header and footer
+     * @public
+     */
+    JSEncrypt.prototype.getPublicKeyB64 = function () {
+        // Return the private representation of this key.
+        return this.getKey().getPublicBaseKeyB64();
+    };
+    JSEncrypt.version = "3.0.0-rc.1";
+    return JSEncrypt;
+}());
+
+window2.JSEncrypt = JSEncrypt;
+
+exports.JSEncrypt = JSEncrypt;
+exports.default = JSEncrypt;
+
+Object.defineProperty(exports, '__esModule', { value: true });
+
+})));

+ 257 - 0
src/main/ets/util/md5.js

@@ -0,0 +1,257 @@
+/*
+ * A JavaScript implementation of the RSA Data Security, Inc. MD5 Message
+ * Digest Algorithm, as defined in RFC 1321.
+ * Version 2.1 Copyright (C) Paul Johnston 1999 - 2002.
+ * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet
+ * Distributed under the BSD License
+ * See http://pajhome.org.uk/crypt/md5 for more info.
+ */
+
+/*
+ * Configurable variables. You may need to tweak these to be compatible with
+ * the server-side, but the defaults work in most cases.
+ */
+var hexcase = 0;  /* hex output format. 0 - lowercase; 1 - uppercase        */
+var b64pad  = ""; /* base-64 pad character. "=" for strict RFC compliance   */
+var chrsz   = 8;  /* bits per input character. 8 - ASCII; 16 - Unicode      */
+
+/*
+ * These are the functions you'll usually want to call
+ * They take string arguments and return either hex or base-64 encoded strings
+ */
+//32位小写
+export function md5_hex(s){ return binl2hex(core_md5(str2binl(s), s.length * chrsz));}
+export function md5_b64(s){ return binl2b64(core_md5(str2binl(s), s.length * chrsz));}
+export function md5_str(s){ return binl2str(core_md5(str2binl(s), s.length * chrsz));}
+export function md5_hex_hmac(key, data) { return binl2hex(core_hmac_md5(key, data)); }
+export function md5_b64_hmac(key, data) { return binl2b64(core_hmac_md5(key, data)); }
+export function md5_str_hmac(key, data) { return binl2str(core_hmac_md5(key, data)); }
+
+/*
+ * Perform a simple self-test to see if the VM is working
+ */
+function md5_vm_test()
+{
+  return md5_hex("abc") == "900150983cd24fb0d6963f7d28e17f72";
+}
+
+/*
+ * Calculate the MD5 of an array of little-endian words, and a bit length
+ */
+function core_md5(x, len)
+{
+  /* append padding */
+  x[len >> 5] |= 0x80 << ((len) % 32);
+  x[(((len + 64) >>> 9) << 4) + 14] = len;
+
+  var a =  1732584193;
+  var b = -271733879;
+  var c = -1732584194;
+  var d =  271733878;
+
+  for(var i = 0; i < x.length; i += 16)
+  {
+    var olda = a;
+    var oldb = b;
+    var oldc = c;
+    var oldd = d;
+
+    a = md5_ff(a, b, c, d, x[i+ 0], 7 , -680876936);
+    d = md5_ff(d, a, b, c, x[i+ 1], 12, -389564586);
+    c = md5_ff(c, d, a, b, x[i+ 2], 17,  606105819);
+    b = md5_ff(b, c, d, a, x[i+ 3], 22, -1044525330);
+    a = md5_ff(a, b, c, d, x[i+ 4], 7 , -176418897);
+    d = md5_ff(d, a, b, c, x[i+ 5], 12,  1200080426);
+    c = md5_ff(c, d, a, b, x[i+ 6], 17, -1473231341);
+    b = md5_ff(b, c, d, a, x[i+ 7], 22, -45705983);
+    a = md5_ff(a, b, c, d, x[i+ 8], 7 ,  1770035416);
+    d = md5_ff(d, a, b, c, x[i+ 9], 12, -1958414417);
+    c = md5_ff(c, d, a, b, x[i+10], 17, -42063);
+    b = md5_ff(b, c, d, a, x[i+11], 22, -1990404162);
+    a = md5_ff(a, b, c, d, x[i+12], 7 ,  1804603682);
+    d = md5_ff(d, a, b, c, x[i+13], 12, -40341101);
+    c = md5_ff(c, d, a, b, x[i+14], 17, -1502002290);
+    b = md5_ff(b, c, d, a, x[i+15], 22,  1236535329);
+
+    a = md5_gg(a, b, c, d, x[i+ 1], 5 , -165796510);
+    d = md5_gg(d, a, b, c, x[i+ 6], 9 , -1069501632);
+    c = md5_gg(c, d, a, b, x[i+11], 14,  643717713);
+    b = md5_gg(b, c, d, a, x[i+ 0], 20, -373897302);
+    a = md5_gg(a, b, c, d, x[i+ 5], 5 , -701558691);
+    d = md5_gg(d, a, b, c, x[i+10], 9 ,  38016083);
+    c = md5_gg(c, d, a, b, x[i+15], 14, -660478335);
+    b = md5_gg(b, c, d, a, x[i+ 4], 20, -405537848);
+    a = md5_gg(a, b, c, d, x[i+ 9], 5 ,  568446438);
+    d = md5_gg(d, a, b, c, x[i+14], 9 , -1019803690);
+    c = md5_gg(c, d, a, b, x[i+ 3], 14, -187363961);
+    b = md5_gg(b, c, d, a, x[i+ 8], 20,  1163531501);
+    a = md5_gg(a, b, c, d, x[i+13], 5 , -1444681467);
+    d = md5_gg(d, a, b, c, x[i+ 2], 9 , -51403784);
+    c = md5_gg(c, d, a, b, x[i+ 7], 14,  1735328473);
+    b = md5_gg(b, c, d, a, x[i+12], 20, -1926607734);
+
+    a = md5_hh(a, b, c, d, x[i+ 5], 4 , -378558);
+    d = md5_hh(d, a, b, c, x[i+ 8], 11, -2022574463);
+    c = md5_hh(c, d, a, b, x[i+11], 16,  1839030562);
+    b = md5_hh(b, c, d, a, x[i+14], 23, -35309556);
+    a = md5_hh(a, b, c, d, x[i+ 1], 4 , -1530992060);
+    d = md5_hh(d, a, b, c, x[i+ 4], 11,  1272893353);
+    c = md5_hh(c, d, a, b, x[i+ 7], 16, -155497632);
+    b = md5_hh(b, c, d, a, x[i+10], 23, -1094730640);
+    a = md5_hh(a, b, c, d, x[i+13], 4 ,  681279174);
+    d = md5_hh(d, a, b, c, x[i+ 0], 11, -358537222);
+    c = md5_hh(c, d, a, b, x[i+ 3], 16, -722521979);
+    b = md5_hh(b, c, d, a, x[i+ 6], 23,  76029189);
+    a = md5_hh(a, b, c, d, x[i+ 9], 4 , -640364487);
+    d = md5_hh(d, a, b, c, x[i+12], 11, -421815835);
+    c = md5_hh(c, d, a, b, x[i+15], 16,  530742520);
+    b = md5_hh(b, c, d, a, x[i+ 2], 23, -995338651);
+
+    a = md5_ii(a, b, c, d, x[i+ 0], 6 , -198630844);
+    d = md5_ii(d, a, b, c, x[i+ 7], 10,  1126891415);
+    c = md5_ii(c, d, a, b, x[i+14], 15, -1416354905);
+    b = md5_ii(b, c, d, a, x[i+ 5], 21, -57434055);
+    a = md5_ii(a, b, c, d, x[i+12], 6 ,  1700485571);
+    d = md5_ii(d, a, b, c, x[i+ 3], 10, -1894986606);
+    c = md5_ii(c, d, a, b, x[i+10], 15, -1051523);
+    b = md5_ii(b, c, d, a, x[i+ 1], 21, -2054922799);
+    a = md5_ii(a, b, c, d, x[i+ 8], 6 ,  1873313359);
+    d = md5_ii(d, a, b, c, x[i+15], 10, -30611744);
+    c = md5_ii(c, d, a, b, x[i+ 6], 15, -1560198380);
+    b = md5_ii(b, c, d, a, x[i+13], 21,  1309151649);
+    a = md5_ii(a, b, c, d, x[i+ 4], 6 , -145523070);
+    d = md5_ii(d, a, b, c, x[i+11], 10, -1120210379);
+    c = md5_ii(c, d, a, b, x[i+ 2], 15,  718787259);
+    b = md5_ii(b, c, d, a, x[i+ 9], 21, -343485551);
+
+    a = safe_add(a, olda);
+    b = safe_add(b, oldb);
+    c = safe_add(c, oldc);
+    d = safe_add(d, oldd);
+  }
+  return Array(a, b, c, d);
+
+}
+
+/*
+ * These functions implement the four basic operations the algorithm uses.
+ */
+function md5_cmn(q, a, b, x, s, t)
+{
+  return safe_add(bit_rol(safe_add(safe_add(a, q), safe_add(x, t)), s),b);
+}
+function md5_ff(a, b, c, d, x, s, t)
+{
+  return md5_cmn((b & c) | ((~b) & d), a, b, x, s, t);
+}
+function md5_gg(a, b, c, d, x, s, t)
+{
+  return md5_cmn((b & d) | (c & (~d)), a, b, x, s, t);
+}
+function md5_hh(a, b, c, d, x, s, t)
+{
+  return md5_cmn(b ^ c ^ d, a, b, x, s, t);
+}
+function md5_ii(a, b, c, d, x, s, t)
+{
+  return md5_cmn(c ^ (b | (~d)), a, b, x, s, t);
+}
+
+/*
+ * Calculate the HMAC-MD5, of a key and some data
+ */
+function core_hmac_md5(key, data)
+{
+  var bkey = str2binl(key);
+  if(bkey.length > 16) bkey = core_md5(bkey, key.length * chrsz);
+
+  var ipad = Array(16), opad = Array(16);
+  for(var i = 0; i < 16; i++)
+  {
+    ipad[i] = bkey[i] ^ 0x36363636;
+    opad[i] = bkey[i] ^ 0x5C5C5C5C;
+  }
+
+  var hash = core_md5(ipad.concat(str2binl(data)), 512 + data.length * chrsz);
+  return core_md5(opad.concat(hash), 512 + 128);
+}
+
+/*
+ * Add integers, wrapping at 2^32. This uses 16-bit operations internally
+ * to work around bugs in some JS interpreters.
+ */
+function safe_add(x, y)
+{
+  var lsw = (x & 0xFFFF) + (y & 0xFFFF);
+  var msw = (x >> 16) + (y >> 16) + (lsw >> 16);
+  return (msw << 16) | (lsw & 0xFFFF);
+}
+
+/*
+ * Bitwise rotate a 32-bit number to the left.
+ */
+function bit_rol(num, cnt)
+{
+  return (num << cnt) | (num >>> (32 - cnt));
+}
+
+/*
+ * Convert a string to an array of little-endian words
+ * If chrsz is ASCII, characters >255 have their hi-byte silently ignored.
+ */
+function str2binl(str)
+{
+  var bin = Array();
+  var mask = (1 << chrsz) - 1;
+  for(var i = 0; i < str.length * chrsz; i += chrsz)
+    bin[i>>5] |= (str.charCodeAt(i / chrsz) & mask) << (i%32);
+  return bin;
+}
+
+/*
+ * Convert an array of little-endian words to a string
+ */
+function binl2str(bin)
+{
+  var str = "";
+  var mask = (1 << chrsz) - 1;
+  for(var i = 0; i < bin.length * 32; i += chrsz)
+    str += String.fromCharCode((bin[i>>5] >>> (i % 32)) & mask);
+  return str;
+}
+
+/*
+ * Convert an array of little-endian words to a hex string.
+ */
+function binl2hex(binarray)
+{
+  var hex_tab = hexcase ? "0123456789ABCDEF" : "0123456789abcdef";
+  var str = "";
+  for(var i = 0; i < binarray.length * 4; i++)
+  {
+    str += hex_tab.charAt((binarray[i>>2] >> ((i%4)*8+4)) & 0xF) +
+           hex_tab.charAt((binarray[i>>2] >> ((i%4)*8  )) & 0xF);
+  }
+  return str;
+}
+
+/*
+ * Convert an array of little-endian words to a base-64 string
+ */
+function binl2b64(binarray)
+{
+  var tab = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+  var str = "";
+  for(var i = 0; i < binarray.length * 4; i += 3)
+  {
+    var triplet = (((binarray[i   >> 2] >> 8 * ( i   %4)) & 0xFF) << 16)
+                | (((binarray[i+1 >> 2] >> 8 * ((i+1)%4)) & 0xFF) << 8 )
+                |  ((binarray[i+2 >> 2] >> 8 * ((i+2)%4)) & 0xFF);
+    for(var j = 0; j < 4; j++)
+    {
+      if(i * 8 + j * 6 > binarray.length * 32) str += b64pad;
+      else str += tab.charAt((triplet >> 6*(3-j)) & 0x3F);
+    }
+  }
+  return str;
+}

+ 1 - 1
src/main/ets/utils/LocalStorageHelper.ts → src/main/ets/utils/SZYXLocalStorageHelper.ts

@@ -1,3 +1,3 @@
-export class LocalStorageHelper{
+export class SZYXLocalStorageHelper{
   public static storage: LocalStorage = new LocalStorage();
 }

+ 1 - 1
src/main/ets/utils/LocalStorageKeys.ts → src/main/ets/utils/SZYXLocalStorageKeys.ts

@@ -1,5 +1,5 @@
 
-export class LocalStorageKeys{
+export class SZYXLocalStorageKeys{
   public static HttpHandlerList: string = 'httpHandlerList';
   public static HttpHandlerListLength: string = 'HttpHandlerListLength';
 }

+ 61 - 10
src/main/ets/utils/ToolsHelper.ets

@@ -3,11 +3,12 @@ import { BusinessError, deviceInfo } from '@kit.BasicServicesKit';
 import { HashMap } from '@kit.ArkTS';
 import { DeviceInfo } from '../bean/DeviceInfo';
 import { common } from '@kit.AbilityKit';
+import { md5_hex } from '../util/md5';
 
 export interface Btn {
   text?: string | Resource;
   color?: string | Resource;
-  onClick: () => void
+  onClick?: () => void
 }
 
 export interface AlertOptions {
@@ -19,8 +20,8 @@ export interface AlertOptions {
 export interface ConfirmOptions {
   title?: string
   msg?: string
-  confirm: Btn
-  cancel: Btn
+  confirm?: Btn
+  cancel?: Btn
 }
 
 export interface ListOptions<T> {
@@ -88,6 +89,12 @@ function customDialogBuilder<T>(option: ListOptions<T>, dialogId: number) {
   })
 }
 
+interface ThrottleInterface {
+  startTime: number; //调用的时间
+  timeoutNumber: number; //setTimeout的句柄
+}
+
+
 /**
  * 常用方法
  */
@@ -157,7 +164,7 @@ export class ToolsHelper {
         }]
       })
         .then(() => {
-          action?.onClick()
+          action?.onClick && action?.onClick()
         })
         .catch((err: Error) => {
           ToolsHelper.showMessage(err.message)
@@ -179,18 +186,18 @@ export class ToolsHelper {
         title: options.title,
         message: options.msg,
         buttons: [{
-          text: options.confirm.text ?? "确定",
-          color: options.confirm.color ?? "#000000",
+          text: options.confirm?.text ?? "确定",
+          color: options.confirm?.color ?? "#000000",
         }, {
-          text: options.cancel.text ?? "取消",
-          color: options.cancel.color ?? "#666666",
+          text: options.cancel?.text ?? "取消",
+          color: options.cancel?.color ?? "#666666",
         }]
       })
         .then((data) => {
           if (data.index === 0) {
-            options.confirm.onClick()
+            options.confirm?.onClick && options.confirm.onClick()
           } else {
-            options.cancel.onClick()
+            options.cancel?.onClick && options.cancel.onClick()
           }
         })
         .catch((err: Error) => {
@@ -276,4 +283,48 @@ export class ToolsHelper {
     }
     return ToolsHelper.deviceInfo
   }
+
+  /**
+   * 防抖动函数,调用后会延迟wait时间执行,当在wait时间内再次对同一函数调用,则会取消之前的定时器,重新定时
+   * @param fun
+   * @param wait
+   */
+  static debounceHold(fun: Function, wait: number = 1500) {
+    let funcValue1 = ToolsHelper.getUniqueId(fun)
+    let hash = md5_hex(funcValue1)
+    if (ToolsHelper.setTimeOutMap.get(hash)) {
+      clearTimeout(ToolsHelper.setTimeOutMap.get(hash)?.timeoutNumber)
+      ToolsHelper.setTimeOutMap.delete(hash)
+    }
+    // ToolsHelper.checkTimeOutNumber()
+    let timeoutNumber = setTimeout(() => {
+      ToolsHelper.setTimeOutMap.get(hash) && clearTimeout(ToolsHelper.setTimeOutMap.get(hash)?.timeoutNumber)
+      ToolsHelper.setTimeOutMap.delete(hash)
+      // 执行函数调用
+      fun()
+    }, wait)
+
+    ToolsHelper.setTimeOutMap.set(hash, {
+      timeoutNumber: timeoutNumber,
+      startTime: new Date().getTime(),
+    })
+
+  }
+
+  private static setTimeOutMap: Map<string, ThrottleInterface> = new Map()
+  private static uniqueIdMap = new WeakMap<Function, string>();
+
+  private static getUuid() {
+    return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, (c) => {
+      let r = (Math.random() * 16) | 0, v = c == 'x' ? r : (r & 0x3) | 0x8;
+      return v.toString(16);
+    });
+  }
+
+  private static getUniqueId(fun: Function): string {
+    if (!ToolsHelper.uniqueIdMap.has(fun)) {
+      ToolsHelper.uniqueIdMap.set(fun, ToolsHelper.getUuid());
+    }
+    return ToolsHelper.uniqueIdMap.get(fun)!;
+  }
 }